15280 + Interview Questions in Chemistry Page 2 InterviewSolution

51.	Which of the following non metals show/s an exceptional physical property/ies?
Answer» Which of the following non metals show/s an exceptional physical property/ies?

Discussion

52.	predict which of the following reaction(s) has a negative entropy change?CH4(g)+2O2(g)-->CO2(g)+2H2O(l)NH3(g)+HCl(g)-->NH4Cl(s)2KClO4(s)-->2KClO3(s)+O2(g)
Answer» predict which of the following reaction(s) has a negative entropy change? CH4(g)+2O2(g)-->CO2(g)+2H2O(l) NH3(g)+HCl(g)-->NH4Cl(s) 2KClO4(s)-->2KClO3(s)+O2(g)

Discussion

53.	Calculate the volume occupied by 35g of N2O4 when partially dissociated at 308K and 1 atm pressure, the degree of dissociation at the temperature being 27%.
Answer» Calculate the volume occupied by 35g of $N_{2} O_{4}$ when partially dissociated at 308K and 1 atm pressure, the degree of dissociation at the temperature being $27 %$ .

Discussion

54.	32. in a crystalline solid anions B are arragned in cubic close packing. cation A are equally distributed between octahedral and tetrahedral voids . if all the octahedral voids are occupies then formula of solid is 1 AB 2 AB2 3 A2B 4 A2B3
Answer» 32. in a crystalline solid anions B are arragned in cubic close packing. cation A are equally distributed between octahedral and tetrahedral voids . if all the octahedral voids are occupies then formula of solid is 1 AB 2 AB2 3 A2B 4 A2B3

Discussion

55.	In the following set of elements, one element does not belong to the set. Select this element and state why it does not belong : Oxygen, Nitrogen, Carbon, Chlorine, Fluorine
Answer» In the following set of elements, one element does not belong to the set. Select this element and state why it does not belong : Oxygen, Nitrogen, Carbon, Chlorine, Fluorine

55.

In the following set of elements, one element does not belong to the set. Select this element and state why it does not belong : Oxygen, Nitrogen, Carbon, Chlorine, Fluorine

Answer»

In the following set of elements, one element does not belong to the set. Select this element and state why it does not belong :

Oxygen, Nitrogen, Carbon, Chlorine, Fluorine

Discussion

56.	A white amphoteric oxide reacts with sodium hydroxide to give sodium zincate and water. Name this amphoteric oxide.
Answer» A white amphoteric oxide reacts with sodium hydroxide to give sodium zincate and water. Name this amphoteric oxide.

Discussion

57.	An aquatic food chain comprises the organisms like tadpoles, weeds, fish and water beetles. The organisms which get the minimum energy through this food chain is: (a) water beetles (b) tadpoles (c) weeds (d) fish
Answer» An aquatic food chain comprises the organisms like tadpoles, weeds, fish and water beetles. The organisms which get the minimum energy through this food chain is: (a) water beetles (b) tadpoles (c) weeds (d) fish

57.

An aquatic food chain comprises the organisms like tadpoles, weeds, fish and water beetles. The organisms which get the minimum energy through this food chain is: (a) water beetles (b) tadpoles (c) weeds (d) fish

Answer»

An aquatic food chain comprises the organisms like tadpoles, weeds, fish and water beetles. The organisms which get the minimum energy through this food chain is:

(a) water beetles (b) tadpoles (c) weeds (d) fish

Discussion

58.	Write balanced equation for the following reaction:Red lead (trilead tetroxide) is warmed with concentrated hydrochloric acid.
Answer» Write balanced equation for the following reaction: Red lead (trilead tetroxide) is warmed with concentrated hydrochloric acid.

Discussion

59.	the order of basic strength of CH4 HF NH3 H2O
Answer» the order of basic strength of CH4 HF NH3 H2O

Discussion

60.	Which of the following contains alcoholic group?
Answer» Which of the following contains alcoholic group?

Discussion

61.	2 In which of the following dative bond not present?
Answer» 2 In which of the following dative bond not present?

Discussion

62.	What is the product when m- chlorobenzaldehyde reacts with Cl_2 in presence of FeCl_3
Answer» What is the product when m- chlorobenzaldehyde reacts with Cl_2 in presence of FeCl_3

Discussion

63.	What happens when aqueous lead nitrate solution reacts with potassium iodide solution? Explain the type of reaction and balance the given equation
Answer» What happens when aqueous lead nitrate solution reacts with potassium iodide solution? Explain the type of reaction and balance the given equation

Discussion

64.	Zinc oxide is reduced to Metallic Zinc by:
Answer» Zinc oxide is reduced to Metallic Zinc by:

Discussion

65.	pH of saturated solution of Ca(OH)2 is 9. The solubility product (Ksp) of Ca(OH)2 is:
Answer» pH of saturated solution of $C a (O H)_{2}$ is 9. The solubility product $(K_{s p})$ of $C a (O H)_{2}$ is:

Discussion

66.	The mass of 350 cubic cm of a diatomic gas at 273K at 2atm is 1g. calculate the mass of 1 atom of the gas
Answer» The mass of 350 cubic cm of a diatomic gas at 273K at 2atm is 1g. calculate the mass of 1 atom of the gas

Discussion

67.	4. How many geometrical isomerism are possible for C2ClBrIF
Answer» 4. How many geometrical isomerism are possible for C2ClBrIF

Discussion

68.	Give the empirical formula of(a) C6H6(b) C6H12O6(c) C2H2(d) CH3COOH
Answer» Give the empirical formula of (a) C₆H₆ (b) C₆H₁₂O₆ (c) C₂H₂ (d) CH₃COOH

Discussion

69.	1 mole of He gas has 6.022×10x atoms. x is _____
Answer» 1 mole of He gas has $6.022 \times 10^{x}$ atoms. $x$ is _____

Discussion

70.	Identify the correct dot structure of O2 molecule?
Answer» Identify the correct dot structure of $O_{2}$ molecule?

Discussion

71.	What is the principle behind the construction of the long form of modern periodic table?
Answer» What is the principle behind the construction of the long form of modern periodic table?

Discussion

72.	A mixcture of CO2 and CO is passed over red hot graphite when 1 mole of mixture changes to 33.6L at stp. Mole fraction of CO2 in mixture is?
Answer» A mixcture of CO2 and CO is passed over red hot graphite when 1 mole of mixture changes to 33.6L at stp. Mole fraction of CO2 in mixture is?

Discussion

73.	The C-C and Si-C interatomic distances are154 pm and 188 pm. The atomic radius of Si is(1) 77 pm(3) 114 pm(2) 94 pm(4) 111 pm
Answer» The C-C and Si-C interatomic distances are154 pm and 188 pm. The atomic radius of Si is(1) 77 pm(3) 114 pm(2) 94 pm(4) 111 pm

Discussion

74.	Give two equations to show the conversion of a unsaturated compound to saturated compound.
Answer» Give two equations to show the conversion of a unsaturated compound to saturated compound.

Discussion

75.	why is the hydration enthalpy of alkaline earth metal ions greater then that of alkali metal ions?
Answer» why is the hydration enthalpy of alkaline earth metal ions greater then that of alkali metal ions?

Discussion

76.	Why does corrosion happen layer-by-layer
Answer» Why does corrosion happen layer-by-layer

Discussion

77.	Element 'A' (with minimum atomic number) in which last electron has n+m>3 but divisible by 3. How many given statements are correct about A? (n=Principal quantum number, m=magnetic quantum number) (i) Sum of group number and period number (in Modern Periodic table) is even number. (ii) Element belongs to s-block (iii) Element belongs to IIIA group number (iv) Element is a metal (v) Atomic number of element is divisible by 3. (vi) Another element B has an atomic number=atomic number of A+10, then element B belongs to IIIB group (vii) Element A has largest radius in their period. (viii) The group in which element is present, has maximum elements in the Modern Periodic Tab
Answer» Element 'A' (with minimum atomic number) in which last electron has n+m>3 but divisible by 3. How many given statements are correct about A? (n=Principal quantum number, m=magnetic quantum number) (i) Sum of group number and period number (in Modern Periodic table) is even number. (ii) Element belongs to s-block (iii) Element belongs to IIIA group number (iv) Element is a metal (v) Atomic number of element is divisible by 3. (vi) Another element B has an atomic number=atomic number of A+10, then element B belongs to IIIB group (vii) Element A has largest radius in their period. (viii) The group in which element is present, has maximum elements in the Modern Periodic Tab

Discussion

78.	Vertical columns in the periodic table starting from top to bottom are called __.
Answer» Vertical columns in the periodic table starting from top to bottom are called __.

Discussion

79.	What is the abbreviation for an element called?
Answer» What is the abbreviation for an element called?

Discussion

80.	In the given figure, the various trophic levels are shown in a pyramid. At which trophic level is maximum energy available?
Answer» In the given figure, the various trophic levels are shown in a pyramid. At which trophic level is maximum energy available?

Discussion

81.	What helps Diammine silver chloride to make silver chloride soluble in ammonium hydroxide???
Answer» What helps Diammine silver chloride to make silver chloride soluble in ammonium hydroxide???

Discussion

82.	Write the approximate colour of the following samples with the universal indicator:(a) distilled water(b) acid rain(c) soap solution(d) soil containing slaked lime(e) gastric juice
Answer» Write the approximate colour of the following samples with the universal indicator: (a) distilled water (b) acid rain (c) soap solution (d) soil containing slaked lime (e) gastric juice

Discussion

83.	Which among the following formation is not an example of Covalent bond?
Answer» Which among the following formation is not an example of Covalent bond?

Discussion

84.	Arrange the given metals in the order of increasing reactivity towards oxygen: Mg,Cu,K,Na
Answer» Arrange the given metals in the order of increasing reactivity towards oxygen: $M g, C u, K, N a$

Discussion

85.	Octet rule states that elements tend to combine in such a way that each atom has eight electrons in its valence shell. Why only 8 electrons?
Answer» Octet rule states that elements tend to combine in such a way that each atom has eight electrons in its valence shell. Why only 8 electrons?

Discussion

86.	56 The mass percentage of FeO ision present in Fe 931.00(1) 15%(2) 5.5%kx Z (3) 10.0%A 11.5%57
Answer» 56 The mass percentage of FeO ision present in Fe 931.00(1) 15%(2) 5.5%kx Z (3) 10.0%A 11.5%57

Discussion

87.	How does hyperconjugation increase the stability of alkenes ?
Answer» How does hyperconjugation increase the stability of alkenes ?

Discussion

88.	5. How to determine if a functional group attached to the benzene ring is planar or non-planar?
Answer» 5. How to determine if a functional group attached to the benzene ring is planar or non-planar?

Discussion

89.	The reactions in which a precipitate is formed are also known as:
Answer» The reactions in which a precipitate is formed are also known as:

Discussion

90.	37. The mass of n2o4 produced by the reaction of 2 g nh3 and 8 g of f2 is 3.56 g.What is the percent yield?
Answer» 37. The mass of n2o4 produced by the reaction of 2 g nh3 and 8 g of f2 is 3.56 g.What is the percent yield?

Discussion

91.	Write the name and general formula of a chain of hydrocarbons in which an addition reaction with hydrogen can take place. Stating the essential conditions required for an addition reaction to occur, write the chemical equation giving the name of the reactant and the product of such a reaction.
Answer» Write the name and general formula of a chain of hydrocarbons in which an addition reaction with hydrogen can take place. Stating the essential conditions required for an addition reaction to occur, write the chemical equation giving the name of the reactant and the product of such a reaction.

Discussion

92.	5. explain in detail electronic configuration of manganese
Answer» 5. explain in detail electronic configuration of manganese

Discussion

93.	A gas cylinder can withstand pressure of 20 atm. At 27°C gas has pressure of 15 atm. If temperature of room start rising due to sudden fire. Minimum temperature at which cylinder will explode isOptions: 375°C 127°C 300°C 210°C
Answer» A gas cylinder can withstand pressure of 20 atm. At 27°C gas has pressure of 15 atm. If temperature of room start rising due to sudden fire. Minimum temperature at which cylinder will explode is Options: 375°C 127°C 300°C 210°C

Discussion

94.	the equilibrium constant kp for the reaction A(g)+B(g)⇌C(g)+D(g) is 10^-12 AT 600K and 10^-7 at 800K calculate heat of reaction
Answer» the equilibrium constant kp for the reaction A(g)+B(g)⇌C(g)+D(g) is 10^-12 AT 600K and 10^-7 at 800K calculate heat of reaction

Discussion

95.	If an ion of 25Mn has a magnetic moment of3.873 B. M. Then Mn is in whichstate.a) +2b) 3c) +4d) 5
Answer» If an ion of 25Mn has a magnetic moment of3.873 B. M. Then Mn is in whichstate.a) +2b) 3c) +4d) 5

Discussion

96.	What do you understand by refining of metals?
Answer» What do you understand by refining of metals?

Discussion

97.	(a) Define an acid salt and a normal salt.(b) How many salts can be obtained from orthophosphoric acid? Is there any difference in the salts formed by the acid?
Answer» (a) Define an acid salt and a normal salt. (b) How many salts can be obtained from orthophosphoric acid? Is there any difference in the salts formed by the acid?

Discussion

98.	53 . Hydrogen exists as three isotopes - H, D, T and oxygen exists as two isotopes - O-16, O-18. HOW many radioactive water molecules are possible ?
Answer» 53 . Hydrogen exists as three isotopes - H, D, T and oxygen exists as two isotopes - O-16, O-18. HOW many radioactive water molecules are possible ?

Discussion

99.	32. G for the following reaction I2(s)+H2S(g)=2HI(g)+S(s) at 298k is given that G HI(g)=1.8kJper mole.G H2S(g)=33.8KJpermole Click here to view details:
Answer» 32. G for the following reaction I2(s)+H2S(g)=2HI(g)+S(s) at 298k is given that G HI(g)=1.8kJper mole.G H2S(g)=33.8KJpermole Click here to view details:

Discussion

100.	Question 5 Which of the following are correct structural isomers of butane? (i) (ii) (iii) (iv) (a) (i) and (iii) (b) (ii) and (iv) (c) (i) and (ii) (d) (iii) and (iv)
Answer» Question 5 Which of the following are correct structural isomers of butane? (i) (ii) (iii) (iv) (a) (i) and (iii) (b) (ii) and (iv) (c) (i) and (ii) (d) (iii) and (iv)

Discussion

Explore topic-wise InterviewSolutions in .

Which of the following non metals show/s an exceptional physical property/ies?

predict which of the following reaction(s) has a negative entropy change?CH4(g)+2O2(g)-->CO2(g)+2H2O(l)NH3(g)+HCl(g)-->NH4Cl(s)2KClO4(s)-->2KClO3(s)+O2(g)

Calculate the volume occupied by 35g of N2O4 when partially dissociated at 308K and 1 atm pressure, the degree of dissociation at the temperature being 27%.

32. in a crystalline solid anions B are arragned in cubic close packing. cation A are equally distributed between octahedral and tetrahedral voids . if all the octahedral voids are occupies then formula of solid is 1 AB 2 AB2 3 A2B 4 A2B3

In the following set of elements, one element does not belong to the set. Select this element and state why it does not belong : Oxygen, Nitrogen, Carbon, Chlorine, Fluorine

A white amphoteric oxide reacts with sodium hydroxide to give sodium zincate and water. Name this amphoteric oxide.

An aquatic food chain comprises the organisms like tadpoles, weeds, fish and water beetles. The organisms which get the minimum energy through this food chain is: (a) water beetles (b) tadpoles (c) weeds (d) fish

Write balanced equation for the following reaction:Red lead (trilead tetroxide) is warmed with concentrated hydrochloric acid.

the order of basic strength of CH4 HF NH3 H2O

Which of the following contains alcoholic group?

2 In which of the following dative bond not present?

What is the product when m- chlorobenzaldehyde reacts with Cl_2 in presence of FeCl_3

What happens when aqueous lead nitrate solution reacts with potassium iodide solution? Explain the type of reaction and balance the given equation

Zinc oxide is reduced to Metallic Zinc by:

pH of saturated solution of Ca(OH)2 is 9. The solubility product (Ksp) of Ca(OH)2 is:

The mass of 350 cubic cm of a diatomic gas at 273K at 2atm is 1g. calculate the mass of 1 atom of the gas

4. How many geometrical isomerism are possible for C2ClBrIF

Give the empirical formula of(a) C6H6(b) C6H12O6(c) C2H2(d) CH3COOH

1 mole of He gas has 6.022×10x atoms. x is _____

Identify the correct dot structure of O2 molecule?

What is the principle behind the construction of the long form of modern periodic table?

A mixcture of CO2 and CO is passed over red hot graphite when 1 mole of mixture changes to 33.6L at stp. Mole fraction of CO2 in mixture is?

The C-C and Si-C interatomic distances are154 pm and 188 pm. The atomic radius of Si is(1) 77 pm(3) 114 pm(2) 94 pm(4) 111 pm

Give two equations to show the conversion of a unsaturated compound to saturated compound.

why is the hydration enthalpy of alkaline earth metal ions greater then that of alkali metal ions?

Why does corrosion happen layer-by-layer

Vertical columns in the periodic table starting from top to bottom are called __.

What is the abbreviation for an element called?

In the given figure, the various trophic levels are shown in a pyramid. At which trophic level is maximum energy available?

What helps Diammine silver chloride to make silver chloride soluble in ammonium hydroxide???

Write the approximate colour of the following samples with the universal indicator:(a) distilled water(b) acid rain(c) soap solution(d) soil containing slaked lime(e) gastric juice

Which among the following formation is not an example of Covalent bond?

Arrange the given metals in the order of increasing reactivity towards oxygen: Mg,Cu,K,Na

Octet rule states that elements tend to combine in such a way that each atom has eight electrons in its valence shell. Why only 8 electrons?

56 The mass percentage of FeO ision present in Fe 931.00(1) 15%(2) 5.5%kx Z (3) 10.0%A 11.5%57

How does hyperconjugation increase the stability of alkenes ?

5. How to determine if a functional group attached to the benzene ring is planar or non-planar?

The reactions in which a precipitate is formed are also known as:

37. The mass of n2o4 produced by the reaction of 2 g nh3 and 8 g of f2 is 3.56 g.What is the percent yield?

Write the name and general formula of a chain of hydrocarbons in which an addition reaction with hydrogen can take place. Stating the essential conditions required for an addition reaction to occur, write the chemical equation giving the name of the reactant and the product of such a reaction.

5. explain in detail electronic configuration of manganese

A gas cylinder can withstand pressure of 20 atm. At 27°C gas has pressure of 15 atm. If temperature of room start rising due to sudden fire. Minimum temperature at which cylinder will explode isOptions: 375°C 127°C 300°C 210°C

the equilibrium constant kp for the reaction A(g)+B(g)⇌C(g)+D(g) is 10^-12 AT 600K and 10^-7 at 800K calculate heat of reaction

If an ion of 25Mn has a magnetic moment of3.873 B. M. Then Mn is in whichstate.a) +2b) 3c) +4d) 5

What do you understand by refining of metals?

(a) Define an acid salt and a normal salt.(b) How many salts can be obtained from orthophosphoric acid? Is there any difference in the salts formed by the acid?

53 . Hydrogen exists as three isotopes - H, D, T and oxygen exists as two isotopes - O-16, O-18. HOW many radioactive water molecules are possible ?

32. G for the following reaction I2(s)+H2S(g)=2HI(g)+S(s) at 298k is given that G HI(g)=1.8kJper mole.G H2S(g)=33.8KJpermole Click here to view details:

Question 5 Which of the following are correct structural isomers of butane? (i) (ii) (iii) (iv) (a) (i) and (iii) (b) (ii) and (iv) (c) (i) and (ii) (d) (iii) and (iv)