15280 + Interview Questions in Chemistry Page 35 InterviewSolution

1701.	What happens when sodium bicarbonate reacts with nitric acid?
Answer» What happens when sodium bicarbonate reacts with nitric acid?

Discussion

1702.	The percentage impurities present in 22 carat gold is
Answer» The percentage impurities present in 22 carat gold is

Discussion

1703.	A colloid is a __ (heterogeneous/homogeneous) mixture and its components can be separated by the technique known as centrifugation.
Answer» A colloid is a __ (heterogeneous/homogeneous) mixture and its components can be separated by the technique known as centrifugation.

Discussion

1704.	Question 44(a) The following reaction takes place when aluminium powder is heated with MnO2: 3MnO2(s)+4Al (s)→3Mn (l)+2Al2O3(l)+Heat Is aluminium getting reduced?
Answer» Question 44(a) The following reaction takes place when aluminium powder is heated with ${MnO}_{2}$ : $3 {MnO}_{2} (s) + 4 Al (s) \to 3 Mn (l) + 2 {Al}_{2} O_{3} (l) + Heat$ Is aluminium getting reduced?

Discussion

1705.	How to write word form of bond structure of ketone
Answer» How to write word form of bond structure of ketone

Discussion

1706.	Electronic configuration of: Element X: 2,8,2Element Y: 2,8,4Element Z: 2,8,7Which among the given element can be beaten into sheets easily?
Answer» Electronic configuration of: Element X: 2,8,2 Element Y: 2,8,4 Element Z: 2,8,7 Which among the given element can be beaten into sheets easily?

Discussion

1707.	Two flasks A and B of equal volumes are kept under similar conditions of temperature and pressure . If flasks A holds 16.2 g of gas X while flasks B holds 1.35 g of hydrogen , calculate the relative molecular mass of gas X ?
Answer» Two flasks A and B of equal volumes are kept under similar conditions of temperature and pressure . If flasks A holds 16.2 g of gas X while flasks B holds 1.35 g of hydrogen , calculate the relative molecular mass of gas X ?

Discussion

1708.	An element having electronic configuration 1s2,2s2 2p6, 3s2 3p6, 4s1forms
Answer» An element having electronic configuration 1s², 2s² 2p⁶, 3s² 3p⁶, 4s¹ forms

Discussion

1709.	A solution of sodium acetate in water will?
Answer» A solution of sodium acetate in water will?

Discussion

1710.	What is the order and molecularity of cannizaro reaction?
Answer» What is the order and molecularity of cannizaro reaction?

Discussion

1711.	Why is 1molar aqueous solution more concentrated than 1 molal aqueous solution?
Answer» Why is 1molar aqueous solution more concentrated than 1 molal aqueous solution?

Discussion

1712.	Ch3-ch(ch2)(CH3)-ch3---cl2-,uvlight---------major product will be
Answer» Ch3-ch(ch2)(CH3)-ch3---cl2-,uvlight---------major product will be

Discussion

1713.	Question 2Name two metals which are found in nature in the free state.
Answer» Question 2 Name two metals which are found in nature in the free state.

Discussion

1714.	39 1f EFe2+/Fe-0.441 V and EFe3+/Fe2+ 0.771 Vthe standard EMF of the reaction Fe 2Fe3+ -3Fe2 will be\lbrack AIPMT (Prelims)-2006\rbrack(1) 0.330 V(2) 1.653 V(3) 1.212 V(4) 0.111 V
Answer» 39 1f EFe2+/Fe-0.441 V and EFe3+/Fe2+ 0.771 Vthe standard EMF of the reaction Fe 2Fe3+ -3Fe2 will be\lbrack AIPMT (Prelims)-2006\rbrack(1) 0.330 V(2) 1.653 V(3) 1.212 V(4) 0.111 V

Discussion

1715.	42.The maximum number of electrons present in px orbital
Answer» 42.The maximum number of electrons present in px orbital

Discussion

1716.	When NaCl decomposes in the presence of water, product A, B and C are formed. When B reacts with D, bleaching powder is formed. What are A, B, C and D?
Answer» When NaCl decomposes in the presence of water, product A, B and C are formed. When B reacts with D, bleaching powder is formed. What are A, B, C and D?

Discussion

1717.	31. A metal forms two oxides. The higher oxide contains 20% oxygen , while 4.29g of the lower oxide when converted to higher oxide became 4.77g. The equivalent weight of the metal in higher oxide and lower oxide respectively are? (1)16 and 32.2 (2) 32.2 and 16 (3) 64.4 and 32 (4) 32 and 64.4
Answer» 31. A metal forms two oxides. The higher oxide contains 20% oxygen , while 4.29g of the lower oxide when converted to higher oxide became 4.77g. The equivalent weight of the metal in higher oxide and lower oxide respectively are? (1)16 and 32.2 (2) 32.2 and 16 (3) 64.4 and 32 (4) 32 and 64.4

Discussion

1718.	Select from the following list: [4 MARKS] Fe2O3,NO,SO3,PbO,Mn2O7 (a) Basic oxide ...... (b) Amphoteric oxide ...... (c) Acidic oxide ...... (d) Neutral oxide .....
Answer» Select from the following list: [4 MARKS] $F e_{2} O_{3}, N O, S O_{3}, P b O, M n_{2} O_{7}$ (a) Basic oxide ...... (b) Amphoteric oxide ...... (c) Acidic oxide ...... (d) Neutral oxide .....

Discussion

1719.	Write down the physical properties of Bases.
Answer» Write down the physical properties of Bases.

Discussion

1720.	Which of the following bond/s contain ions?(i) Ionic bond(ii) Covalent bond(iii) Metallic bond
Answer» Which of the following bond/s contain ions? (i) Ionic bond (ii) Covalent bond (iii) Metallic bond

Discussion

1721.	Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?
Answer» Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?

1721.

Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?

Answer»

Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?

Discussion

1722.	nta vessel contain 28gm N2, 32 gm O2, T = 1000K and P = 2 atm . find pressure if N2 dissociates30% and O2 50%, temperature remaining constantn
Answer» nta vessel contain 28gm N2, 32 gm O2, T = 1000K and P = 2 atm . find pressure if N2 dissociates30% and O2 50%, temperature remaining constantn

Discussion

1723.	Which amongst the following is a positional isomer of CH3−CH2−CH=CH3
Answer» Which amongst the following is a positional isomer of ${CH}_{3} - {CH}_{2} - CH = {CH}_{3}$

Discussion

1724.	what is the trend of effective nuclear charge in a group and period ?
Answer» what is the trend of effective nuclear charge in a group and period ?

Discussion

1725.	What will you observe when concentrated HCl is added to lead (IV) oxide and warmed?
Answer» What will you observe when concentrated HCl is added to lead (IV) oxide and warmed?

Discussion

1726.	The result of adding a small crystal of NaCl to a saturated solution of NaCl is that:
Answer» The result of adding a small crystal of NaCl to a saturated solution of NaCl is that:

Discussion

1727.	What type of chemical reactions are represented by the following equations ? (i) A+BC⟶AC+B (ii) A+B⟶C (iii) X⟶Y+Z (iv) PQ+RS⟶PS+RQ (v) A2O3+2B⟶B2O3+2A
Answer» What type of chemical reactions are represented by the following equations ? (i) $A + B C ⟶ A C + B$ (ii) $A + B ⟶ C$ (iii) $X ⟶ Y + Z$ (iv) $P Q + R S ⟶ P S + R Q$ (v) $A_{2} O_{3} + 2 B ⟶ B_{2} O_{3} + 2 A$

1727.

What type of chemical reactions are represented by the following equations ? (i) A+BC⟶AC+B (ii) A+B⟶C (iii) X⟶Y+Z (iv) PQ+RS⟶PS+RQ (v) A2O3+2B⟶B2O3+2A

Answer»

What type of chemical reactions are represented by the following equations ?

(i) $A + B C ⟶ A C + B$

(ii) $A + B ⟶ C$

(iii) $X ⟶ Y + Z$

(iv) $P Q + R S ⟶ P S + R Q$

(v) $A_{2} O_{3} + 2 B ⟶ B_{2} O_{3} + 2 A$

Discussion

1728.	What is the mass of oxygen required to react completely with 15g of H2 gas to form water?
Answer» What is the mass of oxygen required to react completely with 15g of $H_{2}$ gas to form water?

Discussion

1729.	20ml of 0.2N NaOH, 40ml of 0.1N Ca (OH)2 and 40ml of KOH solutions are mixed and the total volume of the mixture is made up to 500ml. Calculate the POH and PH of the mixture
Answer» 20ml of 0.2N NaOH, 40ml of 0.1N Ca (OH)2 and 40ml of KOH solutions are mixed and the total volume of the mixture is made up to 500ml. Calculate the POH and PH of the mixture

Discussion

1730.	The noble gases are unreactive because
Answer» The noble gases are unreactive because

Discussion

1731.	Which bubble would give 20 as the answer?
Answer» Which bubble would give 20 as the answer?

Discussion

1732.	48. The composition of KClO3(s) takes place- KClO3→ KCl+O2 ↓ KClO4+KCl . If 2gm sample of KClO3 on complete decomposition gives 224ml of O2 at STP, then calculate percentage by mass of KCl in the residue.
Answer» 48. The composition of KClO3(s) takes place- KClO3→ KCl+O2 ↓ KClO4+KCl . If 2gm sample of KClO3 on complete decomposition gives 224ml of O2 at STP, then calculate percentage by mass of KCl in the residue.

Discussion

1733.	5. If 2 moles ofSF4 is mixed with 18g of H2O then incorrect statement is 1 only 0.5 mole of SF4 is reacted 2 H2O is limiting reagent 3 2 moles of HF is formed 4 1 mole of SO2 is formed Reaction= SF4 +2H2O=SO2+4HF
Answer» 5. If 2 moles ofSF4 is mixed with 18g of H2O then incorrect statement is 1 only 0.5 mole of SF4 is reacted 2 H2O is limiting reagent 3 2 moles of HF is formed 4 1 mole of SO2 is formed Reaction= SF4 +2H2O=SO2+4HF

Discussion

1734.	Draw the IUPAC structure for 1-chlorocycloproane carbaldehyde with explanation and steps
Answer» Draw the IUPAC structure for 1-chlorocycloproane carbaldehyde with explanation and steps

Discussion

1735.	Green chemistry is the study of an approach that aims to________.
Answer» Green chemistry is the study of an approach that aims to________.

Discussion

1736.	Why does hydrogen gas burns with a pop sound?
Answer» Why does hydrogen gas burns with a pop sound?

Discussion

1737.	Bond angle in water molecules is 104.5^° instead of109 28' mainly because of (1) Lone pair-bond pair repulsion (2) Bond pair-lone pair repulsion (3) Lone pair-lone pair replusion (4) Bond pair-bond pair repulsion
Answer» Bond angle in water molecules is 104.5^° instead of109 28' mainly because of (1) Lone pair-bond pair repulsion (2) Bond pair-lone pair repulsion (3) Lone pair-lone pair replusion (4) Bond pair-bond pair repulsion

Discussion

1738.	Explain the principle of the method of electrolytic refining of metals. Give one example.
Answer» Explain the principle of the method of electrolytic refining of metals. Give one example.

Discussion

1739.	In the calcination process, the ore is heated in
Answer» In the calcination process, the ore is heated in

Discussion

1740.	can the process of rusting be called combustion
Answer» can the process of rusting be called combustion

Discussion

1741.	In the reaction 3MnO2+4Al→3Mn+2Al2O3, the oxidising agent is
Answer» In the reaction $3 M n O_{2} + 4 A l \to 3 M n + 2 A l_{2} O_{3}$ , the oxidising agent is

Discussion

1742.	Which of the following statements are true?
Answer» Which of the following statements are true?

Discussion

1743.	what is concentration of ores?
Answer» what is concentration of ores?

Discussion

1744.	An element with atomic number 34 belongs to1) s-block 2) p-block3) d-block 4) f-block
Answer» An element with atomic number 34 belongs to 1) s-block 2) p-block 3) d-block 4) f-block

Discussion

1745.	Show the bond formation in the structure of hydronium ion and ammonium ion.
Answer» Show the bond formation in the structure of hydronium ion and ammonium ion.

Discussion

1746.	What is hydronium ion and how is it formed
Answer» What is hydronium ion and how is it formed

Discussion

1747.	Dalton's law of partial pressure
Answer» Dalton's law of partial pressure

Discussion

1748.	in alcohol if there is repulsion between lone pair of electron why it doesn't increase the bond angle ? why it less than tetrahedral angle.
Answer» in alcohol if there is repulsion between lone pair of electron why it doesn't increase the bond angle ? why it less than tetrahedral angle.

Discussion

1749.	Write the electronic configuration for the following atoms: Magnesium (Mg) Neon (Ne) Boron (B) Fluorine (F)
Answer» Write the electronic configuration for the following atoms: Magnesium (Mg) Neon (Ne) Boron (B) Fluorine (F)

Discussion

1750.

Match the following: Column A Column B 1. A substance that turns moist starch iodide paper blue. A. Ammonium sulphate 2. A compound which releases a reddish brown gas on reaction with concentrated sulphuric acid and copper turnings. B. Lead carbonate 3. A solution of this compound gives a dirty green precipitate with sodium hydroxide. C. Chlorine 4. A compound which on heating with sodium hydroxide produces a gas which forms dense white fumes with hydrogen chloride. D. Copper nitrate 5. A white solid which gives a yellow residue on heating. E. Ferrous sulphate

Answer» Match the following:

Column A		Column B
1.	A substance that turns moist starch iodide paper blue.	A.	Ammonium sulphate
2.	A compound which releases a reddish brown gas on reaction with concentrated sulphuric acid and copper turnings.	B.	Lead carbonate
3.	A solution of this compound gives a dirty green precipitate with sodium hydroxide.	C.	Chlorine
4.	A compound which on heating with sodium hydroxide produces a gas which forms dense white fumes with hydrogen chloride.	D.	Copper nitrate
5.	A white solid which gives a yellow residue on heating.	E.	Ferrous sulphate

Discussion

Explore topic-wise InterviewSolutions in .

What happens when sodium bicarbonate reacts with nitric acid?

The percentage impurities present in 22 carat gold is

A colloid is a __ (heterogeneous/homogeneous) mixture and its components can be separated by the technique known as centrifugation.

Question 44(a) The following reaction takes place when aluminium powder is heated with MnO2: 3MnO2(s)+4Al (s)→3Mn (l)+2Al2O3(l)+Heat Is aluminium getting reduced?

How to write word form of bond structure of ketone

Electronic configuration of: Element X: 2,8,2Element Y: 2,8,4Element Z: 2,8,7Which among the given element can be beaten into sheets easily?

Two flasks A and B of equal volumes are kept under similar conditions of temperature and pressure . If flasks A holds 16.2 g of gas X while flasks B holds 1.35 g of hydrogen , calculate the relative molecular mass of gas X ?

An element having electronic configuration 1s2,2s2 2p6, 3s2 3p6, 4s1forms

A solution of sodium acetate in water will?

What is the order and molecularity of cannizaro reaction?

Why is 1molar aqueous solution more concentrated than 1 molal aqueous solution?

Ch3-ch(ch2)(CH3)-ch3---cl2-,uvlight---------major product will be

Question 2Name two metals which are found in nature in the free state.

39 1f EFe2+/Fe-0.441 V and EFe3+/Fe2+ 0.771 Vthe standard EMF of the reaction Fe 2Fe3+ -3Fe2 will be\lbrack AIPMT (Prelims)-2006\rbrack(1) 0.330 V(2) 1.653 V(3) 1.212 V(4) 0.111 V

42.The maximum number of electrons present in px orbital

When NaCl decomposes in the presence of water, product A, B and C are formed. When B reacts with D, bleaching powder is formed. What are A, B, C and D?

31. A metal forms two oxides. The higher oxide contains 20% oxygen , while 4.29g of the lower oxide when converted to higher oxide became 4.77g. The equivalent weight of the metal in higher oxide and lower oxide respectively are? (1)16 and 32.2 (2) 32.2 and 16 (3) 64.4 and 32 (4) 32 and 64.4

Select from the following list: [4 MARKS] Fe2O3,NO,SO3,PbO,Mn2O7 (a) Basic oxide ...... (b) Amphoteric oxide ...... (c) Acidic oxide ...... (d) Neutral oxide .....

Write down the physical properties of Bases.

Which of the following bond/s contain ions?(i) Ionic bond(ii) Covalent bond(iii) Metallic bond

Shivam took a beaker containing a basic solution and added a metal to the solution. What will happen after the addition of copper metal ?

nta vessel contain 28gm N2, 32 gm O2, T = 1000K and P = 2 atm . find pressure if N2 dissociates30% and O2 50%, temperature remaining constantn

Which amongst the following is a positional isomer of CH3−CH2−CH=CH3

what is the trend of effective nuclear charge in a group and period ?

What will you observe when concentrated HCl is added to lead (IV) oxide and warmed?

The result of adding a small crystal of NaCl to a saturated solution of NaCl is that:

What type of chemical reactions are represented by the following equations ? (i) A+BC⟶AC+B (ii) A+B⟶C (iii) X⟶Y+Z (iv) PQ+RS⟶PS+RQ (v) A2O3+2B⟶B2O3+2A

What is the mass of oxygen required to react completely with 15g of H2 gas to form water?

20ml of 0.2N NaOH, 40ml of 0.1N Ca (OH)2 and 40ml of KOH solutions are mixed and the total volume of the mixture is made up to 500ml. Calculate the POH and PH of the mixture

The noble gases are unreactive because

Which bubble would give 20 as the answer?

48. The composition of KClO3(s) takes place- KClO3→ KCl+O2 ↓ KClO4+KCl . If 2gm sample of KClO3 on complete decomposition gives 224ml of O2 at STP, then calculate percentage by mass of KCl in the residue.

5. If 2 moles ofSF4 is mixed with 18g of H2O then incorrect statement is 1 only 0.5 mole of SF4 is reacted 2 H2O is limiting reagent 3 2 moles of HF is formed 4 1 mole of SO2 is formed Reaction= SF4 +2H2O=SO2+4HF

Draw the IUPAC structure for 1-chlorocycloproane carbaldehyde with explanation and steps

Green chemistry is the study of an approach that aims to________.

Why does hydrogen gas burns with a pop sound?

Bond angle in water molecules is 104.5^° instead of109 28' mainly because of (1) Lone pair-bond pair repulsion (2) Bond pair-lone pair repulsion (3) Lone pair-lone pair replusion (4) Bond pair-bond pair repulsion

Explain the principle of the method of electrolytic refining of metals. Give one example.

In the calcination process, the ore is heated in

can the process of rusting be called combustion

In the reaction 3MnO2+4Al→3Mn+2Al2O3, the oxidising agent is

Which of the following statements are true?

what is concentration of ores?

An element with atomic number 34 belongs to1) s-block 2) p-block3) d-block 4) f-block

Show the bond formation in the structure of hydronium ion and ammonium ion.

What is hydronium ion and how is it formed

Dalton's law of partial pressure

in alcohol if there is repulsion between lone pair of electron why it doesn't increase the bond angle ? why it less than tetrahedral angle.

Write the electronic configuration for the following atoms: Magnesium (Mg) Neon (Ne) Boron (B) Fluorine (F)