Explore topic-wise InterviewSolutions in .

A solution contains 30ml of ethyl alcohol mixed with 100ml of water. What is the concentration of the solution in terms of volume by volume percentage?

What will be the valency of an element having atomic number (Z)=7?

Write the distribution of electrons in an atom of an element whose atomic number is 18. What is special about the outermost electron shell (or valence shell) of the atom of this element?

The properties of water are different from the properties of the elements of which it is formed. Discuss.

The charge carried by an electron is ___.

What is the number of hydrogen atoms in hexyne?

The number of electron hydrogen contains in its K shell is-

Choose the correct match for the property of compounds.

How particles scatter light in collidation

Hydrogen is collected by the _______ displacement of _______ .

What is the molar mass of hydrated salt of $N{a}_{2}C{O}_3.10H_{2}O$?

Evaporation is considered to be a ___ and can take place at ___

Which catalyst helps in reducing air pollution?

What is the valency of the cation, if it is known that the valency of each anion is -4.?

Define diffusion explain the rate of order of diffusion in solids liquids and gases and state the effect of temperature on diffusion

1. Convert the following temperature to Celsius scale.

(A)293 K

(B)470K

2. Convert the following temperature to kelvin scale.

(A)25degree C

(B)373degree C

The correct order of atomic radii of fe+2,fe+3,fe+4

Central part of the atom where neutrons and protons are held together is known as__.

Solid are generally very heavy while gases are light. Explain

Two gases found dissolved in natural water are

(a) oxygen and carbon dioxide

(b) hydrogen and oxygen

(c) sulphur dioxide and hydrogen

(d) chlorine and ammonia

Neon occurs as two isotopes of mass numbers 20 and 22. Its relative atomic mass is 20.2. What is the percentage of ²⁰Ne in naturally occurring neon?

A mixture of chalk powder and water can be separated using the technique of filtration because:

Which solvent can be used to obtain sodium chloride from a mixture of sodium chloride and sulphur without using water?

X is the most abundant element in the atmosphere. In which of the following case element X cannot be used?

The symbol of a metal element which is used in making thermometers is:

For the symbols H, D and T, write the subatomic particles (protons, neutrons and electrons) found in each one of them.

Name a liquid which can be classified as a pure substance and conducts electricity.

Alloy is considered a mixture. Give 3 reason to support your answer

Chlorofluorocarbons(CFCs) are widely used in air conditioner and refrigerators etc because of being

Boiling does not occur when:

While $F{e}^{3+}$ is stable, $M{n}^{3+}$ is not stabe in acid solution because:
$(M{n}^{3+}+e^{-}\to M{n}^{2+},E^{\circ }=1.5V;O_2+4H^{+}+4e^{-}\to 2H_{2}O,E^{\circ }=+1.23V;F{e}^{3+}+e^{-}\to F{e}^{2+},E^{\circ }=0.77V)$

Which among the given equations is an example of the reaction of metal carbonate with hydrochloric acid?

During the electrolysis of water, large amount of hydronium ions are produced when water is acidified with

The process of burning subtstance in oxygen is called ___ .

5.0 g of a certain element X forms 10.0g of its oxide having the formula $X_4{O}_6$. The atomic mass of X is ?

Which one of the following reactions is an example of decomposition reaction?

What is the weight percentage of solution formed by dissolving 30g salt in 270 g water?

Design an experiment to show that air contains water vapour. [3 MARKS]

How does the increase in temperature affect the solubility of solids and gases?

Which of these reactions releases hydrogen gas?

A farmer while cultivating his farm by mistake added a lot of pesticides with a pH 2 into the soil. What will be the effect on his crops?

Which one of the following is not a chemical change?

(a) Formation of curd (b) Ripening of banana

(c) Sublimation of naphthalene (d) Corrosion of photo frame