InterviewSolution
Saved Bookmarks
InterviewSolution
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your Class 11 knowledge and support exam preparation. Choose a topic below to get started.
| 1051. |
Why H3BO3 is an acid |
| Answer» Because when it is heated with water than it remove h+ of water<br>Boric acid ( H3BO3) or B(OH)3. This is because boric acid does not act as proton donor rather it accepts a lone pair of electrons from OH- ions. There by acting as monobasic lewis acid. | |
| 1052. |
IUPAC NAMES OF CH3-CH2-CH(OH)-CH2-CH2-CH(CH3)-CH2-CH3 |
| Answer» 6-Methyleoctane3-ol<br>Sorry it\'s 6 methyl octan-3 ol<br>66 methyl octan-3ol<br>6-Methyl-3-octanol<br>6-methyl octan-3-ol<br>6-Methyloctan-3-ol<br>Water | |
| 1053. |
What are metamers? |
| Answer» Compounds having the same molecular formula but different number of carbon atoms ( alkyl groups) on either side of functional group are called metamers | |
| 1054. |
Under what condition will a reaction be spontaneous if delta h and delta s both are negative |
| Answer» Delta g is positive | |
| 1055. |
How to Write IUPAC name of (CH3)3-C-CH2-C-(CH3)3 ? |
| Answer» 2,2,4,4-tetramethylpentane<br>2,2,4,4-tetramethylpentane<br>2,2,4 tetrapentane<br>2,2,4,4-Tertrapentane | |
| 1056. |
Difference between quick lime, slaked lime and lime water |
| Answer» A white caustic alkaline substance consisting of calcium oxide, which is obtained by heating limestone and which combines with water with the production of much heat; lime.Slaked lime is chemically calcium hydroxide, and its chemical formula is Ca(OH)2. It is a white coloured solid which is obtained when water is added to calcium oxide (CaO). Lime water on the other hand is a saturated solution of slaked lime in water. | |
| 1057. |
Why do trihalides of group 13 elements fume in moist air??? |
| Answer» | |
| 1058. |
Hydrogen atoms of ethyne are acidic in nature,why? |
| Answer» Because in ethyne there is 50℅ s character so carbon atom attach to triple bond is most electronegative from alkane and alkene So b/w the CH bond polarity is created and Hpositive is obtained which is acidic in nature | |
| 1059. |
Why after hydrolysis one atom has a sextet electronic structure and a positive charge |
| Answer» | |
| 1060. |
What it means:- " LiCl is deliquescent and crystallises as a hydrate, LiCl.2H2O" plz help me |
| Answer» Deliquescent ka matlab jo asani se atmosphere ke water ke sath react karle<br>Deliquescent means presence of water<br>Deliquescent k to pata nhi but licl me lithium ke small size ki wajah se lithium ki hydration enthalpy jyada hoti hai so uske sare salts hydrated hote hai | |
| 1061. |
What is oxidation no. |
| Answer» The total number of electrons that an atom either gains or loses in order to form a chemical bond with another atom is known as oxidation number | |
| 1062. |
What do you mean by hydration enthalpy |
| Answer» The hydration enthalpy is the enthalpy change when 1 mole of gaseous ions dissolve in sufficient water to give an infinitely dilute solution. Hydration enthalpies are always negative.............?? | |
| 1063. |
10ml of a given solution of H2O2 contain 0.91g of H2O2 express its strength in volume |
| Answer» | |
| 1064. |
Write down the conjugate acid for the bronsted base CN- and F- |
| Answer» HCN of CN- and HF of F- | |
| 1065. |
What is the accurate definition of transition elements? |
| Answer» Elements which have partially filled d or f block are called transition elements | |
| 1066. |
Significance of Uncertainty Principle..in short and simple |
| Answer» The Heisenberg uncertainty principle is a law in quantum mechanics that limits how accurately you can measure two related variables. Specifically, it says that the more accurately you measure the momentum (or velocity) of a particle, the less accurately you can know its position, and vice versa | |
| 1067. |
Solid state important topics |
| Answer» Packing efficiency,problems | |
| 1068. |
What is moleculer orbital theory |
| Answer» what is Molecular orbital theoryResults in Englishआणविक कक्षीय सिद्धांत क्या हैहिन्दी में नतीजेMolecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryImage result for what is Molecular orbital theoryView allMolecular orbital theory uses a linear combination of atomic orbitals to represent molecular orbitals resulting from bonds between atoms. These are often divided into three types, bonding, antibonding, and non-bonding. ... The molecular orbitals of a molecule can be illustrated in molecular orbital diagrams.<br>Molecular orbital theory is a method developed in the beginning of twentieth century by F. Hund and R. S. Mulliken to describe the structure and properties of different molecules. Before molecular orbital theory, there was no clear and distinctive theory about the bonding and non-bonding electrons and how their arrangement in a molecule affects the structure of the molecule. In this method the electrons are not assigned to a particular bond between atoms, rather they are treated as moving under the influence of the nuclei of the molecule. The space in a molecule in which the probability of finding an electron is maximum is known as molecular orbital. | |
| 1069. |
What is formula of boyle law |
| Answer» P1v1=p2v2<br>Boyle\'s law= P1V1=P2V2.<br>P1/p2=v2/v1<br>P1×V1=P2×V2 | |
| 1070. |
Which is more acidic -ethanoic acid or methanoic acid? |
| Answer» Ethanoic acid<br>I agree,formic acid is more acidic in nature.<br>methanoic acid doesn\'t contain electron releasing group and there is no inductive effect.The larger the positive inductive effect, the lesser will be the strength of an acid. Hence, methanoic acid (formic acid) is stronger than ethanoic acid<br>Methanoic acid is more acidic | |
| 1071. |
What is the oxidation number of Fe in [Fe(CN)6]4- |
| Answer» 2<br>Let the oxidation no. of Fe be xx + -6 = -4x = +2<br>+2 | |
| 1072. |
Define Aromaticity . ? |
| Answer» Thanks<br>plz tell us how to upload pics on this app<br>Aromatic compounds\xa0are substances that consist of one or more rings that contain alternating single and double bonds in its chemical structure. In real life, many aromatic compounds have an odor, however, there are some compounds that are chemically aromatic, but do not have a distinct smell.For example, benzene is an aromatic compound.\xa0<br>The term \'aromatic\' is used by chemists for substances with distinct odors. In this lesson, we will learn all about aromatic compounds, the features of such compounds\' chemical structures, and Huckel\'s Rule.What Are Aromatic CompoundsTake a moment and think of substances that have a strong fragrance. What kind of things come to your mind? Perfume, vanilla or, perhaps, even cinnamon? All of these are fragrant or\xa0aromatic. While they certainly smell differently, they do have something in common: these substances are made of aromatic compounds.\xa0\t<caption align="bottom">These substances are made of aromatic compounds.</caption>\t\t | |
| 1073. |
What is inert pair effect?☺☺ |
| Answer» The inert pair effect is the tendency of the two electrons in the outermost atomic s-orbital to remain unionized or unshared in compounds of post-transition metals. Due to this, the element down the group possess lower oxidation state of that group and becomes stable....?? | |
| 1074. |
What is the definition of covalent Bond |
| Answer» The force of attaraction created between homo or hetero nuclear atoms by mutual sharing of electron is called covalent bond<br>Bond formed due to sharing of eletron<br>The bond which is formed by mutal sharing of electron between two atoms<br>bond in which one or more pairs of electron are shared by two atoms | |
| 1075. |
Define the methods of preparations of alkane...!! |
| Answer» 1 .Decarboxylation.......2. Wurtz Reaction...3.By the Reduction of Alkyl Halides.....4. By Hydrogenation of Alkenes((>C=C<) .... 5. Kolbe\'s Electrolysis Method. | |
| 1076. |
Define nucleophiles |
| Answer» Nucleophiles are the anions or electron rich compounds that donate electrons. These are nucleus ( + ve charge) loving. Eg. OH``, Cl``, Br`` , PCl5 ( electron rich).<br>Nucleophiles:- a nucleophile is an attacking reagent with love or attraction for the nucleus of positive centre. It is therefore either negatively charged or neutral but with atleast one lone pair of electrons which it can easily donate. | |
| 1077. |
What are reducing agents? |
| Answer» Acceptor of electron<br>Reducing agents are species which reduce the other substance by oxidizing itself (by lowering the oxidation number ) | |
| 1078. |
Why Beryllium is not considered as alkaline Earthmetal? |
| Answer» Because it shows anomalous behaviour........due to this it won\'t be considered... | |
| 1079. |
Hos to calculate molarity and molality? |
| Answer» Molarity=mass of solute/molecular mass of solute*1000/vol. Of solution. Molality=mass of solute/molecular mass of solute*1000/mass of solvent | |
| 1080. |
Why is potassium lighter than sodium |
| Answer» The increase in shell size outweighs the pull of the core on the outer shell electron. So K is lighter than Na. | |
| 1081. |
Discuss the similarities and disimilarities between 1s and 2s orbitals? |
| Answer» Difference- Energy level, distance from nucleus and angular nodeSimilarities -No nodal planes, shape | |
| 1082. |
Electrofile |
| Answer» Electrophile are the ions or compund which have postive charge or the tendency to gain electrons ( electron deficient ) . Therefore we can say that electrophile are the ones which love electrons. Eg. H+, Na+,Mg2+ , BF3, AlCl3. Since AlCl3 and BF3 doesnot have + ve charge yet they are electrophile because they are electron deficient (they will attract electron) ........<br>Electophilic means electron loving species.<br>Species which preferencially attack on electrons are electrophile | |
| 1083. |
Neutron was discovered by whom ? |
| Answer» In the year 1932, James Chadwick discovered neutrons, another subatomic particle. He bombarded a thin sheet of beryllium by α-particles and found that electrically neutral particles with a mass slightly greater than that of the proton were being emitted. Chadwick called these particles as neutrons. | |
| 1084. |
What is the difference between nascent hydrogen and atomic hydrogen |
| Answer» Atomic hydrogen: Atomic hydrogen is extremely reactive, being more reactive than ordinary, nascent, or adsorbed oxygen. When it is passed over metals or non-metals, it forms hydrides at normal temperatures, excepting for nitrogen, to which it does not react. Atomic hydrogen is an extremely powerful reducing agent, reducing oxides chlorides and sulphides of some metals like Ag, Hg, Cu etc. to metals at ordinary temperature.Nascent Hydrogen: The hydrogen gas, which is just liberated as a result of a chemical is called nascent hydrogen or newly born hydrogen. It is obtained by passing dihydrogen gas at atmospheric pressure through an electric arc between two tungsten rods. The electric arc maintains a temperature around 4000 - 4500°C. As the molecules of dihydrogen gas pass through the electric arc, these absorb energy and get dissociated into atoms as nascent hydrogen. It is more reactive than ordinary hydrogen and its colour is not discharged. (pink in colour). For example, if ordinary hydrogen is passed through acidified KMnO4 it does not get decolourised. However, if zinc pieces are added to the same solution, bubbles of hydrogen rise up through the solution and the colour is discharged due to the reduction of KMnO4 by nascent hydrogen. | |
| 1085. |
Spontaneous reaction |
| Answer» Spontaneous reaction is the reaction which does not require outside help to start. | |
| 1086. |
How does dihydrogen reacts with halogens like chlorine and fluorine |
| Answer» Dihydrogen reacts with halogens(X) to form halideH2 + X2 ----. 2HX. | |
| 1087. |
How can we prepare methane from ethane |
| Answer» Ethane to MethaneCH3-CH3 + Cl2/light --------> CH3-CH2-ClCH3-CH2-Cl + KOH (aq) ---------> CH3-CH2-OHCH3-CH2-OH + K2Cr2O7/H2SO4 --------------> CH3-COOHCH3-COOH + NaOH --------> CH3-COONaCH3-COONa + CaO + NaOH + heat ---------> CH4 | |
| 1088. |
Describe corey-house reaction |
| Answer» | |
| 1089. |
What is halide gap ????????? |
| Answer» Explain<br>Gap from group 17 to 19 | |
| 1090. |
What are herbicides |
| Answer» Which can kill germs and undesirable crops like sodium chlorate | |
| 1091. |
Define law of octaves |
| Answer» \tIn 1864, Newlands arranged the known 56 elements in the order of increasing atomic masses.\tHe observed that the properties of every eighth element are similar to the properties of the first element.\tBased on this observation, he proposed the Law of Octaves for the classification of elements.Law of Octaves: When the elements are arranged in the increasing order of their atomic masses, the properties of every eighth element are similar to the first. | |
| 1092. |
Salt analysis of aluminium chloride,zinc carbonate, |
| Answer» | |
| 1093. |
Salt anaylysis of Copper sulphate |
| Answer» | |
| 1094. |
How to get the electronic configuration no. Of a given element?? |
| Answer» Use the atomic number to fill orbitals according to energy level 1s2 2s2 2p3 3s2.... | |
| 1095. |
How to calculate oxidation no |
| Answer» oxidation state for a particular atom is calculated by equating the sum of the various charges on each atom to the the net charge on the respective compound<br>O.N. will be 0 at native state<br>By calculating the num of charge on it | |
| 1096. |
Pauli exclusion principal |
| Answer» no two electrons in an atom can have same set of 4 quantum number or only two electrons may exist in the same orbital and these electrons must have opposite spin. | |
| 1097. |
The ph of soft drink is 3.76. calculate the concentration of hydrogen ion in it |
| Answer» 10 to the power -3.76 | |
| 1098. |
Why doesn\'t elemental phosphoric acid is heated strongly? |
| Answer» | |
| 1099. |
Why branched chains exhibit weak vanderwaal force as compared to normal chains??? |
| Answer» branched alkanes have weaker van der waals forces because of the smaller area of contact between the molecules.so less energy is needed to overcome the intermolecular force.Linear alkanes can line up more closer and therefore have stronger van der waals forces than unbranched alkanes.so just remember that van der waals forces are stronger when there is more area of contact between molecules, and obviously area of contact is smaller in branched molecules compared to linear molecules (when they both have the same molecular formula).<br>It\'s because when we observed the boiling point of alkane and branched we find that branched has low boiling point which means vanderwaal force is less.That\'s all i knowMay be it is due to the open chain has large area and no. of molecules which would add van der waal force. Hope this would help.<br>Please answer...........i am stuck... | |
| 1100. |
What is isoalkyl group |
| Answer» | |