This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Give two reasons to justify-is a logia.la) water at room temperature is a liqu(b) an tron almirah is a solid at room temperature.ling than wate |
| Answer» | |
| 2. |
balance this redox reaction. fes+ h2o2----feo+so2+h2o |
| Answer» | |
| 3. |
Calculate the oxidation numbupnurDefine entropy, what are the conditions for entropy when system(a) Equilibrium(b) Spontaneous(c)Non Spontaneous. |
|
Answer» entropy is a thermodynamic quantity representing the unavailability of a system's thermal energy for conversion into mechanical work, often interpreted as the degree of disorder or randomness in the system. According to the Second Law of Thermodynamics a spontaneous change results in an increase in theentropyof the universe. In an isolated system, when the system'sentropyreaches the maximum, the system stays there because any further change would reduceentropy. That's obviously theequilibriumposition. The second law of thermodynamics states that a process involving an isolatedsystemwill bespontaneousif theentropyof thesystemincreases over time. ... In many processes, the increase inentropyof the surroundings is accomplished via heat transfer from thesystemto the surroundings (i.e. an exothermic process). In order for a reaction to benonspontaneous, it must be endothermic, accompanied by a decrease inentropy |
|
| 4. |
5.1 Define the terms oxidation, reduction, oxidant andreductant in terms of electron transfer. |
| Answer» | |
| 5. |
8. What is an oxidation reaction ? Give an example of oxidation reaction. Is oxidation anexothermic or an endothermic reaction ? |
|
Answer» 1 |
|
| 6. |
what is oxidation?What are the types of oxidation? |
|
Answer» oxidation is the burning of substance in air. It is of three types :-1. rapid oxidation 2. slow oxidation 3. spontaneous oxidation oxidations means the substance which give away electrons eg: as iron reacts with oxygen it forms rust .like ZnSO 4 |
|
| 7. |
Which of the following are identical compounds?CH3-COOHCH,HOẶCHO-НОGTCOOHLI |
|
Answer» I think its b and d......... |
|
| 8. |
(if) (CH32CHâCOOH. |
|
Answer» Ans :- IUPAC name - tridecanoic acidtridecylic acid
|
|
| 9. |
1. Name the following compounds:(i)CH3-CH2-OH(ii)CH3-C=O |
|
Answer» (I) CH3 - CH2 - OHThe IUPAC name of CH3-CH2-OH is Ethanol. But the common name is Ethyl Alcohol. (2) CH3-CH=OAcetaldehyde (systematic name ethanal) |
|
| 10. |
कक... रू. कक कक: उ'प्प्का मे लिखि्ति(*) =g न्यूनता दोष वाला क्रिस्टल है-) Nacii) ko(i) FeO(v)Zno |
|
Answer» धातु न्यूनता दोष वाला क्रिस्टल FEoहै |
|
| 11. |
. What is the ratio between the rate of decomFosinon of N、O, to rate of formation of NO, ?(APM-2015)1) 1000 2) 9903) 9990 4) 90 |
|
Answer» According to your equation it takes 2 moles of N2O5 to make one mole of Oxygen. So, the oxygen will be made at half the rate at which the N2O5 is destroyed. |
|
| 12. |
ZnO crystal on heating acquires the formula Zn iO. Give reason. |
| Answer» | |
| 13. |
What is an oxidation reaction? Identify in the following reaction (a) the substanceoxidized, and (b) the substance reduced:ZnO CZnCO |
| Answer» | |
| 14. |
when an acid react with base than it gives |
|
Answer» Acid rainis caused by nitrogen oxides and sulfur dioxide produced by both natural processes and the combustion of fossil fuels. Eventually, these oxidesreactwith oxygen and water to give nitricacidand sulfuricacid. Reactionbetween sodium hydroxide andnitric acidis a textbook example ofacid baseneutralisation. Sodium ions combine with nitrate ions to form sodium nitrite and hydrogen ionsreactwith hydroxide ions to form water. ... Naturally when anacidandbase react, they form salt and water. |
|
| 15. |
What is an oxidation reaction? Identify in the following reaction (a) the substanceoxidized, and (b) the substance reduced:ZnO + C-> Zn + CO |
| Answer» | |
| 16. |
/. What is the ratio between the rate of decom-position of N2O to rate of formation of NO2?(APM-2015)1) 1000 2) 990 3) 9990 4 90 |
|
Answer» According to your equation it takes 2 moles of N2O5 to make one mole of Oxygen. So, the oxygen will be made at half the rate at which the N2O5 is destroyed. |
|
| 17. |
(3) CH,CH,OHa) CH COOH |
|
Answer» Sodium doesn't reacts with ethershenceoption c |
|
| 18. |
7.6 What is the covalence of nitrogen in N2O,? |
| Answer» | |
| 19. |
Which of the following compound show acid-base reaction with Grignard reagent?(B)CH3(C) 11(D) CH3-C C-CH3 |
|
Answer» C is the correct answer of this questions option c is the correct answer |
|
| 20. |
7. Write the IUPAC names of the following alkynes.C2H, CH3i) CH3-C-C-C=C-CH,CH3 HCHsii) CH3 -CH2-CH- CH-C CHCH |
| Answer» | |
| 21. |
Write the IUPAC name of the given compound:CH3- CH- CH2-O CH2- CHsCH3 |
|
Answer» 1-ethoxy-2-methyl-propane |
|
| 22. |
Foom PZ 3.DIChol is react whithPhosphoves toia IobileTin present of red PhospouerIobine gives alkyl Iobine |
|
Answer» Alcohols react with liquid phosphorus(III) chloride (also called phosphorus trichloride) toyield chloroalkanes. 3CH3CH2CH2OH+PCl3→3CH3CH2CH2Cl+H3PO3 |
|
| 23. |
Iron sulphate (FeSO4) + Copper turnings (Cu) |
|
Answer» &/÷^*( Since copper is below iron in the reactivity series, it is less reactive than iron, so it will not replace the iron in the compound. So there is no reaction, and the equation should be written as: Cu(s) + FeSO4(aq)→no reaction when Iron nail(ferrum)is dipped in copper sulphate(cuso4) there takes reaction between them and copper sulphate change its color form blue to light green .This shows Iron is more reactive than copper it can replace copper form cuso4. cuso4 is in blue color and feso4 is a light green colour |
|
| 24. |
b) Write the name of FeSO4 and PbCl2. |
|
Answer» Feso4= iron sulphateis the correct answer Feso4=iron sulphatepbcl2= lead chloride where lead valency is. 2 here 1. iron sulphate 2. lead chloridethis is your answer 1)Feso4: iron sulphate2)Pbci2: lead chloride 1)- Iron sulphate2)- lead chloride ferrous sulfate for FeSo4 and Lead chloride for pbcl2 ferrous sulphate and lead chlofide Iron sulphate and lead chloride |
|
| 25. |
A compound 'X' on heating with excess concentrated sulphuric acid at 443K gives an unsaturated compound 'Y' 'X' also react swithodium metal to evolve a colourless gas Z'.Identify X',Y'and Z'. Write the equation of the chemical reaction of formationof r |
|
Answer» X→443Kconc.H2SO4Y ( unsaturated compound)Z is hydrogen (Colourless gas) X, Y and Z are alcohol, alkene and hydrogen respectively. Suppose X is ethanol,it gives alkene on reacting with conc. H2SO4 C2H5OH (X)→443Kconc.H2SO4 C2H4(Y) 2C2H5OH→Na2C2H5O-Na++ H2(Z) Role of sulphuric acid: It is used as a dehydrating agent in the above reaction. |
|
| 26. |
genatichofAlkaneAikare is rectang whith halogenL in pregeht er sunligh it giveAlkaji Halide |
|
Answer» The reaction of a halogen with an alkane in the presence of ultraviolet (UV) light or heat leads to the formation ofa haloalkane (alkyl halide).An example is the chlorination of methane. |
|
| 27. |
Which of the following is basic in nature.A) N2O4.B) CaOC) H,0D) HC |
|
Answer» Option B is correct. |
|
| 28. |
12. Find the oxidation number of introgen in thefollowing compounds:(a) N20 (b) NO (c) N203 (d) NO2 (e) N20ss. |
|
Answer» a) -1b) -2c) -3d) -4e) -5 |
|
| 29. |
7. Write the Name of the following compounds.(i) CH CH COOH(ii) C,Hco |
|
Answer» 1) Propionic acid is a naturally occurring carboxylic acid with chemical formula CH₃CH₂CO₂H 2) benzene |
|
| 30. |
Write the followinhe following reactions in the form of chemical1. Reaction of irorReaction of iron with oxygen and water |
|
Answer» 4Fe + 3O2 + 6H2O → 4Fe(OH)3. reaction of iron with oxygen cause rusting reaction of iron with oxygen and water is rusting 4Fe + 3O2 + 6H2O = 4Fe(OH)3 reaction of iron and oxygen is caused rusting 4fe+3o2+6H2o=4fe(OH)3 4Fe +3O2+6H2O=4fe(OH)3 the process is called rusting |
|
| 31. |
3. write the following equations as word eqFeSO4 - Fe2O3 + SO2 + SO312 |
|
Answer» The thermal decomposition of iron(II) sulfate to produce iron(III) oxide, sulfur dioxide and oxygen. This reaction takes place at a temperature near 700°C. Impurities: oxide sulfur() SO3. |
|
| 32. |
O hie fie/C/Users/add/DoCHEMISTRYQ.1: Define atomic number. |
|
Answer» Atomic number is defined as the number of protons that a chemical element has in its nucleus. |
|
| 33. |
of Student: -ite IUPAC name of following compoBr |
|
Answer» 2-Bromo-2,3-dimethylpentane 2-bromo 2,3di methyl pentane |
|
| 34. |
10. Write the IUPAC name ofCI Br |
| Answer» | |
| 35. |
19.Which of the following is the best conductor ofelectricity ?a) IM HNO, b) IM CH COOHc) IM NHOH d) 1M H,SO4 |
|
Answer» option d , because... H2SO4 , will break into 3 ions . |
|
| 36. |
What is the oxidation number of N in N3H? |
| Answer» | |
| 37. |
5) What is the oxidation number of Cr in Cr202 ? |
|
Answer» In the dichromate ion, the oxidation number of chromium is+6. The sum of the oxidation numbers in Cr2O72-, a polyatomic ion, is -2, the charge of the ion. |
|
| 38. |
Q. 7. Define solid angle. What are its units ? |
|
Answer» Steradian, unit of solid-angle measure in the International System of Units (SI), defined as the solid angle of a sphere subtended by a portion of the surface whose area is equal to the square of the sphere’s radius. TheSIunitofsolid angleisthesteradian (sr).The solid angleof a complete sphere is 4π sr.The solid anglecorresponding totheface of a cube measured atthecentre is 2π/3 sr. One steradian is equal to (180/π)2square degrees. Steradian,unitofsolid-anglemeasure in the International System ofUnits(SI),definedas thesolid angleof a sphere subtended by a portion of the surface whose area is equal to the square of the sphere's radius. Steradian,unitofsolid-anglemeasure in the International System ofUnits(SI),definedas thesolid angleof a sphere subtended by a portion of the surface whose area is equal to the square of the sphere's radius. The solid angle is the angle created in three-dimensional space that an object subtends at a point. Solid angle is a measure of how big an object appears to an observer when looking from that point. The symbol for solid angle is Ω (Greek letter omega). A solid angle can be defined in terms of an area on the surface of a sphere which is centred at the vertex of the angle. This is the equivalent of defining a planar angle in terms of the length of arc on a circle subtended to the centre. Solid angle can also be defined as an angle formed by three or more planes intersecting at a common point (the vertex). The SI unit of solid angle is the steradian (sr). The solid angle of a complete sphere is 4π sr. The solid angle corresponding to the face of a cube measured at the centre is 2π/3 sr. One steradian is equal to (180/π)2square degrees. three-dimensional analogue of an angle, such as that subtended by a cone or formed by planes meeting at a point. It is measured in steradians |
|
| 39. |
explain basic nature of metal hydroxides. |
|
Answer» From left to right on the periodic table, acid-base characterof oxides andhydroxidesgo frombasicto acidic. - Increasing charge on an anion increases the production ofbasicsolutions. - As electronegativity increase, production of ionic cations increases because elements are more able to adopt a cation. Metallicoxides arebasicinnaturebecause they react with dilute acids to form salt and water. They also react with water to formmetal hydroxideswhich are alkaline innaturebecause thesemetal hydroxidesrelease OH- ions in solution. Therefore, nonmetallicoxides would be acidic innature. |
|
| 40. |
4)WntetheIUPACnameof the element with atomic number 104.5)What is the oxidation number of Mn in Mno,? |
|
Answer» hit like if you find it useful |
|
| 41. |
5)What is the oxidation number of Mn in MnQ.? |
|
Answer» hit like if you find it useful 4)Rutherfordium is a syntheticchemical elementwith symbol Rf andatomic number 104, named after physicist Ernest Rutherford. As a synthetic element, it is not found in nature and can only be created in a laboratory. It is radioactive; the most stable known isotope,267Rf, has a half-life of approximately 1.3 hours. Let oxidation number of Mn be x in the compound.Oxidation number of oxygen is - 2By average oxidation number method, X-2-1=0X=+3So, oxidation number of Mn is +3 |
|
| 42. |
e3.5.1 MOLECULAR MASS |
|
Answer» An atom a fundamental piece of matter. (Matter is anything that can be touched physically.) Everything in the universe (except energy) is made of matter, and, so, everything the mass of a molecule that is equal to the sum of the masses of all the atoms contained in the molecule |
|
| 43. |
Why NH3 is less basic than PH, ? |
|
Answer» This is because of the electronegitivity and size difference in the elements N and P. N has a higher electronegitivity and pulls the electrons in the N-H bonds toward itself, creating amorepolar bondthanthe P-H bond. N issmaller thanP thus it is a better lewis base, being able to formmorestable sigma bonds. please pic is clearly |
|
| 44. |
Harpreet's motorbike is facing towards West. He turns left anddrives 10 km and turns left again and drives 10 km. Then he turns rightand drives 40 km. He turns right again and drives 30 km. lastly, he turnsright and drives 50 km. How far is Harpreet from the starting point?(A) 10 km(C) 40 km(B) 20 km(D) 60 km |
|
Answer» Ending and starting point are on the same line and they are 20kms away from each other. |
|
| 45. |
how will you convert Methane to methanol |
|
Answer» is it not so hard 4r 11th grade students... plzzz is this an organic chemistry question? or you are asking for general industrial process? organic chemistry question Then the first equation is the answer to your question. It is selective addition process but I can't able to understand that actually 😧😧 |
|
| 46. |
eaction of methanol with ammonia? |
| Answer» | |
| 47. |
I=Integral(sin(x)^4, x) |
| Answer» | |
| 48. |
31. Spin angular momentum of an electron is given by1n h2/2m22π2 27T |
|
Answer» spin angular momentum has two components namely +(h/2 pi)(1/2) and -(h/2 pi)(1/2) on the specified axis. |
|
| 49. |
What is the value of the gravitational constant? |
| Answer» | |
| 50. |
With what velocity should an α-particle travel towards thenucleus of a copper atom so as to arrive at a distance10-13 m from the nucleus of the copper atom? (1997) |
| Answer» | |