Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Study the Periodic Table and answer the following questions:(i) Na has physical and chemical properties similar to which element(s) and why?(ii) Write the electronic configuration of N and P. Which one of these will be more electronegative and why?PERIODGROUPIIIIIIIVVVIVIIZero1.HHe2.LiBeBCNOFNe3.NaMgAlSiPSClAr4.KCa

Answer»

(i) Na has similar properties as of the same group members as K, Rb, Cs. They contain 1 valence in the outermost shell so all of them are reactive.

(ii) Nitrogen:- 2,5

Phosphorus:- 2,8,5

Electronegativity is a measure of how strongly atoms attract bonding electrons to themselves.

Nitrogen is more electronegative because in nitrogen outermost shell is nearer to nucleus and nucleus will attract electrons easily.

2.

Name:(a) a chloride which is insoluble in cold water but dissolves in hot water,(b) a chloride which is insoluble,(c) two sulphates which are insoluble,(d) a basic salt,(e) an acidic salt,(f) a mixed salt,(g) a complex salt,(h) a double salt,(i) two salts whose solubility increases with temperature,(j) a salt whose solubility decreases with temperature.

Answer»

(a) Lead chloride

(b) Silver chloride

(c) Barium sulphate and lead sulphate

(d) Basic lead chloride

(e) Sodium hydrogen sulphate

(f) Sodium potassium carbonate

(g) Sodium argentocyanide

(h) Potash alum

(i) Potassium bromide and potassium chloride

(j) Calcium sulphate

3.

Elements have been arranged in the following sequence on the basis of their increasing atomic masses. F, Na, Mg, Al, Si, P, S, Cl, Ar, K  (a) Pick two sets of elements that have similar properties. (b) The given sequence represents which law of classification of elements?

Answer»

(a) (i) F and Cl  (ii) Na and K. 

(b) Newland’s law of octaves.

4.

An element has an atomic number of 15 with which of the following elements will it show similar chemical properties? (a) Be(4) (b) Ne(10) (c) N(7) (d) O(8)

Answer»

N(7) it show similar chemical properties.

5.

The three elements A, B and C with similar properties have atomic masses X, Y, and Z respectively. The mass of Y is approximately equal to the average mass of X and Z. What is such an arrangement of elements called as? Give one example of such a set of elements.

Answer»
  • The arrangement of these elements is known as Dobereiner & triad.
  •   Example, Lithium, Sodium and Potassium.
6.

Which of the following set of elements is written in order of their increasing metallic character? (a) Be Mg  Ca (b) Na Li  K (c) Mg Al Si (d) C O N

Answer»

The answer is (a) Be Mg Ca

  • Metallic character increase as we move down the group. 
  • In the elements that belong to same group Berrylium is at the top and Calcium is at the bottom.
7.

Which 2 criteria did Mendeleev use to classify the elements in his table.

Answer»

(i) Increasing order of atomic mass and similarities in chemical properties of elements. 

(ii) The formula of oxides and hydrides formed by elements.

8.

Which of the following set of elements is written in order of their increasing metallic character?A. Be Mg Ca B. Na Li K C. Mg Al Si D. C O N

Answer»

Down the group metallic character increases and across the period metallic character decreases. Only option (a) follows the right order.

9.

What is the formula of oxide and hydride of Group I elements?

Answer»

Oxide formula → R2

Hydride formula → RH. 

‘R’ represents element.

10.

Name three elements discovered later, which filled gaps left by Mendeleev for them.

Answer»

Scandium, gallium and germanium. 

11.

Why did Mendeleev left gaps in his Periodic Table?

Answer»

Mendeleev left some gaps for undiscovered elements, because he predicted that there would be such elements which will fit in the gaps in future. He also predicted the properties of these elements.

12.

Why could no fixed position be given to hydrogen in Mendeleev's Periodic Table ?

Answer»

It is because it resembles both with alkali metals as well as halogens.

13.

Answer the following questions related to salts and their preparations:(a) What is a ‘salt’?(b) What kind of salt prepared by direct combination. Write an equation for the reaction that takes place in preparing the salt you have named.(c) Name a salt prepared by direct combination. Write an equation for the equation for the reaction that takes place in preparing the salt you have named.(d) Name the procedure used to prepare a sodium salt such as sodium sulphate.

Answer»

(a) Salt is a compound formed by the partial or total replacement of the ionizable hydrogen atoms of an acid by a metallic ion or an ammonium ion.

(b) An insoluble salt can be prepared by precipitation.

(c) A salt prepared by direct combination is Iron (III) chloride.

Reaction:

2Fe +3Cl2 2FeCl3

(d) The name of the procedure used to prepare a sodium salt such as sodium sulphate is Neutralization of acid with base.

14.

In Mendeleev’s Periodic Table, gaps were left for the elements to be discovered later. Which of the following elements found a place in the periodic table later?A. Germanium B. Chlorine C. Oxygen D. Silicon

Answer»

Germanium was the element which found the place later in periodic table but Mendeleev predicted germanium to as eka-silicon.

15.

Why could no fixed position be given to hydrogen in Mendeleev’s Periodic Table.

Answer»

Hydrogen had no fixed position in Mendeleev’s Periodic table because it resembles alkali metal by forming positive ions and resembles halogens by forming diatomic molecule.

16.

Which group of elements could be placed in Mendeleev’s periodic table later on, without disturbing the original order ? Give reason.

Answer»

Noble gases. Since they are chemically unreactive, so they got a place in the periodic table in the form of a separate group and hence did not disturb the original order of Mendeleev’s periodic table

17.

Which group of elements could be placed in Mendeleev's Periodic Table without disturbing the original order? Give reason

Answer»

Inert gases (Noble gases) could be placed in Mendeleev’s Periodic Table without disturbing the original order.

  • Before Mendeleev Noble gases; like Helium. Neon and Argon had been mentioned by various scientists. 
  • But these gases could be grouped together as noble gases much later than Mendeleev’s discovery.
  • Mendeleev used 63 elements till his periodic table because these were the only known elements till his time. 
  • However, he was bold enough to leave gaps in his periodic table. 
  • He had predicted that that more elements would be discovered in times to come.
  • Mendeleev’s Periodic Table was the first comprehensive attempt to classify elements on the basis of their chemical properties. 

This is the main reason that new elements could be easily placed in Mendeleev’s Periodic Table without disturbing the original order.

18.

Calculate the total number of electrons present in one mole of methane.

Answer»

No. of electrons in one molecule of methane (CH4)

= 6 + 4 = 10

No. of electrons in one mole of methane

= 10 x 6.023 x 1023

= 6.023 x 1024

19.

Calculate the charge of one mole of electrons.

Answer»

Charge of one electron is 1.6 × 10−19 Coulomb.

The mass of one mole of electrons is :

6.023 × 1023 × 9.1 × 10−31Kg = 5.48 × 10−7 Kg

The charge of one mole of electrons is:

6.023 × 1023 × 1.6 × 10−19 Coulomb  

= 9.65 × 10Coulomb

20.

Calculate the mass and charge of one mole of electrons.

Answer»

1 mol = 6.023 x 1023 units

Mass of 1 mol of electrons = Mass of an electron x 6.023 x 1023

= 9.1 x 10-31 kg x 6.023 x 1023

= 5.48 x 10-7 kg

Charge on 1 mol of electrons = charge on an electron x 6.023 x 1023

= 1.602 x 10-19 C x 6.023 x 1023

= 9.65 x 104 C.

21.

Write the IUPAC name of the following :CH3 - CH2 - CHO

Answer»

The IUPAC name is CH3 - CH2 - CHO

Propanal.

22.

Write IUPAC name of :

Answer»

3-Hydroxybutanoic acid/3-hydroxybutan-1-oic acid.

23.

Calculate the mass and charge of one mole of electrons.

Answer»

Mass of 1 mol of e- = 9.1 x 10-31 x 6.022 x 1023 kg = 54.8 x 10-8 kg 

Charge of 1 mol e- = 1.6x10-19 x6.022 x 1023 = 96487 C

24.

What are hermaphrodites ?

Answer»

The animal bearing both male and female sex organs are called hermaphrodites. Example, earthworms, sponge and tapeworm.

25.

Write the IUPAC name of the compound having the given formula(a) CH3COCH2COCH3(b) CH3-CH2-CH(CHO)-CH2CH3(c) CH3CH2CH(OH)CH2CHO

Answer»

(a) Pentane-2,4-dione

(b) 2-Ethylbutanal

(c) 3- Hydroxypentanal

26.

Write the IUPAC name of :

Answer»

Pent-3-yne-1-oic acid.

27.

Write the IUPAC name of

Answer»

3- Aminobutanal.

28.

In vegetative propagation, characters of parent plants are: (a) Changed(b) Not preserved(c) preserved(d) Exchanged

Answer»

In vegetative propagation, characters of parent plants are preserved

29.

Write the IUPAC name of :

Answer»

Pent -2-len-1-al.

30.

What are antherozoids ?

Answer»

The male gamete or male reproductive unit is called antherozoid or spermatozoa.

31.

What do you mean by staminate?

Answer»

The unisexual male flower bearing stamens is called staminate.

32.

Select the one which is not helping vegetative propagation.(a) Bulb (b) Clone (c) Adventitious (d) Eyes of the potato

Answer»

Clone is not helping vegetative propagation. 

33.

How would you show that silver is chemically less reactive than copper ?

Answer»

If a strip of silver metal is kept immersed in copper sulphate solution for some time, then no reaction occurs. This shows that silver is not able to displace copper from copper sulphate solution.

34.

What are the technical terms used to denote unisexual condition?

Answer»

Heterothallic and dioecious.

35.

What are the technical terms used for a bisexual condition?

Answer»

Homothallic and monoecious.

36.

A unisexual ower having no androecium is called ..............a) Dithecous b) Dioecious c) Monoecious d) Pistillate

Answer»

(d) Pistillate

37.

Give reasons for the following :Blue colour of copper sulphate solution is destroyed when iron filings are added to it.

Answer»

Blue color of copper sulphate is destroyed because iron displaces copper from copper sulphate solution as iron is more reactive than copper.

38.

Name one bisexual and one unisexual animal.

Answer»

Bisexual animal — Earthworm 

Unisexual animal — Cockroach

39.

Name a non-metal having a very high melting point.

Answer»

Diamond. is very high melting point

40.

Which property of graphite is utilised in making electrodes ?

Answer»

Since graphite is a good conductor of electricity, it is used in making electrodes.

41.

Write true or false for the following statements: A solution of an ionic compound in water contains ions, which move to the opposite electrodes when electricity is passed through the solution.

Answer»

True

A solution of an ionic compound in water contains ions, which move to the opposite electrodes when electricity is passed through the solution.

42.

Write true or false for the following statements: Copper reacts vigorously with dilute HCl.

Answer»

False

Copper is below hydrogen in the reactivity series. Therefore copper cannot displace H from HCl.

43.

Give plausible explanation for each of the following:i. Cyclohexanone forms cyanohydrin in good yield but 2,2,6 trimethylcyclohexanone does not.ii. There are two -NH2 groups in semicarbazide. However, only one is involved in the formation of semicarbazones.iii. During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.

Answer»

i. In cyclohexanone, the carbonyl carbon is not hindered. Hence, the nucleophile CN-ion can easily attack the carbonyl carbon. However in 2,2,6-trimethyl cyclohexanone, the carbonyl carbon is sterically hindered due to presence of methyl groups. Hence, the nucleophile CN- ion cannot easily attack the carbonyl carbon.

ii. Out of two -NH2 groups in semicarbazide, one is a part of amide functional group. In this, the lone pair on nitrogen atom is involved in the resonance with carbonyl group. Hence, this -NH2 group cannot act as a nucleophile. Hence, it is not involved in the formation of semicarbazones.

iii. The formation of esters from a carboxylic acid and alcohol in the presence of an acid catalyst is a reversible reaction. If water or ester is not removed as soon as it is formed, the ester will hydrolyse to give starting materials carboxylic acid and alcohol.

44.

Write true or false for the following statements: Hydrogen gas is evolved when a metal reacts with nitric acid.

Answer»

False 

The hydrogen gas obtained from the reaction of metal and nitric acid is oxidized to water by nitric acid.

45.

Write true or false for the following statements: Silver and gold react with oxygen at high temperatures.

Answer»

False 

Silver and gold do not react with oxygen at high temperatures.

46.

Write true or false for the following statements:Copper does not burn in air, but the hot metal is coated with a black coloured layer of copper (II) oxide.

Answer»

True

Copper does not burn in air

47.

Write true or false for the following statements: Iron does not burn on heating but iron filings burn vigorously when sprinkled in the flame of the burner.

Answer»

True

Iron does not burn on heating but iron filings burn vigorously when sprinkled in the flame of the burner.

48.

Give the IUPAC name and write the functional group present in vinegar.

Answer»

Vinegar IUPAC name is acetic acid CH3COOH 

Functional group –COOH

49.

An organic compound X which is sometimes used as an antifreeze has the molecular formula C2H6O. X on oxidation gives a compound Y which gives effervescence with a baking soda solution. Identify X and Y. Write the chemical equation of reaction.

Answer»

X is ethanol (C2H5OH) and Y is ethanoic acid (C2H4O2)

(C2H5OH) (X) \(\overset{Oxidation}\longrightarrow\) CH3COOH (Y)

2CH3COOH + Na2CO3 (Baking soda) → 2CH3COOHNa + CO2↑ + H2O

50.

What is rearing process?

Answer»

RearIng: To take care and support up to maturity is called rearing.