Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

α, β are the roots of the equation x2 + 4x + 5. Find α3 + β3

Answer»

α, β are the roots of the equation x2 + 4x + 5. Find α3 + β3


2.

Three faces of a fair dye are yellow, two faces red and one blue. The die is tossed three times. The probability that the colours, yellow red and blue appear in first, second and the third tosses respectively is ............

Answer»

Three faces of a fair dye are yellow, two faces red and one blue. The die is tossed three times. The probability that the colours, yellow red and blue appear in first, second and the third tosses respectively is ............


3.

If the radius of sphere is measured as 7 m with an error of 0.02 m, then the approximate error in calculating its volume is

Answer»

If the radius of sphere is measured as 7 m with an error of 0.02 m, then the approximate error in calculating its volume is


4.

The area bounded by(y−2)2=x−1 the tangent to it at the point whose ordinate is 3 and the x – axis is (in sq.units)___

Answer» The area bounded by(y2)2=x1 the tangent to it at the point whose ordinate is 3 and the x – axis is (in sq.units)___
5.

A straight line, makes an angle of 60∘ with each of y and z-axis,then the inclination of the line with x-axis is

Answer»

A straight line, makes an angle of 60 with each of y and z-axis,then the inclination of the line with x-axis is

6.

Three coins are tossed once. Let A denote the event "three heads show ", B denote the event "two heads and one tail show", c denote the event "three tails show" and D denote the event "a head show on the first coin", Which events are (i) mutually exclusive ? (ii) simple ? (iii) compound?

Answer»

Three coins are tossed once. Let A denote the event "three heads show ", B denote the event "two heads and one tail show", c denote the event "three tails show" and D denote the event "a head show on the first coin", Which events are (i) mutually exclusive ? (ii) simple ? (iii) compound?


    7.

    The negation of "Ram and Rahim are not brave" is .

    Answer»

    The negation of "Ram and Rahim are not brave" is .

    8.

    The circle x2+y2+2gx+2fy+c=0 does not intersect x-axis, if

    Answer»

    The circle x2+y2+2gx+2fy+c=0 does not intersect x-axis, if


    9.

    The ratio of the area of a triangle inscribed in a parabola to the area of the triangle formed by the tangents drawn at the vertices of the triangle is

    Answer» The ratio of the area of a triangle inscribed in a parabola to the area of the triangle formed by the tangents drawn at the vertices of the triangle is
    10.

    If exp[(sin2x+sin4x+sin6x+....∞)loge2, satisfies the equation x2−9x+8=0, then the value of cosxcosx+sinx, 0<x<π2 is

    Answer»

    If exp[(sin2x+sin4x+sin6x+....)loge2, satisfies the equation x29x+8=0, then the value of cosxcosx+sinx, 0<x<π2 is

    11.

    If the mode of the data is 18 and the mean is 24, then median is

    Answer»

    If the mode of the data is 18 and the mean is 24, then median is

    12.

    The circular wire of diameter 10cm is cut and placed along the circumference of a circle of diameter 1 metre. The angle subtended by the wire at the centre of the circle is equal to

    Answer»

    The circular wire of diameter 10cm is cut and placed along the circumference of a circle of diameter 1 metre. The angle subtended by the wire at the centre of the circle is equal to


    13.

    Consider a family of straight lines (x+y)+λ(2x−y+1)=0. Then the equation of the straight line belonging to this family that is farthest from (1,−3) is:

    Answer»

    Consider a family of straight lines (x+y)+λ(2xy+1)=0. Then the equation of the straight line belonging to this family that is farthest from (1,3) is:

    14.

    The perpendicular distance of a line from the origin is 5 units and its slope is - 1. Find the equation of the line.

    Answer»

    The perpendicular distance of a line from the origin is 5 units and its slope is - 1. Find the equation of the line.

    15.

    ∫ex(2tan x1+tan x+cot2(x+π4))dx is equal to

    Answer»

    ex(2tan x1+tan x+cot2(x+π4))dx is equal to


    16.

    If the major axis is “n” (n&gt;1) times the minor axis of the ellipse, then its eccentricity is

    Answer»

    If the major axis is “n” (n>1) times the minor axis of the ellipse, then its eccentricity is

    17.

    If If xcosθ=ycos(θ+2π3)=zcos(θ+4π3), then write the value of 1x+1y+1z.

    Answer» If If xcosθ=ycos(θ+2π3)=zcos(θ+4π3), then write the value of 1x+1y+1z.
    18.

    Let I=b∫a(x4−2x2)dx. If I is minimum then the ordered pair (a,b) is :

    Answer»

    Let I=ba(x42x2)dx. If I is minimum then the ordered pair (a,b) is :

    19.

    Prove that the term independent of x in the expansion of (x+1x)2n is 1.3.5....(2n−1)n!.2n.

    Answer»

    Prove that the term independent of x in the expansion of (x+1x)2n is

    1.3.5....(2n1)n!.2n.

    20.

    Let P=⎡⎢⎣100310931⎤⎥⎦ and Q=[qij] be two 3×3 matrices such that Q−P5=I3. Then q21+q31q32 is equal to

    Answer»

    Let P=100310931 and Q=[qij] be two 3×3 matrices such that QP5=I3. Then q21+q31q32 is equal to

    21.

    If the system of equations ax + y = 3, x + 2y =3, 3x + 4y =7 is consistent, then value of a is equal to

    Answer»

    If the system of equations ax + y = 3, x + 2y =3, 3x + 4y =7 is consistent, then value of a is equal to


    22.

    Prove that: tan22θ−tan2θ1−tan22θtan2θ=tan3θtanθ

    Answer» Prove that:
    tan22θtan2θ1tan22θtan2θ=tan3θtanθ
    23.

    Which of the following is a unit vector in the direction of ^i+^j+^k.

    Answer»

    Which of the following is a unit vector in the direction of ^i+^j+^k.

    24.

    If two squares are chosen at random on a chess board, the probability that they have a side in common is:

    Answer»

    If two squares are chosen at random on a chess board, the probability that they have a side in common is:

    25.

    (-5,2), (3,-6) and (7,4) are vertices of triangle. Find the length of its median through the vertex (3, -6).

    Answer» (-5,2), (3,-6) and (7,4) are vertices of triangle. Find the length of its median through the vertex (3, -6).
    26.

    In ΔXYZ, YZ=2 units, XZ=3 units and medians XP,YQ are such that XP is perpendicular to YQ. Then the area of ΔXYZ is

    Answer»

    In ΔXYZ, YZ=2 units, XZ=3 units and medians XP,YQ are such that XP is perpendicular to YQ. Then the area of ΔXYZ is

    27.

    List−IList−II P.Zk=cos(2kπ2016)+I sin(2kπ2016)k=1,2,3,...,2015 then 1−∑2015k=1cos(2kπ2016)=1.0Q.If(a2−a+k)(11b2−4b+2)=92 have exactly one ordered pair (a,b)then k=2.2 In a triangle ABC,equations of medians AD and BE are 2x+3y=6,3x R.−2y=10 respectively and AD=6,BE=113.3 and area of triangle ABC is 11k then K= S.y(x)=a cos Inx+b sin Inx,(x&gt;0)and 1y(x)(x2d2y(x)dx2+xdy(x)dx)+1=4.4

    Answer»

    ListIListII P.Zk=cos(2kπ2016)+I sin(2kπ2016)k=1,2,3,...,2015 then 12015k=1cos(2kπ2016)=1.0Q.If(a2a+k)(11b24b+2)=92 have exactly one ordered pair (a,b)then k=2.2 In a triangle ABC,equations of medians AD and BE are 2x+3y=6,3x R.2y=10 respectively and AD=6,BE=113.3 and area of triangle ABC is 11k then K= S.y(x)=a cos Inx+b sin Inx,(x>0)and 1y(x)(x2d2y(x)dx2+xdy(x)dx)+1=4.4


    28.

    ∫π20sec xsec x+cosec xdx=

    Answer» π20sec xsec x+cosec xdx=
    29.

    Area under the curve y = sin 2x + cos 2x between x=0 and x=π4is

    Answer»

    Area under the curve y = sin 2x + cos 2x between x=0 and x=π4is


    30.

    The area (in sq. units) of the region {(x,y):x≥0,x+y≤3,x2≤4y and y≤1+√x} is:

    Answer»

    The area (in sq. units) of the region {(x,y):x0,x+y3,x24y and y1+x}
    is:

    31.

    If I is the greatest of the definite integrals I1=∫10e−xcos2x dx, I2=∫10e−x2cos2 x dx I3=∫10e−x2dx, I4=∫10e−x22dx, then

    Answer»

    If I is the greatest of the definite integrals
    I1=10excos2x dx, I2=10ex2cos2 x dx
    I3=10ex2dx, I4=10ex22dx, then


    32.

    The equation of the common tangent touching the circle (x−3)2+y2=9 and the parabola y2=4x above the X-axis is

    Answer»

    The equation of the common tangent touching the circle (x3)2+y2=9 and the parabola y2=4x above the X-axis is

    33.

    If the vertices of a triangle be (0,0), (6,0) and (6,8), then its incentre will be

    Answer»

    If the vertices of a triangle be (0,0), (6,0) and (6,8), then its incentre will be


    34.

    If (21.4)a=(0.00214)b=100, then the value of 1a−1b is

    Answer»

    If (21.4)a=(0.00214)b=100, then the value of 1a1b is

    35.

    The set of values of 'c' so that the equations y=|x|+c and x2+y2−8|x|−9=0 have no solution is

    Answer»

    The set of values of 'c' so that the equations y=|x|+c and x2+y28|x|9=0 have no solution is


    36.

    If A and B are two events such that P(A∪B)′=16, P(A∩B)=14 and P(A′)=14, then events A and B are

    Answer»

    If A and B are two events such that P(AB)=16, P(AB)=14 and P(A)=14, then events A and B are


    37.

    A man takes a step forward with the probability of 0.4 and one step backward with the probability of 0.6, then the probability that at the end of eleven step he is one step away from the starting point is

    Answer»

    A man takes a step forward with the probability of 0.4 and one step backward with the probability of 0.6, then the probability that at the end of eleven step he is one step away from the starting point is

    38.

    Write the value of sin12∘ sin48∘ sin54∘

    Answer»

    Write the value of sin12 sin48 sin54

    39.

    Find the ecentrictity, coordinates of foci, equations of directrices and length of the latus-rectum of the hyperbola(i) 9x2−16y2=144(ii) 16x2−9y2=−144(iiii) 4x2−3y2=36(iv) 3x2−y2=4(v) 2x2−3y2=5

    Answer»

    Find the ecentrictity, coordinates of foci, equations of directrices and length of the latus-rectum of the hyperbola(i) 9x216y2=144(ii) 16x29y2=144(iiii) 4x23y2=36(iv) 3x2y2=4(v) 2x23y2=5

    40.

    Prove that: (i) sin(A+B)+sin(A−B)cos(A+B)+cos(A−B)=tanA (ii) sin(A−B)cosAcosB+sin(B−C)cosBcosC+sin(C−A)cosCcosA=0 (iii) sin(A−B)sinAsinB+sin(B−C)sinBsinC+sin(C−A)sinCsinA=0 (iv) sin2B=sin2A+sin2(A−B)−2sinAcosBsin(A−B) (v) cos2+cos2B−2cosAcosBcos(A+B)=sin2(A+B) (vi) tan(A+B)cot(A−B)=tan2A−tan2B1−tan2Atan2B

    Answer» Prove that:
    (i) sin(A+B)+sin(AB)cos(A+B)+cos(AB)=tanA
    (ii) sin(AB)cosAcosB+sin(BC)cosBcosC+sin(CA)cosCcosA=0
    (iii) sin(AB)sinAsinB+sin(BC)sinBsinC+sin(CA)sinCsinA=0
    (iv) sin2B=sin2A+sin2(AB)2sinAcosBsin(AB)
    (v) cos2+cos2B2cosAcosBcos(A+B)=sin2(A+B)
    (vi) tan(A+B)cot(AB)=tan2Atan2B1tan2Atan2B
    41.

    The number of solution(s) of the equation x−7x−3=3−7x−3 is

    Answer»

    The number of solution(s) of the equation x7x3=37x3 is

    42.

    List IList II (A)If limn→∞(n2+1n+1−an)−b=0,thenthe value of b is(P)0(B)If x2y+y3=2 and the value of d2ydx2 at x=1 is −m8, then the value of m is(Q)1(C)If f(x)={x,x≤1x2+bx+c,x&gt;1 and f′(x)exists for all x∈R, then the value of c is(R)2(D)If f(x)=x∫0tsin1t dt, then the number ofpoint(s) of discontinuity of f(x) in (0,π) is(S)−1(T)4(U)3 Which of the following is the only INCORRECT combination?

    Answer» List IList II (A)If limn(n2+1n+1an)b=0,thenthe value of b is(P)0(B)If x2y+y3=2 and the value of d2ydx2 at x=1 is m8, then the value of m is(Q)1(C)If f(x)={x,x1x2+bx+c,x>1 and f(x)exists for all xR, then the value of c is(R)2(D)If f(x)=x0tsin1t dt, then the number ofpoint(s) of discontinuity of f(x) in (0,π) is(S)1(T)4(U)3

    Which of the following is the only INCORRECT combination?
    43.

    If the distance between a focus and corresponding directrix of an ellipse be 8 and the eccentricity be 12 , then length of the minor axis is

    Answer»

    If the distance between a focus and corresponding directrix of an ellipse be 8 and the eccentricity be 12 , then length of the minor axis is



    44.

    The probability that a person will travel by plane is 3 / 5 and that he will travel by train is 1 / 4. What is the probability that he (she) will travel by plane or train ?

    Answer»

    The probability that a person will travel by plane is 3 / 5 and that he will

    travel by train is 1 / 4. What is the probability that he (she) will travel by

    plane or train ?

    45.

    Let Sn denotes the sum of the first n terms of an A.P.. If S4=16 and S6=−48, then S10 is equal to

    Answer»

    Let Sn denotes the sum of the first n terms of an A.P.. If S4=16 and S6=48, then S10 is equal to

    46.

    The solution of x=1+(xydydx)+x2y22!(dydx)2+x3y33!(dydx)3…… is

    Answer» The solution of x=1+(xydydx)+x2y22!(dydx)2+x3y33!(dydx)3 is
    47.

    If one root of the equation ax2 + bx + c = 0 be n times the other root, then

    Answer»

    If one root of the equation ax2 + bx + c = 0 be n times the other root, then


    48.

    The edge of unit cell of FCC Xe crystal is 620pm. The radius of Xe atom is

    Answer» The edge of unit cell of FCC Xe crystal is 620pm. The radius of Xe atom is
    49.

    When 3233 is divided by 34, it leaves the remainder

    Answer»

    When 3233 is divided by 34, it leaves the remainder


    50.

    Let f be the subset of Z × Z defined by f= {(ab, a+b) : a, b belongs to Z } . Is f a function from Z to Z ?

    Answer»

    Let f be the subset of Z × Z defined by f= {(ab, a+b) : a, b belongs to Z } . Is f a function from Z to Z ?