Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

How many outcomes are there in the sample space of an event defined as "throwing two dice and a coin together"

Answer» How many outcomes are there in the sample space of an event defined as "throwing two dice and a coin together"
2.

Find the point on x-axis which is equidistant from the points A(3, 2, 2) and B(5, 5, 4).

Answer»

Find the point on x-axis which is equidistant from the points A(3, 2, 2) and B(5, 5, 4).


    3.

    For a positive integer n, let a(n)=1+12+13+14…+12n−1 then

    Answer»

    For a positive integer n, let a(n)=1+12+13+14+12n1 then


    4.

    If∫42f(x)dx=12 and f(6−x)=f(x),then ∫42xf(x) dx=

    Answer»

    If42f(x)dx=12 and f(6x)=f(x),then 42xf(x) dx=


    5.

    limx→π2(1−sin x) tan x will be equal to _____

    Answer»

    limxπ2(1sin x) tan x will be equal to _____


    6.

    List I has four entries and List II has five entries. Each entry of List I is to be matched with one or more than one entries of List II. List IList II (A)The possible value(s) of a for which the largest(P)9value of sin2x−2asinx+a+3 is 7 is/are(B)The possible value(s) of a for which the smallest(Q)16value of x4−ax2+2a−1 for x∈[−1,2] is−7, is/are(C)If a relation R is defined on set of integers as(R)−3 R={(x,y):4x2+9y2≤36}, then possibleelement(s) in the domain is/are(D)If sinx+cosx=15, then |12tanx| is equal to(S)1 (T)11 Which of the following is the only CORRECT combination?

    Answer» List I has four entries and List II has five entries. Each entry of List I is to be matched with one or more than one entries of List II.

    List IList II (A)The possible value(s) of a for which the largest(P)9value of sin2x2asinx+a+3 is 7 is/are(B)The possible value(s) of a for which the smallest(Q)16value of x4ax2+2a1 for x[1,2] is7, is/are(C)If a relation R is defined on set of integers as(R)3 R={(x,y):4x2+9y236}, then possibleelement(s) in the domain is/are(D)If sinx+cosx=15, then |12tanx| is equal to(S)1 (T)11

    Which of the following is the only CORRECT combination?
    7.

    The derivative of 2(x+1) with respect to x will be

    Answer»

    The derivative of 2(x+1) with respect to x will be

    8.

    A rifle man is firing at a distant target and has only 10% chance of hitting it. The minimum number of rounds he must fire in order to have 50% chance of hitting it at least once is [Kurukshetra CEE 1998]

    Answer»

    A rifle man is firing at a distant target and has only 10% chance of hitting it. The minimum number of rounds he must fire in order to have 50% chance of hitting it at least once is

    [Kurukshetra CEE 1998]


    9.

    Which of the following cannot be valid assignment of probability for elementary events or outcomes of sample space S={w1,w2,w3,w4,w5,w6,w7}: Elementary events : (i) w1w2w3w4w5w6w70.10.010.050.030.010.20.6 (ii) 17171717171717 (iii) 0.70.60.50.40.30.20.1 (iv) 114114114114114114114

    Answer»

    Which of the following cannot be valid assignment of probability for elementary events or outcomes of sample space

    S={w1,w2,w3,w4,w5,w6,w7}:
    Elementary events :

    (i) w1w2w3w4w5w6w70.10.010.050.030.010.20.6

    (ii) 17171717171717

    (iii) 0.70.60.50.40.30.20.1

    (iv) 114114114114114114114

    10.

    The coefficient of x5 in the expansion of (1+x)21+(1+x)22+(1+x)23+⋯+(1+x)30

    Answer»

    The coefficient of x5 in the expansion of (1+x)21+(1+x)22+(1+x)23++(1+x)30

    11.

    PSQ is a focal chord of the parabola y2=8x.If SP=6,then write SQ.

    Answer»

    PSQ is a focal chord of the parabola y2=8x.If SP=6,then write SQ.

    12.

    The equation of the parabola whose vertex is (a,0) and the directrix has the equation x+y=3a,is

    Answer»

    The equation of the parabola whose vertex is (a,0) and the directrix has the equation x+y=3a,is


    13.

    Find S when ¯C=200, MPC=0.4 and Y=1,000.

    Answer»

    Find S when ¯C=200, MPC=0.4 and Y=1,000.

    14.

    Solve the following linear in equations in R. Solve:-4x >30, when (i) x ϵ R (ii) x ϵ Z (iii) x ϵ N

    Answer»

    Solve the following linear in equations in R.

    Solve:-4x >30, when

    (i) x ϵ R (ii) x ϵ Z (iii) x ϵ N

    15.

    f(x)=∫3sinx+4cosx4sinx−3cosxdx If the value of f(−π2) is In (a), find a. Neglect the constant of integration while integrating ___

    Answer» f(x)=3sinx+4cosx4sinx3cosxdx
    If the value of f(π2) is In (a), find a. Neglect the constant of integration while integrating
    ___
    16.

    Find ∫π0sin(x)dx

    Answer» Find π0sin(x)dx
    17.

    Two teams are playing a series of five matches between them. Any random match ends with three results i.e, win, loss or draw for a team. Let a group of n people forecast the result of a perticular team for each match and no two people make the same forecast for the series of matches. The maximum number of people required in a group such that a person forcasts all the results correctly for all the matches is

    Answer» Two teams are playing a series of five matches between them. Any random match ends with three results i.e, win, loss or draw for a team. Let a group of n people forecast the result of a perticular team for each match and no two people make the same forecast for the series of matches. The maximum number of people required in a group such that a person forcasts all the results correctly for all the matches is
    18.

    Let A=(sinθ+1,cosθ) and B=(1−cosθ,−sinθ). Then the maximum value of AB is

    Answer»

    Let A=(sinθ+1,cosθ) and B=(1cosθ,sinθ). Then the maximum value of AB is

    19.

    A tangent drawn through the point (2,−1) to a circle meets it at (2,3). If radius of the circle is 3 units, then equation of the circle can be

    Answer»

    A tangent drawn through the point (2,1) to a circle meets it at (2,3). If radius of the circle is 3 units, then equation of the circle can be

    20.

    Find the coordinates of all letters in the graph given below.

    Answer»

    Find the coordinates of all letters in the graph given below.


    21.

    Let A(2,−3) and B(−2,1) be vertices of a triangle ABC. If the centroid of this triangle moves on the line 2x+3y=1, then the locus of vertex C is

    Answer»

    Let A(2,3) and B(2,1) be vertices of a triangle ABC. If the centroid of this triangle moves on the line 2x+3y=1, then the locus of vertex C is

    22.

    The number of solution(s) of y=x2+10x+22 and y=ex is

    Answer»

    The number of solution(s) of y=x2+10x+22 and y=ex is

    23.

    Show that the points (a, b, c), (b, c, a) and (c, a, b) are the vertices of an equilateral triangle.

    Answer»

    Show that the points (a, b, c), (b, c, a) and (c, a, b) are the vertices of an equilateral triangle.

    24.

    The value of cosecθ+sec(270°−θ)−cosec(270°+θ)+sec(180°−θ) is

    Answer»

    The value of cosecθ+sec(270°θ)cosec(270°+θ)+sec(180°θ) is

    25.

    Let A=[aij]3×3, B=[bij]3×3, where bij=3i−jaij and C=[cij]3×3, where cij=4i−jbij be any three matrices. If det.A = 2 then ‘det.B + det.C’ is equal to

    Answer»

    Let A=[aij]3×3, B=[bij]3×3, where bij=3ijaij and C=[cij]3×3, where cij=4ijbij be any three matrices. If det.A = 2 then ‘det.B + det.C’ is equal to


    26.

    Let f be a function defined on R such that f'(x)=2010(x−2009)(x−2010)2(x−2011)3(x−2012)4, for all x∈R. If g is a function defined on R with values in the interval (0,∞) such that f(x)=ln(g(x)) for all x∈R, then the number of points in R at which g has a local maximum is

    Answer» Let f be a function defined on R such that
    f'(x)=2010(x2009)(x2010)2(x2011)3(x2012)4, for all xR. If g is a function defined on R with values in the interval (0,) such that f(x)=ln(g(x)) for all xR, then the number of points in R at which g has a local maximum is
    27.

    1. The probablity of getting exactly 2 tails in 6 tosses of a fair coin? 2. 3 dice are rolled simultaneously the probablity that the sum of the numbers on them is 16 ?

    Answer»

    1. The probablity of getting exactly 2 tails in 6 tosses of a fair coin?

    2. 3 dice are rolled simultaneously the probablity that the sum of the numbers on them is 16 ?

    28.

    A box contains 6 red marbles numbers from 1 through 6 and 4 white marbles 12 through 15. Find the probability that a marble drawn at random is white and odd numbered.

    Answer»

    A box contains 6 red marbles numbers from 1 through 6 and 4 white marbles 12 through 15. Find the probability that a marble drawn at random is white and odd numbered.


    29.

    Find the sine of the angle between the vectors →a=3^i+^j+2^k and →b=2^i−2^j+4^k.

    Answer»

    Find the sine of the angle between the vectors a=3^i+^j+2^k and b=2^i2^j+4^k.

    30.

    Maximum value of 15Cr is

    Answer» Maximum value of 15Cr is
    31.

    If x = -9 is a root of ∣∣∣∣x372x276x∣∣∣∣=0, then other two roots are ___

    Answer»

    If x = -9 is a root of
    x372x276x
    =0
    , then other two roots are ___

    32.

    What is angle when range and height of projectile motion is same?

    Answer» What is angle when range and height of projectile motion is same?
    33.

    If A is a square matrix of order 3 and ∣∣|adj(A)|⋅|A|⋅A∣∣=|A|λ, then the value of λ is

    Answer»

    If A is a square matrix of order 3 and |adj(A)||A|A=|A|λ, then the value of λ is

    34.

    If d1 and d2 are the longest and the shortest distances of the point P(−7,2) from the circle x2+y2−10x−14y−51=0, then the value of d21+d22 is

    Answer» If d1 and d2 are the longest and the shortest distances of the point P(7,2) from the circle x2+y210x14y51=0, then the value of d21+d22 is
    35.

    Ben wrestles in a weight division that requires all wrestlers to weigh between140 and 150 pounds. Which of the following inequalities can be used to determine whether or not Ben's current weight w satisfies the weight requirement?

    Answer» Ben wrestles in a weight division that requires all wrestlers to weigh between140 and 150 pounds. Which of the following inequalities can be used to determine whether or not Ben's current weight w satisfies the weight requirement?
    36.

    Let A={1,2,3,....,9} and R be the relation in A×A defined by (a,b) R (c,d) if a+d=b+c for a,b,c,d in A×A. Prove that R is an equivalence relation.Also obtain the equivalence class [(2,5)].

    Answer» Let A={1,2,3,....,9} and R be the relation in A×A defined by (a,b) R (c,d) if a+d=b+c for a,b,c,d in A×A.
    Prove that R is an equivalence relation.Also obtain the equivalence class [(2,5)].
    37.

    Column IColumn IIColumn IIIP) ¯¯¯v=v0^i1) ¯¯¯¯E=E0^ki) ¯¯¯¯B=B0(^i+^j)Q) ¯¯¯v=v0(^i+^j)2) ¯¯¯¯E=E0^iii) ¯¯¯¯B=B0^kR) ¯¯¯v=v0^j3) ¯¯¯¯E=0iii) ¯¯¯¯B=0S) ¯¯¯v=04) ¯¯¯¯E=E0(^i+^j)iv) ¯¯¯¯B=B0^j Which of the following combinations should be true for the particle to travel along a straight line?

    Answer»

    Column IColumn IIColumn IIIP) ¯¯¯v=v0^i1) ¯¯¯¯E=E0^ki) ¯¯¯¯B=B0(^i+^j)Q) ¯¯¯v=v0(^i+^j)2) ¯¯¯¯E=E0^iii) ¯¯¯¯B=B0^kR) ¯¯¯v=v0^j3) ¯¯¯¯E=0iii) ¯¯¯¯B=0S) ¯¯¯v=04) ¯¯¯¯E=E0(^i+^j)iv) ¯¯¯¯B=B0^j

    Which of the following combinations should be true for the particle to travel along a straight line?


    38.

    If for three non-zero and unequal real numbers a, b and c; 1a+ω+1b+ω+1c+ω=2ω2 and 1a+ω2+1b+ω2+1c+ω2=2ω, where ω2 and ω are the complex cube roots of unity, then 1a+1+1b+1+1c+1=

    Answer»

    If for three non-zero and unequal real numbers a, b and c; 1a+ω+1b+ω+1c+ω=2ω2 and 1a+ω2+1b+ω2+1c+ω2=2ω, where ω2 and ω are the complex cube roots of unity, then 1a+1+1b+1+1c+1=


    39.

    Let f be a differentiable function with limx→∞f(x)=0. If y′+yf′(x)−f(x)f′(x)=0, limx→∞y(x)=0, then (where y′≡dydx)

    Answer»

    Let f be a differentiable function with limxf(x)=0. If y+yf(x)f(x)f(x)=0, limxy(x)=0, then
    (where ydydx)

    40.

    If the area of the triangle formed by the positive x−axis, the normal and the tangent to the circle (x−2)2+(y−3)3=25 at the point (5,7) is A, then 24A is equal to

    Answer» If the area of the triangle formed by the positive xaxis, the normal and the tangent to the circle (x2)2+(y3)3=25 at the point (5,7) is A, then 24A is equal to
    41.

    If the total number of m-element subsets of the set A={a1,a2,...,an} is k times the number of m element subsets containing a4 then n is

    Answer»

    If the total number of m-element subsets of the set A={a1,a2,...,an} is k times the number of m element subsets containing a4 then n is

    42.

    If sides of the triangle are x, y, z and x^2+y^2+z^2 = xy+yz+zx . then it is which type of triangle

    Answer» If sides of the triangle are x, y, z and x^2+y^2+z^2 = xy+yz+zx . then it is which type of triangle
    43.

    How many number of four digits can be formed with the digits 1,2,3,4,5 if the digit can be repeated in any number of times?

    Answer»

    How many number of four digits can be formed with the digits 1,2,3,4,5 if the digit can be repeated in any number of times?


    44.

    The remainder when 3100 is divided by 100 is

    Answer»

    The remainder when 3100 is divided by 100 is

    45.

    If Cr represents 100Cr, then 5C0−8C1+11C2−… upto 101 terms equal to

    Answer»

    If Cr represents 100Cr, then 5C08C1+11C2 upto 101 terms equal to

    46.

    Integrate the function. ∫√1−4x−x2dx.

    Answer»

    Integrate the function.
    14xx2dx.

    47.

    Tangent drawn from point (c,d) to the hyperbola x225−y216=1 make angles α and β with the x− axis. If tanαtanβ=1, then the value of c2−d2

    Answer» Tangent drawn from point (c,d) to the hyperbola x225y216=1 make angles α and β with the x axis. If tanαtanβ=1, then the value of c2d2
    48.

    The common ratio of a G.P. is 3 and the last term is 486. If the sum of these terms be 728, find the first term.

    Answer»

    The common ratio of a G.P. is 3 and the last term is 486. If the sum of these terms be 728, find the first term.

    49.

    The value of sin420∘cos390∘−cos(−660∘)sin330∘ is

    Answer» The value of sin420cos390cos(660)sin330 is
    50.

    Let A and B be two sets containing 4 and 7 elements respectively. If the minimum and maximum number of elements in A∪B are m and n respectively, then m+n is

    Answer»

    Let A and B be two sets containing 4 and 7 elements respectively. If the minimum and maximum number of elements in AB are m and n respectively, then m+n is