InterviewSolution
Saved Bookmarks
InterviewSolution
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 2401. |
Express 0.00323232------ in the form of p/q |
| Answer» 8/2475 | |
| 2402. |
What is the percentage increase in dispensaries from 1951 to 2015Dispensaries |29274|29709|29957 |
| Answer» 3.2803690415% | |
| 2403. |
a-b-a^2+b^2 |
|
Answer» (a-b)(a+b)(a-b) A-b |
|
| 2404. |
Chapter 7 exersice 7.1 question no. 7 |
| Answer» | |
| 2405. |
Abcd is a cycle quadrilateral whose diagonals interect at a point E. If |
| Answer» | |
| 2406. |
Is 0.5918 a rational number |
|
Answer» Yes as can be written as p/q 5918/1000=>2959/500 Yes as it can represented as p/q |
|
| 2407. |
Write Heron\'s formula |
|
Answer» area = √s(s-a)(s-b)(s-c)S=a+b+c/2 S=a+b+c/2 area = √s(s-a)(s-b)(s-c) S=a+b+c/2and then Area =under rogt(s-a)(s-b)(s-c). Under root s(s-a)(s-b)(s-c) Write Heron\'s formula |
|
| 2408. |
11 chapter solved |
| Answer» 11 chapter solved | |
| 2409. |
Find six rational numbers between-2 and -1 |
| Answer» -2/1×7/7=-14/7 , -1/7×7/7=-7/7Ans=> -8/7, -9/7, -10/7, -11/7, -12/7, -13/7. | |
| 2410. |
Square root of 10+root 24+root 60 +root 40 |
| Answer» 10+2√6+4√15+2√10 | |
| 2411. |
In a trapezium ABCD if AB parallel to CD then find AC^2+BD^2 |
| Answer» | |
| 2412. |
Rationalize the denominator of 3 23 2\uf02d\uf02b. |
| Answer» write the from of p/q 0.57 | |
| 2413. |
Find the ratios of volume of cylinder cone and sphere,if they have same radius and same height? |
|
Answer» 3:1:2 3:1:4 Am I ryt?? |
|
| 2414. |
Find the probability of Sun revolving around the Earth. |
|
Answer» 1 P(s)= s/m 1 Jdi 1/1 |
|
| 2415. |
In an experiment a coin is tossed 600 times |
| Answer» Write full question | |
| 2416. |
Please help in all chapter |
|
Answer» In circles Which chapter |
|
| 2417. |
Sir I have exam |
| Answer» | |
| 2418. |
Find the value of 4/(216)^-2/3-1/(256)^-3/4 |
| Answer» -4132096 | |
| 2419. |
Bcc |
| Answer» | |
| 2420. |
Can all the angle of quadrilateral be right angle ? Give reasons for you answer |
| Answer» YES. BECUASE WE KNOW SUM OF ANGLES OF A QUADRILATERAL IS 3600 | |
| 2421. |
Classify the following as linear,quadratic and cubic polynomials :(i) -7+z(ii) 5t (iii) p³ |
|
Answer» (i) linear (ii) linear (iii) cubic (i) and (ii) is a linear polynomial and (iii) is a cubic polynomial 1 is quadratic 2 and 3 is linear |
|
| 2422. |
Exercise 8.1 |
| Answer» | |
| 2423. |
Simplify (3¹/3) 4 |
| Answer» 4 | |
| 2424. |
Why does 1/3 of 1/3 equal 1? |
|
Answer» 1/3 × 1/3 = 1/9 The word \'of \' to the best of my knowledge , is synonymous with the word multiply in the math world .If I have 40 loaves of bread (2 baskets multiplied by 20 loaves)In the same way 1/3 of 1/3 is synonymous with 1/3 multiplied by 1/3 , which is 1/9. Thanks!..But I am still confused, Can you explain it in detail please... 1/3 of 1/3 does not equal to 1 because \'of \'means multiply so the answer is 1/9 |
|
| 2425. |
In which Quadrant pts (-3,7), (0,3), (-4,0) and (4,-3) |
|
Answer» 2nd,y- axis,x- axis ,4th auadrant -(4,0)= X-axis (-3,7)= 2nd quadrant(0,3)= y-axis(-4,0)=y-axis(4,-3)=4th quadrant |
|
| 2426. |
What is rational and irrational number |
| Answer» Rational numbers are those numbers whose decimal expansion is terminating or non terminating , reoccurringAnd irrational number are those numbers whose decimal expansion is non terminating and non reoccurring | |
| 2427. |
Cocate √7 on number line |
| Answer» | |
| 2428. |
The diameter of a square is decrease by 25%. By what percent does it\'s curve surface area decrease. |
|
Answer» Sarvsamika ki sahayata se 95 ke varg ka man gyat kijiye 75% |
|
| 2429. |
Express 8.0025 in form P by Q? |
|
Answer» 80025/10000 80025/10000 80025/10000 |
|
| 2430. |
Pythagora theorem |
| Answer» It\'s Pythagoras theorem not Pythagora theorem The formula is(only for right angled triangle) - ifa triangle abc has ab as hypotneous and bc and cd as the remaining sides then - (ab)²=(bc)² + (cd)² | |
| 2431. |
Simplify root 3-² |
| Answer» √3-²= 1/3 because root and square get cancelled and 3- becomes 1/3 | |
| 2432. |
Prove that:(??????)x(??????)x(??????) =1 |
| Answer» | |
| 2433. |
Express 8.0025 in the form p-q |
|
Answer» jocwqikol/ 80025/10000 80025/10000 |
|
| 2434. |
A line passes through the point (-4, 6) and is parallel to the x-axis. Find its equation. |
| Answer» Y = 6 | |
| 2435. |
Rationalise the denominator 1/1+√2+√3 |
| Answer» Already this is in rational | |
| 2436. |
Define0 |
| Answer» | |
| 2437. |
The construction of a triangle is possible only when the difference of any two sides is ........ |
| Answer» Greater than third side | |
| 2438. |
100-150 150-200 -250 250_300 300_350 350_400 frequently ,polgon |
| Answer» | |
| 2439. |
Can anyone send me the pdf of last year maths question paper please? |
| Answer» | |
| 2440. |
Rationalize the denominator of 1 upon 2 plus 5 cube |
|
Answer» 1upon 7 cube 1/2+√5*2-√5/2-√5=2-√5/(2)^2-(5)^2=2-√5/4-5=2-√5/-1=-2+√5 |
|
| 2441. |
When a fair dice throws 10 time then how many time 1 appears |
| Answer» ⅙ | |
| 2442. |
If X=0 and y=k is a solution of the equation 5x-3y=3 find value of k |
|
Answer» _1 K=1 5×0-3×k=3-3×k=3k=3+3k=6 K= -1 |
|
| 2443. |
xraise to a |
| Answer» X to the power aX^a | |
| 2444. |
Exercise 2.3 |
| Answer» | |
| 2445. |
Derivation of cone formulas |
| Answer» The capacity of a cone is one-third of the capacity of the cylinder. That means if we take 1/3rd of the volume of the cylinder, we get the formula for cone volume. Volume of a cone = (1/3) πr2h cubic unit | |
| 2446. |
Define centroid of a triangle |
|
Answer» The centroid of a triangle is the point where all the medians of a triangle meet. The centroid divides the medians in the ratio of 2 :1. A centre where all median meet in the triangle i want to say that where are you leaving |
|
| 2447. |
(13 1/2÷3 1/4)13 1/4 solve it |
|
Answer» 17.29 is the answer. Please give me like ...... 276.7903225(approx.) Is the answer |
|
| 2448. |
(a-b) hole 2 |
|
Answer» a2 - ab - b2 a²-2ab+b² a^2_2ab+b^2 a² + b² - 2ab A^2 + b^2 -2Ab |
|
| 2449. |
If ( x+2) is a factor of x^4km^2+2x+4 find k |
| Answer» X=2-2^4K M^2+2.-2+416KM^2 +4=0 | |
| 2450. |
5 black 88 ki power 1 by 3 + 27 ki power 1 by 3 (ki power 3) ki power 4 |
| Answer» | |