InterviewSolution
Saved Bookmarks
InterviewSolution
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 8351. |
Convert 6 radian into degree measurr |
| Answer» 6×180÷π= 3780/11 | |
| 8352. |
Find equation of circle passing through three points (1,2) , (3,-4) , (5,-6) |
| Answer» Concyclic. | |
| 8353. |
Which is best book for mathematic. |
|
Answer» Kc sinha best book for maths Exampler KC sinha or RD sharma Elements or RD Sharma Sl arora |
|
| 8354. |
When class x mathematic improvement exam held??? |
| Answer» I think it will held in march with new session students of class 10 but ur exam is private exam | |
| 8355. |
Prove (1/1.2.3)+(1/2.3.4)+(1/3.4.5)+--------------(1/n(n+1)(n+2))=n(n+3)/4(n+1)(nt2) |
| Answer» This is ques. No 11of ncert class 11You can check the solution of this question in ncert solutions | |
| 8356. |
how do i get 2017 18 maths question paper with solution |
| Answer» | |
| 8357. |
The sum of n terms of two AP are in the ratio (7n-5):(5n+17). Show that their 6th terms are equal. |
| Answer» | |
| 8358. |
Mekunu Maitri ki behan ko pata nahi kar Pata Hoon Aur Main Radiant main change nahi kar Pata Hoon |
| Answer» | |
| 8359. |
22.D |
| Answer» | |
| 8360. |
What is the value of cot 120° ? |
|
Answer» -1/3^1/2 -√3/3 Cot (180-60) = cot 120= -1/3^2 |
|
| 8361. |
Find the sum to n terms of the series 5+11+19+29+41+...... |
| Answer» Sn=n÷2 (2a+(n-1)×dN%2 (10+6n-6)N÷2 (4+6n)N (2+3n) | |
| 8362. |
10 raise to 2n-1 +1 is divisible by 11 |
| Answer» 10^(2n-1) +1 is divisible by 11. We will prove this statement by induction. For n = 1 this is true,Now we assume that it is true for n = kTherefore 10^(2k-1) + 1 = 11×t (where t is some integer.=> 10^(2k-1) = 11×t - 1 ..... equation 1For n = k + 1LHS = 10^(2(k+1) - 1) +1 = 100×10^(2k-1) +1 From equation 1 we substitute value of 10^(2k-1),LHS = 100×(11×t - 1) +1= 11 (100×t + 9) which is clearly a multiple of 11.Hence proved | |
| 8363. |
Z=5-√3i/4+2√3ia.Express Z in the a+ib form.b.Express Z in polar form. |
| Answer» | |
| 8364. |
How to find RHS of two triangles |
| Answer» | |
| 8365. |
Show that (9,1) (7,9) (-2,12) (6,10) are concyclic |
| Answer» | |
| 8366. |
Show that the atatement for any real no a and b a2 =b2 |
| Answer» | |
| 8367. |
(AUB\'uC)n(AnB\'nC\')u(AuBuC\')n( B\'nc\') |
| Answer» see the answer | |
| 8368. |
Lim sin(2+x)-sin(2-x)/xX=0 |
| Answer» | |
| 8369. |
2sin^2y + 4cos ( x+y ) sinxsiny + cos(2x + y)= cos2x |
| Answer» | |
| 8370. |
Find value of tan 15° |
|
Answer» Tan2.15=2tan15/1-tan^2 15 Let tan 15° = tan (30° - 45°)Now use the formula tan ( x + y )So the sol. Become tan 30 - tan 45 / 1 + tan30 tan45= √3 -1/ √3+1 |
|
| 8371. |
How to draw graph of sin3x ? |
| Answer» | |
| 8372. |
4c2 |
| Answer» 6 | |
| 8373. |
Square root of 237 |
|
Answer» 56169 15.39 |
|
| 8374. |
Find squarroot of iota root method |
| Answer» | |
| 8375. |
Sketch the graph of 3x + 2y |
| Answer» | |
| 8376. |
If z= 2+√3i, find the value of zz |
| Answer» {tex}\\style{font-family:Arial}{\\style{font-size:10px}{\\begin{array}{l}zz=(2+\\sqrt3i)\\times{(2+\\sqrt3i)}\\\\=2^2+(\\sqrt3i)^2+4\\sqrt3i\\\\=4+3i^2+4\\sqrt3i\\\\=4-3+4\\sqrt3i\\\\=1+4\\sqrt3i\\end{array}}}{/tex} | |
| 8377. |
Class 7 question |
| Answer» | |
| 8378. |
What is the darivative of 1/x |
|
Answer» -1x*; *=-2 X•d/dx 1 - 1•d/dx X____________________ X² X•0 - 1•1___________ X² 0-1______ X²Ans= -1/X² First u should ask about the variable with respect to which u want your derivative. By the way with respect to x, the answer ofyour question is -1/x^2 |
|
| 8379. |
For all n>1,prove that 1^2+2^2+3^3+....+n^2=n(n+1)(2n+1)/6 |
| Answer» First prove for 2 . Put n = 2 and prove LHS and RHS equal then assume the result true for n = k and then prove for n = k + 1 . You get your LHS and RHS equal | |
| 8380. |
Find slope of line 3x+4y=7 |
| Answer» -3/4 | |
| 8381. |
Evaluate: limit x tends to 0 sinx°/x |
|
Answer» Shristi u can refer to www.quora.com their u can see this question with well explained diagram please thoda explain kar do ki iska answer 1 kaise aaya 1 is the answer |
|
| 8382. |
In an A.P if mth term is n and the nth term is m, where m not equal to n, find the pth term. |
| Answer» hey ram kushwah how u posted image for this question plz tell so that i can directly post image without typing so long | |
| 8383. |
Lim x-0 (x+1)ki power 5 -1 \\x |
| Answer» Refer to www.quora.com there u can find answer in simple way | |
| 8384. |
Prove that equation of ellipse x square / a square + y square / b square = 1 |
| Answer» u can refer to youtube channel : pradeep khestrapal on maths topic there u can learn about formation of each formula with full detail | |
| 8385. |
3 x square minus x minus 10 factorise |
| Answer» 3x^2--x--10 ..........3x^2--6x+5x--10...............3x( x--2) +5(x-2)......(3x+5)(x-2)...x= 2, (-5/3). | |
| 8386. |
a cos2theta +b sin2theta = c Prove that vtan |
| Answer» | |
| 8387. |
For any triangle ABC, prove that a+b/c = cos(A-B/2)/sinC/2 |
| Answer» | |
| 8388. |
find the general solutions of tan^3 x -3tanx=0 |
| Answer» | |
| 8389. |
Class 11th me kon kon sa chapter pdhna jaroori h.. Class 12th ka math bnane ke liye..?? |
| Answer» Limits and derivatives,trigonometry,conic sec | |
| 8390. |
Solution for A\'-B\'=B-A |
| Answer» | |
| 8391. |
Prove that √1+sina/1-sina = tan(π/4+a/2) |
| Answer» g | |
| 8392. |
find the range of real function f (x)= 1- x-2 |
| Answer» Range=Real no. | |
| 8393. |
CosA. Cos(60-A).Cos(60+A)=cos3A/4 |
| Answer» | |
| 8394. |
If cos theta=cosA.cosB then prove that tan(theta+A/2).tan(theta-A/2)=tan^2(B/2) |
| Answer» | |
| 8395. |
How to find cumulative frequency ins stats |
|
Answer» Ex f=4 6 7 2 5Cf =4+6+7+2+5 Cf is sum of previous frequency |
|
| 8396. |
Subset |
| Answer» | |
| 8397. |
any one have previous years maths ques pprs |
| Answer» Available in this app | |
| 8398. |
Prove that tan20°+tan40°+tan80°=tan60° |
| Answer» Convert into sin and cos and then solve | |
| 8399. |
2017 and 2018 paper |
| Answer» | |
| 8400. |
Find the n term of series:3+7+13+21+31+.........+n |
| Answer» | |