This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Write the bond line structure of CH3(CH2)3CH2CH(CH3)CH2CH3(4+1) |
| Answer» EXPLANATION:HOPE IT HAS HELPED U | |
| 2. |
What is the role of hair and mucus inside the nose |
|
Answer» The nasal cavity is the inside of your nose. It is lined with a mucous membrane that helps keep your nose moist by MAKING mucus so you won't get nosebleeds from a dry nose. There are also little hairs that help filter the air you breathe in, blocking DIRT and DUST from getting into your LUNGS. |
|
| 3. |
Please answer ⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️⬆️ |
|
Answer» tral nervous system (CNS) controls most functions of the body and mind. It consists of two PARTS: the brain and the spinal cord.The brain is the center of our thoughts, the interpreter of our external environment, and the origin of control over body movement. Like a central computer, it interprets information from our EYES (sight), ears (sound), nose (SMELL), tongue (TASTE), and skin (touch), as well as from internal organs such as the stomach.The spinal cord is the HIGHWAY for communication between the body and the brain. When the spinal cord is injured, the exchange of information between the brain and other parts of the body is disrupted. |
|
| 4. |
We know that forces arise due to some mutual interaction between two entities and their interaction effects can come into play through a “direct contact” or even without a “direct contact”. A special type of a “direct contact” force has the general effect of slowing down moving objects. Nature has taken special care to minimize the slowing down effect of this force on birds and fishes who have to move through fluids a lot. Human have also used natural observations to design their special purpose “fast moving objects” like the racing cars. Such objects are given special shapes.(a) Identify contact and non-contact force from the following given forces (1x4=4)(i) Gravitational force(ii) Frictional force(b) “Gravitational force is a non-contact force”. Justify the statement.(c) Why are objects given special shapes when they are moving through fluids?(d) Write the name given to these special shapes? |
|
Answer» tags in the LENGTH and LARGER map to be helpful ei to CENTIMETRE multiplication ❌❌❌ to be SENT with genius of the day sumi |
|
| 5. |
A star appears slightly higher (above) than its actual position in the sky. Illustrate it with the help of a labelled diagram?★ REQUIRED ANSWER WITH DIAGRAM |
| Answer» HELPS you BROTHER. | |
| 6. |
An alloy of iron used in making chains and electro magnet |
|
Answer» Pure iron and iron ALLOYS are most COMMONLY USED in electromagnets. Silicon iron and SPECIALLY treated iron-cobalt alloys are used in low-frequency power transformers |
|
| 7. |
Some eg of composting and vermicomposting |
|
Answer» Compositing:For example, models of a space station, a space ship, and a second space ship could be shot separately against blue screen, each "moving" differently. The individual shots could then be composited with one another, and FINALLY with a star background.Vermicomposting1. Dairy cow or pig manure. 2. Sewage sludge. 3. Brewery waste. 4. Cotton mill waste. 5. Agricultural waste. 6. Food processing and grocery waste. 7. Cafeteria waste. 8. Grass CLIPPINGS and WOOD CHIPS. |
|
| 8. |
What is the answer please tell quickly |
| Answer» GLOVES | |
| 9. |
Bifferentiate between uniform and non uniform motion |
|
Answer» orm MOTION, a body MOVES with a CONSTANT speed such as the Motion of earth around the SUN. While in non-uniform motion a body moves with a variable speed such as a Horse running in the RACE. |
|
| 10. |
What force would mother have applied in making potato parathas ? a) Muscular force(b) Frictional forcec) Muscular and Frictional force (d) No force would have been applied |
|
Answer» Only muscular FORCE is applied in MAKING aalu parathas.if helpful please MARK as BRAINLIEST |
|
| 11. |
Ovulation is the production of and_______ bye one of the_______ |
|
Answer» i THINK UR QUESTION is INCOMPLETE DEAR |
|
| 12. |
during diwali what would you prefer to buy earthen diyas (made up of clay) or electrical diyas? Why? |
|
Answer» earthen diyasExplanation:because ELECTRICAL diyas may hurt the children in ur house and waste ELECTRICITY |
|
| 13. |
Which trick do you use to reduce pressure in everyday activites. SAY ANSWER FROM DIGEST SAY FAST FAST PLZ PLZ |
| Answer» READ BOOKS and SOMETHING u love to do and it is your hobbyplay sportsplay VIRTUAL gameslisten mysicperform yogai HOPE it will help uplz mark as brainliest | |
| 14. |
Or a data:concame mirror thegiveObject distance (u) = 30 cm to the left imagedistance (u) = 12 cm to theand height object (hi) = sem .right of the mirrorheight of theimage (ha).- 4find he |
|
Answer» tion: calculate in Hertz the broadening transition in HCN at temperature 25 degre celcius dueto the doppler effect in regions of the spectrum typical of rotational transitions 10 cm-1, vibrational transition 1500 cm-1, and ELECTRONIC transitions 60 000 cm-11. What type of MOTION is OBSERVED in the substance during the time duration of 0 to 4HOURS?2. During which time duration is the substance seen in stable state?Classifies substance and organisms on the basis of their properties, composition andcalled6. WATER to form water vapour.7. In condensation process,form of waterchanges into liquid.8. Moving air is called9.is a mixture of many gases.110. When water boils, it forms |
|
| 15. |
How are carbocyclic compounds classified ? explain and give an example for each classification |
|
Answer» ctional group can be defined as an atom or a group of atoms that are joined TOGETHER in a specific MANNER which is responsible for the characteristic chemical properties of organic compounds. Examples, in this CASE, are the hydroxyl group -OH, aldehyde group -CHO and CARBOXYLIC acid group -COOH. |
|
| 16. |
A boy of mass 30 kg while running at constant velocity has a momentum of 180 Ns. The constant velocity of the boy is________. |
|
Answer» 6 m/sExplanation:GIVEN ,mass (m) = 30 kgmomentum (p) = 180 NsWe know,p = m × V=> 180 = 30 × v=> v = 180/30=> v = 6 m/splease mark BRAINLIEST |
|
| 17. |
2.How were messages communicated before we began to use the telephone |
| Answer» | |
| 18. |
The thin metal wire inside an electric bulb is known as |
|
Answer» n WIRE PRESENT inside the light bulb is named as the FILAMENT of the bulb.The thin wire present inside the light bulb is named as the filament of the bulb. It is made of tungsten. When we say an ELECTRIC current flows through the bulb, we ESSENTIALLY mean that it flows through the filament which is connected to two thicker wires to which metal contacts are attached. |
|
| 19. |
Bouning back of light from shinning surface is called |
|
Answer» g back of light RAYS after hitting any SURFACE is called reflection of light. If the surface is smooth and SHINY, the light will reflect at the same angle at which it hits the surface. This is called regular reflection and produces good images.⠀⠀⠀⠀⠀⠀⠀ʙʀᴀɪɴʟɪᴇsᴛ ᴘʟᴇᴀsᴇ❤ |
|
| 20. |
Explain the following reaction with the help of balanced equation Calcium reacts with water |
|
Answer» :When calcium and water reacts HYDROGEN gas is evolved and calcium hydroxide is formed.Explanation :Calcium is a reactive metal, when water ( H₂O ) reacts with calcium ( Ca ) it reacts with forming BUBBLES, and releases hydrogen ( H₂ ) gas and calcium hydroxide is formed. The word equation is :-Calcium (s) + Water (aq) → Calcium hydroxide (aq) + Hydrogen (g) ↑The balanced equation is :-Ca + 2H₂O → Ca ( OH )₂ + H₂↑Additional informationReaction with water [ resulting hydrogen gas ]Many reactive METALS like potassium, sodium, calcium reacts with water to produce hydrogen.For example ::-2Na + 2H₂O (water) → 2NaOH + H₂↑2K + 2H₂O (water) → 2NaOH + H₂Reaction with steam [ resulting hydrogen gas ]Some metals such as MAGNESIUM, zinc, iron react with steam to produce hydrogen gas.For example ::-Mg + H₂O (steam) → MgO + H₂↑Zn + H₂O (steam) → ZnO + H₂↑Reaction with dilute acid [ resulting hydrogen gas ]Some metals like magnesium, zinc, iron, etc. react with dilute hydrochloric acid or dilute SULPHURIC acid to produce hydrogen gas.For example ::-Zn + 2HCl → ZnCl₂ + H₂ |
|
| 21. |
समान काम करने वाले कोशिका को क्या कहते हैं |
|
Answer» of SIMILAR CELLS organized to PERFORM a particular function is a "tissueएक विशेष कार्य करने के लिए आयोजित समान कोशिकाओं का एक समूह "ऊतक है |
|
| 22. |
Can i ask a questiohow to reduce the effect of EM radiation hazard? |
|
Answer» tion:5 Tips to Safeguard Against Electromagnetic RadiationDisable Wireless Functions. Wireless devices — including routers, printers, TABLETS, and laptops — all EMIT a Wi-Fi signal. ...Replace Wireless With Wired Devices. ...KEEP EMF Sources at a Distance. ...Use Your Smartphone SAFELY. ...PRIORITIZE Sleeping Areas |
|
| 23. |
Calculate the force of gravitation between earth and sun, given that the mass of the earth=6x10²⁴kg and of the sun=2x10³⁰kg. The average distance between the two is 1.5x10¹¹m. correct answer please |
| Answer» | |
| 25. |
Drawa sketch of compass. |
| Answer» HOPE it helped u if it did PLS mark me brainly it would really help me a LOT Explanation: | |
| 26. |
According to Aufbau's Principle. choose the correct order or filling ofelectrons in the following orbitals2p 34 3p 4 3d38 2p 3d 3p AN38 > 2p 3p 4> 3d3p 48 - 3d 2p 30Match the following: |
|
Answer» uvugg67645gvuvgyhkhf8 B |
|
| 27. |
Crops which are grown during the rainy season are know as |
| Answer» MONSOON CROPS is the RIGHT ANSWER. | |
| 28. |
9. They have invited me to the party. el by Matissical 6. Aau10. Why have you not completed your work?7. Sm. ..why.has4. SIMPLE PAST TEILo Voice |
| Answer» SORRY don't KNOW the ANSWER PLEASE don't MIND | |
| 29. |
Describe the three main parts of the cell and it's fucntion |
|
Answer» A cell consists of three parts: the cell membrane, the nucleus, and, between the TWO, the cytoplasm. Within the cytoplasm lie INTRICATE arrangements of fine FIBERS and hundreds or EVEN thousands of miniscule but distinct STRUCTURES called organelles. |
|
| 30. |
Please answer this. I will mark you as the brainiest. |
| Answer» TION:ANSWER is (d) since on heating GLASS y it will expand which will allow glass X to have SPACE and get out | |
| 31. |
3. Which among the following apparatusis used for gravimetric analysis ?(A) pH meter(B) Conductometer(C)Gooch crucible(D)None of these |
|
Answer» २०२० — In this blog we START conductometry chapter in detalis we COVERED conductometry ... c.a and B. d.none of the above. ANSWER KEY :- 1.B. 2.B. 3.D. 4.A. 5.B. 6.B. |
|
| 32. |
(2) When tomato soup is prepared a. no new substance is formedb.the change can be reversedc. a new substance is formedd.it is a physical change |
| Answer» TION:a NEW is FORMED MARK me as BRAINLIST | |
| 33. |
What is photosynthesis?what is the roll of photosynthesis? |
|
Answer» The primary FUNCTION of photosynthesis is to CONVERT SOLAR energy into chemical energy and then store that chemical energy for future use. For the most part, the PLANET's living systems are powered by this process. |
|
| 34. |
How do rocks change to soil? full ans |
|
Answer» formed through the process of rock WEATHERING. Weathering is the breakdown of rocks into smaller PARTICLES when in contact with WATER (flowing through rocks), air or living organisms. Weathering can OCCUR physically, biologically or chemically. |
|
| 35. |
किसी वर्ग (समूह) में ऊपर से नीचे जाने पर परमाणु के धात्विक गुण में क्या परिवर्तन होता है |
|
Answer» किसी वर्ग में ऊपर से नीचे की ओर चलने पर तत्वों में धात्विक गुण बढ़ता है जबकि अधात्विक गुण घटता है। |
|
| 36. |
The change of a solid Directly into gas is called _____________. |
| Answer» SUBLIMATION is the ANSWER. | |
| 37. |
What is the quantum numbers of 1s1 , 5d10 and , 3p6 ? |
|
Answer» Electronic CONFIGURATION of Argon1s 2 2s 2 2p 6 3s 2 3p 6 Last electrons quantum NUMBERSI)3s 2 :n=3,l=0,m=0,s= 2+1 , 2−1 II)3P x2 :n=3,l=1,m=−1,s= 2+1 , 2−1 III)3P y2 :n=3,l=1,m=0,s= 2+1 , 2−1 IV)3P Z2 :n=3,l=1,m=1,s= 2+1 , 2−1 |
|
| 38. |
Can i ask a question answer this and give you 100 pointshow to reduce the effect of EM radiation hazard? |
|
Answer» These approaches involve reducing both the exposure level and duration.Disable Wireless Functions. Wireless devices — including ROUTERS, printers, tablets, and LAPTOPS — all emit a Wi-Fi signal. ...Replace Wireless With Wired Devices. ...Keep EMF SOURCES at a Distance. ...Use Your SMARTPHONE Safely. ...Prioritize SLEEPING Areas. |
|
| 39. |
Waves and sound 1. A low note has a time period of 0.0125 s. What is its frequency? A. 8 Hz C. 80 Hz B. 12.5 Hz D. 125 Hz |
|
Answer» a is the CORRECT ansExplanation: |
|
| 40. |
Name an alloy of: 1) Aluminium used in aircraft construction 2) An alloy of iron used in making chains ,electromagnet 3) An alloy of lead used in printing please answer fast ☺️ Your answer |
|
Answer» rzr7stixiyxoydtidoydtixtisrutustidyodyoctixruztiztixtixtitidtidt5i5d |
|
| 41. |
4. When a -particles are sent through athin metal foremost of them gostraight through the foil because :(A) a -particles are more heavierthan electrons(B)a -particles are positivelychargedMost part of the atom is emptyspacea-particles move with highvelocity |
|
Answer» tion:Good MorningAssalamoalikumExplanation:itni acchi good morning h Subscribe KR do yrrI need subscriber not blessings plss didiNoone is subscribing only saying ok i will but noone doI m very SAD Plss BOLO to karo bhi ABHI plss |
|
| 42. |
WHO DOES CREATES GODS TELL THE RIGHT ANSWER |
| Answer» GOD only CREATED each other by their POWERS. | |
| 43. |
1. Write down the educational uses ofmass media, |
| Answer» SEMENTS: (5) Educational television brings us a new kind of teaching team into EXISTENCE. (6) It can ACQUAINT the children with past culture, history and social life. (7) It can motivate both children and adults, because not only it is educative but also entertaining. | |
| 44. |
Write the rules for Drawing a ray diagram |
| Answer» ANS is in the ATTACHMENT...Explanation:here's ur ANSWER MATE | |
| 45. |
The _______ air rises in the equatarial region of earth |
| Answer» HOT and humid Explanation:HOPE it HELPS...U can ALSO write only hot | |
| 46. |
Unscramble the following words related to science with the help of the hints given this term is used to refer to object that should not be touched inhaled or swallowedPSNOIO |
|
Answer» poisonright?EXPLANATION: |
|
| 47. |
Rohans kidney is not working properly state the problem he is going to face |
| Answer» L QUESTION ctttcttvghiygt TI oojj ROMANO PERKINS i | |
| 48. |
Plastic are not affected byplease say |
| Answer» HEAT EXPLANATION:HOPE this HELPS you | |
| 49. |
During ravimetric cutimation in general. Cuis precipitated as(А)CuC(В)Cu(OІІ),(С)Cu(NO3)2(D)None of diese |
| Answer» | |
| 50. |
The cartilages are harder than bones true or false . |
|
Answer» True it's right answer.The CARTILAGES are harder than bones. The finger bones do not have joints. The fore arm has TWO bones. COCKROACHES have an OUTER skeleton.Explanation:HopeithelpU |
|