Saved Bookmarks
| 1. |
Good evening ❤❤Today's Question ✌Q.Calculate the compound interest for the second year on ₹8000 invested for 3 yrs at 10%p.a.Also find the sum due at the end of third year.no spamming otherwise______ |
|
Answer» cosA=5/13 sinA=-√(1-cos^2A) (since theta is in 4TH quadrant) i.e. sinA=-√144/169 =-12/13 tanB=-15/8 sinB=+(15)/√{(-15)^2+(8)^2} (B is in Q2) i.e. sinB=15/17 cosB=tanB/sinB i.e. cosB=-15/8 * 17/15 cosB=17/8 now sin(A+B)=sinAcosB+cosAsinB sin(A+B)=(-12/13)(17/8)+(5/13)(15/17) ={1/13}(-51/2 + 75/17) =(1/13)(-710/34) =-710/442 |
|