because singale bond so ane and iupasc name is butane

single bond is there so it's iupac name is BUTANE

butane because bond is single so ane and for carbon atom so butbut+ane = butane

eth,meth,prop,but-so carbon 4then it prove single bondC4H10=Butane

because of single bond it is butane because it has 4 carbon and 10 hydrogen

butane it name of molecules

there are four atom of carbon and single bond between each atom so,the name of this compound is butane

Butane because Singal bond

This Hydrocarbon compound's name is Butane

hello ,butane answer hai .

butane because bond is single so ane and for carbon atom so but

IUPAC=butanebecause single bond is there

Butane =C4H10 is carbon compond

It's BUTANE (C4H10)

I hope it Helps you

it's iupac name is "butane"because here the carbon no is 4 so it's called bute and here all the bonds are single so here we called "ane" , that's "butane"

butane as it have single bond and four carbon atoms

Butane because it is a single bond

IUPAC name is butane

IUPAC NAME IS BUTANE

According to me the answer is Butane

iupac name is butane hoga

because single bond so any and iupac name is butane

this is butane because here single bond is formed between each molecule

It's Butane because there is four carban and the single bond between them

it is having single bond and it is butane

It can be simplified as... C4H10... which is a single chained hydrocarbon having 4 carbon and 10 hydrogen... Also, it is Alkane because its group formula is CnH2n+2...Four carbon = ButGeneral formula of Alkane = Ane Hence name = " BUTANE"

the answer is "butane "

the answer is butane

butane is iupac name this qaution

the iupac name of this compund is butane

because singale bond so ane and iupasc name is butane

the answer of your question will be :- butane

the ans C4H10 correct

carbon Ka lama chain 4 hai air 4

carbon Ka lamba chain 4 Ka h aur 4 carbon ko butane bolenge

this chain name will be butane

This is the structure of (propane)

The IUPAC name of this carbon compound is Butane.

because their is single bond and these is butane

butane with general formula CnH2n+2

butane is the name of this bond

it's a Buten. so easy

It is butanebeacuse it has four carbon atom which are join by single bond

IUPAC name is butanae

command name is n butane

organic chemistry

because single bond so and iupasc name is butane

singal bond is there so it's iupac name is butane

the answer is Butane

butane is answer of question

Butane is the answer

butane because single bond

butane because this is single bond so name is butane

CH3-CH2-CH2-CH3CH3-CH(2+2+3)CH3-CH7-CH4

answer of this question is butane

since there is only single bond therefore its name i butane

It is single bond so the IUPAC name is Butane

the IUPAC name of following Organic alkane is beuten.

butane is the right answer

the IUPAC name of the given hydrocarbon chain is n-butane

it's IUPAC name is n- butane

because singale bond so ane and iupasc name is butane

Since Carbon has 4 covalent single bond so, this compound is butane

Butane is the correct answer

Butane. .

butane because it is because this compound is made of single bond so at the end of the name of the compound it will be ( ane ) as there 4 carbon so ( but ) at the first

0 is the answer for you quistion

C4H10 ishka answer hoga right

Butane is the right answer

The molecular formula of CH3-CH2-CH2-CH3 is Butane

Butane is IUPAC name to the given compound

butane because single bond

its iupac name is but and because of single bond added with ane .so name is butane

answer is butane because it has single bond

IUPAC Name:butane name

IUPAC name=Butane(C4 H10)

butane is a single bond

the given structure is butane

Isla iupac name butane

because singale bond so and iupac name is butan

these is single there is aiupac name is butane

single bond is their so that is why it's iupac name is 'BUTANE' this answer is right pls referee is answer

ब्यूटेन होगा क्युकी कार्बन के चार परमाणु है

this is a saturated bonding, the formula of it is CnH2n+2so c=4 = butethus the name of itbutane

H H H H l l l lH - C - C - C - C - H 1 l 2 l 3 l 4 l H H H H

Butane ( C H) ( 4 10)

Iupac is n-butane or butane pucca this is right answer

it contains 4 carbon atoms and 10 hydrogen atom so it is butane

C4H10 = Butane .

The right answer to this question is BUTANE

Butane because c4H10

ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन

This chain is known as BUTANE and fourth member or alkane group

this carbon compound form singal bondso it's iupac name is Butane(C4H10)

Butane is iupac name

C (Carbon) is four so it's shows ( But )According to Meth, Eth, Prop and But.And single bond shows ane.So But + ane = ButaneC4H10 = Butane

The name of this compound is Butane.

single bond is there.so its IUPAC name is But+ane=Butane

Butane ... contains 4 Carbons and Single bond

butane .reason > The bond between all the carbons is single so it's suffix is ane and 4 carbons means bute combine butane .

This is IUPAC name is a Butane

during single bond, it's butane

because of the single bond its name is BUTANE