This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 15351. |
Each of equal sides of isosceles right triangle is 20 cm. what is the semi perimeter of the triangle |
|
Answer» Answer: 20 + 10 root 2 Step-by-step explanation: LET ABC be an isosceles right TRIANGLE in which 2 cm AB =AC =20cm Hypotenuse BC = AB2+AC2 = a2+a2 =a 2=20 2CM. s =20+20+20 root 2 =40+20root 2 =20+10 root 2 |
|
| 15352. |
Factorise: ^3 − 2^2 − + 2 |
|
Answer» your QUESTION SEEMS to be INCOMPLETE.
|
|
| 15353. |
please re write this because tommorow is my paper think it is not correct.. I will mark as brainlist and follow you. this is Sanskrit sub. |
|
Answer» Answer: 1.इनका व्यकतीत्व अच्छे नही है। 2.ईनकी आक्रीडसी बेकार है। 5.यह कलाकार आकृषक है। 6.भारत के सैनिक भारत की रकशा करते है। |
|
| 15354. |
Factorize step by step : (x-2y)^2 - 5(x-2y)+6 |
|
Answer» {X-2y}/5x-10y+6 Step-by-step EXPLANATION: |
|
| 15355. |
2/1×1/2=________________ |
|
Answer» ²/²is the answer because it is answer |
|
| 15356. |
Write hai So check Please and wrong hai to write send me |
|
Answer» CORRECT answer! Step-by-step EXPLANATION: |
|
| 15357. |
(1-tanx) ^2+(1-cotx) ^2=(secx-cosecx) ^2 prove that |
|
Answer» Step-by-step EXPLANATION: |
|
| 15358. |
Find the remainder obtained on dividing p(x) = x3 + 1 by x + 1. |
|
Answer» Step-by-step EXPLANATION: X3+. +x2 __________ 2 + x3 |
|
| 15359. |
BODMAS of 9×(-8)×10- (37+4)+(-12) |
|
Answer» Step-by-step explanation:
=9×(-8)×10-41+(-12). (now we will multiply) =(-72)×10-41-12 =-720-40-12 =-760-12. (we will add the negative SIGN) =-772 Please follow me if this answer is correct |
|
| 15360. |
(-3)+7(-4) ______. 15-8+(-9) |
|
Answer» Step-by-step EXPLANATION: HOPE it will help you please follow me |
|
| 15361. |
Insert three rational no for 3/5and 2/3 |
|
Answer» |
|
| 15362. |
Explain area under curve and compute two correspond examples.... |
|
Answer» The area under a curve between two points can be FOUND by doing a definite integral between the two points. To find the area under the curve y = f(x) between x = a and x = b, INTEGRATE y = f(x) between the limits of a and b. Areas under the x-axis will come out NEGATIVE and areas above the x-axis will be positive. |
|
| 15363. |
Find values of k for which the pairs of linear equations 3x+(k+1)y=5k+1. (2k+1)x+15y=63 have infinitily many solutions |
|
Answer» just SOLVE like LINEAR equations u GET two VALUES of x and y values u get urs answer perfectly |
|
| 15364. |
From the Sum of 33 and (-47)subtract-74 |
|
Answer» Step-by-step explanation: 33+(-47)-(-74) =33-47+74 =107-47 =60 |
|
| 15365. |
(ii)integration of 3^xe^2xdx |
|
Answer» Step-by-step EXPLANATION: sry sry sry sry |
|
| 15366. |
(79-24)x (11-6)103.(5x9)-(13+12)का मान क्या है। |
|
Answer» प्रश्न 11 से 13 तक प्रत्येक अनुक्रम के पाँच पद ... x के किस मान के लिए संख्याएँ. Step-by-step EXPLANATION: MAY this ANSWER will help you plz mark has brainliest |
|
| 15367. |
What are full form of ST |
|
Answer» Answer: Plz,if it is correct plz rate ⭐me,like me and follow me and mark me as brainlist Step-by-step EXPLANATION: The full FORM of ST is Scheduled Castes(SCs). The schedule Castes & schedule tribes are officially DESIGNATED group of historically disadvantaged people in India. The terms are recognised in the constitution of India & the groups are DESIGNED in one or other of the categories. |
|
| 15368. |
Good evening ❤❤Today's Question ✌Q.Calculate the compound interest for the second year on ₹8000 invested for 3 yrs at 10%p.a.Also find the sum due at the end of third year.no spamming otherwise______ |
|
Answer» cosA=5/13 sinA=-√(1-cos^2A) (since theta is in 4TH quadrant) i.e. sinA=-√144/169 =-12/13 tanB=-15/8 sinB=+(15)/√{(-15)^2+(8)^2} (B is in Q2) i.e. sinB=15/17 cosB=tanB/sinB i.e. cosB=-15/8 * 17/15 cosB=17/8 now sin(A+B)=sinAcosB+cosAsinB sin(A+B)=(-12/13)(17/8)+(5/13)(15/17) ={1/13}(-51/2 + 75/17) =(1/13)(-710/34) =-710/442 |
|
| 15369. |
What is distributive and evaluate explain |
|
Answer» follow Step-by-step explanation: To “distribute” means to divide SOMETHING or give a SHARE or part of something. According to the distributive property, multiplying the sum of two or more addends by a number will give the same RESULT as multiplying each addend INDIVIDUALLY by the number and then adding the products together.
|
|
| 15370. |
Cards are marked with the numbers 4,5,6...50 are placed in the box and mixed thoroughly. One card is drawn at a random from the box. What is the probability of getting:- (i) an even prime number. (ii) a number divisible by 5. (iii) multiple of 7? |
|
Answer» i) 0 ii)10/50=1/5 iii) 7/50 |
|
| 15371. |
PaseStalerFIND THE EQUATION OF THE LINEWHOSE X ENTECEPT IS8 AND Y INTERCEPT is -12 |
|
Answer» Step-by-step EXPLANATION: |
|
| 15372. |
Find the equation of a straight line |
|
Answer» haaaaaaaaaaaaaáaaaAaãaaaaaaaad |
|
| 15373. |
Expand the following number using exponent18964.63 |
|
Answer» Answer: 10000+8000+900+60+4+6/10+3/100 |
|
| 15375. |
Please solve this math...the question is in picture... |
|
Answer» =(m-3)(m^2+1) Step-by-step EXPLANATION:
|
|
| 15376. |
Factorise. 2b(3a-b+6ac-c)DO FAST |
|
Answer» Answer: b(3a+6ac-c) Step-by-step EXPLANATION: since only 2B and b are the like TERMS we can subtract them and we will get b 2b-b =b the others are UNLIKE terms so this MEANS that they stay the same. i hope this answers your question. mark me as brainliest |
|
| 15377. |
(A2. If the system of equations 4x - 5y = 6 and -12x + ay = b is inconsistent, which of the followingcannot be the value of b ?(A) - 16(B) - 18(C) - 20(D) - 22 |
| Answer» | |
| 15378. |
A competes 40 per cent of the work in 9 days and then calls B and competes the remainingwork in 6 days. How long will it take for B to complete the whole work alone? |
| Answer» | |
| 15379. |
if the zeroes of the quadratic polynomial x2+(a+1) x+b are 2and -3 the |
| Answer» | |
| 15381. |
72600÷12 full solution written in copy its urgent ☹️ |
|
Answer» Answer: 72600÷12=6050 hope it HELPS |
|
| 15383. |
2x + 3y=03x +4y=5solve by substitution method |
|
Answer» Answer: x=15 and y =-10 Step-by-step explanation: Given :
To find : solve this by SUBSTITUTION METHOD and ELIMINATION method Solution: Substitution method : ---A ----B Substitute the value of x from A in B Substitute the value of y in A So, x=15 and y =-10 Please mark me as a brainliest |
|
| 15384. |
Express each of the followingin the form of p/q (i) 8•0025(ii) 0•00026(iii) 0•5 bar Urgent guys fastI will mark it as brainlist..../╲/\╭(•‿•)╮/\╱\ |
|
Answer» Answer: 1. 80025/10000 2. 26/100000 |
|
| 15385. |
If the polynomial az^3+4z^2+3z-4 and z^3-4z+a leave the same remainder when divided by (z-3) find the value of a. |
|
Answer» Step-by-step EXPLANATION: a(3)³+4(3)²+3(3)-4 solve this u GET urs answer perfectly (3)³-4(3)+a 27-12+a=0 15+a=0 a=-15 OK FRIEND this is urs answer |
|
| 15386. |
Draw a circle of radius 3.6 cm. Draw a tangent to the circle at any point on itwithout using the centre. |
| Answer» | |
| 15387. |
72600÷12 full solution its urgent ☹️ |
|
Answer» Answer: 6050..... Step-by-step explanation: 72600/12 = 6050 |
|
| 15388. |
हम मूपराद अददात co-primo में एक 7 हौगा तो दूसरा_______होगा? |
| Answer» | |
| 15389. |
Can any body suggest me time table for doing study and some time to chill(5 : 30 am to 12 : 30 am ) Feild - Science it would be a great help.: ) : ) : ) |
|
Answer» 5:30 to 6:30 - SCIENCE 6:30 to 7:30 - math 7:30 to 8:30 - SOCIAL science 8:30 to 9:00 - break 9:00 to 9:30 - it 9:30 to 10:30 - English 10:30 to 11:30 - TAMIL 11:30 to 12:30 - all subjects revision hope HELPS you... thank you.... |
|
| 15390. |
Solve for x and y : 2/ x-1 +3/y-2= 1 , 5/x-1+ 6/y-2 = 7 PLZ ANYONE SOLVE IT FAST.................... |
|
Answer» Given 2/x-1 +3/y-2 = 1 let m= 1/x-1 , n= 1/y-2 2m+3n=1 5m+6N,= 7 = 4M +6n= 1 ( multiply the 1 equation with 2) = 5m+6n = 7
= -1M = -6 m= 6 from1 2m + 3n= 1 12 + 3n = 1 n= 1-12/3 n= -11/3 now, m= 1/x -1 x = 7/6 n= 1/y-2 y= -5/3 |
|
| 15391. |
Please help me with this someone. (x+1/2)(2x−1/2) |
|
Answer» |
|
| 15392. |
X to the power 8=X to the power 4Q-How many values can b x and how?? |
|
Answer» Answer: X={-1,0,1} Step-by-step EXPLANATION: |
|
| 15393. |
10. Priti allows 8% discount on the marked price of the suits and still maleof 15%. If her gain over the sale of a suit is 156, find the marked prio |
|
Answer» Step-by-step explanation: priti ALLOWS 8% discount on the MARKED price of a suits and still makes a profit of 15%. if her gain over the SALE of a SUIT is RS 156,find the marked price of a suit. hind= let marked price be x. Plse mark me as BRAINLIEST |
|
| 15394. |
Write the equation of line parellel to y axis and passing through the point1) (-4,0)2)(3,5) |
|
Answer» SINCE the line is parallel to y-axis, its slope will be same as y-axis i.e. 1/0 ALSO, it passes THOUGH the point (-4,-5) So according to the formula of line : y' -y = m(x'-x) where (x',y') is the points through which the required line passes and m is the slope of the line. -5-y = 1/0 (-4 -x) =>0=-4-x => Required EQUATION is x = -4 |
|
| 15395. |
If 175/a = a/63, then the value of 'a' is ___________ A.115 B.135 C.105 D.145 |
Answer» HOPE THIS HELPS YOU_________________✌️✌️✌️ |
|
| 15396. |
Insert three rational number between 1/5 and 1/2 |
|
Answer» Answer: Step-by-step EXPLANATION: find THREE rational number between 1/5 1/2 given number =1/5 1/2 =1/5;3/5+1/2 =1/5;4/5;1/5 =1/5,1/5+4/5,4/5,4/5+1/2 =1/5,4/5,5/5,5/7,1/2 three number are=4/5,5/5,5/7 here your answer MAKE it brainlist |
|
| 15398. |
If x^2+1/x^2=7, find the value of x^3+1/x^3 |
Answer» Answer:( when X + 1/x = 3 )
( when x + 1/x = -3 )
Step-by-step explanation:[Given that] → x² + 1/x² = 7 [ADDING 2 both sides to make LHS a perfect square] → x² + 1/x² + 2 = 7 + 2 [ ∵ (x) (1/x) = 1 ] → (x)² + (1/x)² + 2 (x) (1/x) = 9 [ using algebraic identity (a+b)² = a² + b² + 2 ab ] → ( x + 1/x )² = 9 → x + 1/x = ±3 ▶ Taking x + 1/x = 3 → x + 1/x = 3 [ cubing both sides ] → (x + 1/x)³ = 3³ [ using identity ( a + b )³ = a³ + b³ + 3 ab ( a + b ) ] → x³ + 1/x³ + 3 (x) (1/x) ( x +1/x) = 27 → x³ + 1/x³ + 3 ( 3 ) = 27 → x³ + 1/x³ = 27 - 9 → x³ + 1/x³ = 18 ▶ Taking x + 1/x = -3 → x + 1/x = -3 [ cubing both sides ] → ( x + 1/x )³ = (-3)³ → x³ + 1/x³ + 3 (x) (1/x) (x + 1/x) = -27 → x³ + 1/x³ + 3 ( - 3 ) = -27 → x³ + 1/x³ = -27 + 9 → x³ + 1/x³ = -18 |
|
| 15399. |
Oranges are bought at 5 for a rupee and sells them at 2 for a rupee. His gainpercent is |
| Answer» | |
| 15400. |
Solution plz .????????????? |
|
Answer» a) 3/5 * 6/7 B)2/3 * 4/7 Step-by-step EXPLANATION: PFA Hope it HELPS you; Mark as the brainliest |
|