This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
10.Name a solid which show both schottky and frenkel defect. |
|
Answer» Schottky defect, basically a vacancy defect, arises in ionic crystals when equal number of anions and cations are missing from their normal lattice sites, resulting in the formation of a pair of holes. Schottky defect is generally found in strongly ionic compounds having high coordination number and made up of anions and cations of nearly same size. On the other hand Frenkel defect arises when a cation leaves it's normal lattice position and occupies an interstitial position. Frenkel defect is generally found in compounds having low coordination numberand made up of canions and cations of widely different sizes i.e., anion much larger than cation. Although these conditions seem to be just opposite to each other, yet AgBr shows both the defects. It is because AgBr crystal has a coordination number of 6 which is neither high nor low. The radius ratio of AgBr is also intermediate, thus AgBr satisfies the conditions to exhibit both type of defects. P.S.: frenkel defect is more commen in AgBr because silver ions due to their small size easily occupy interstitial sites while comparitively larger bromide ions doesn't leave their position that easiy. |
|
| 2. |
Effects of Schottky and Frenkel Defects |
|
Answer» A Schottky defect is a type of point defect in a crystal lattice named after Walter H. Schottky. ... In ionic crystals, the defect forms when oppositely charged ions leave their lattice sites, creating vacancies. These vacancies are formed in stoichiometric units, to maintain an overall neutral charge in the ionic solid. A Frenkel defect or dislocation defect is a type of defect in crystalline solids where in an atom is displaced from its lattice position to an interstitial site, creating a vacancy at the original site and an interstitial defect at the new location without any changes in chemical properties. |
|
| 3. |
A child staying in a coastal region tests the drinking water and also theseawater with his tester. He finds that the compass needle deflects morein the case of seawater. Can you explain the reason? |
| Answer» | |
| 4. |
toor as theurade. ..o-onaad-NqDH-..to_căăź,tal c..._c tne s R0 |
| Answer» | |
| 5. |
what is the difference between schottky defect and Frankel defect |
| Answer» | |
| 6. |
What are the 2 ways in which the physical statof matter can be changed ? |
|
Answer» The two main ways of changing physical states of matter include heatingandcooling.Evaporation involves theheatingof a substance till it changes into a gaseous state. Some substances under a change from solid to gas directly without first changing into liquid, a process called sublimation. |
|
| 7. |
State three reasons why you think air is a mixture and water is a compound. |
| Answer» | |
| 8. |
why the inter-conversion of state ofmatter is considered as a physical changeSive three reasons to justify your newsWer |
|
Answer» because only change of matter is take place on it so it is a physical change it is a physical change because only change of matter is take place on it so it is a physical change |
|
| 9. |
The percentage composition of water crystalin Na, Co,. 10H, O is- |
|
Answer» percentage composition is 62.9% Washing soda crystals hydrated = >Na2CO3.10H2OMolar mass = 286molar mass of water = 180 % of water = > 180/286*100= > 62.93 4.0 22 votes |
|
| 10. |
59.Explain R, S configuration system of nomenclature. |
|
Answer» Stereocenters are labeledRorS. The "right hand" and "left hand" nomenclature is used to name the enantiomers of a chiral compound. The stereocenters are labeled asRorS. Consider the first picture: a curved arrow is drawn from the highest priority (1) substituent to the lowest priority (4) substituent |
|
| 11. |
16. Percentage composition of hydrogen in ethane isAno |
|
Answer» The% w/wofHinC2H6 [ethane]is: % H= (MH,tot/MC2H6) ×100% where: MHis themolar mass of hydrogen,1.0079 g/mol, andMH,totis thetotalmass contributed by hydrogen in the compound. There are6equivalents of hydrogen in ethane, so we need to account for that. MC2H6is themolecular mass of ethane, which is the sum of the atomic masses of carbon and hydrogen. MC2H6=2×12.011+6×1.0079=30.069 g/mol Hence, the% w/wofHis: % H= 6×1.007930.069×100% =20.11% |
|
| 12. |
what is nomenclature properties of ethanol |
|
Answer» 1.Nomenclature is a system of names or terms, or the rules for forming these terms in a particular field of arts or sciences. Probably the best known of these nomenclatural systems are the five codes of biological nomenclature that govern the Latinized scientific names of organisms. 2.Pure ethanol is a flammable, colorless liquid with a boiling point of 78.5° C. Its low melting point of -114.5° C allows it to be used in antifreeze products. It has a pleasant odor reminiscent of whiskey. Its density is 789 g/l about 20% less than that of water. |
|
| 13. |
16. In IUPAC nomenclature, the term cydleindicates the presence of a(A) ring(C) substituent(B) straight chain(D) side branch |
|
Answer» Cyclic hydrocarbons have the prefix "cyclo-" and have an "-alkane" ending unless there is an alcohol substituent present. When an alcohol substituent is present, the molecule has an "-ol" ending.hence option c |
|
| 14. |
Use identities, evaluate$ 71^{2} $$ 5.2^{2} $ |
| Answer» | |
| 15. |
2 Nard +H250g – 2400 & Na 2504calculate the mass et sodium chloride requireto get 150grams at Hell |
| Answer» | |
| 16. |
QUIILABRIUMof forward reactilon becomes oqual to the rate of bxokward renton."Chemical equilibrium is a state in a reversible reaction when the ratereaction becomes equal to the rate of backward reaction".The concentrations nf th |
|
Answer» Areversible reactioncan proceed in both theforwardandbackwarddirections. Equilibriumis when therateof theforward reaction equalstherateof thereverse reaction. All reactant and product concentrations are constant atequilibrium. |
|
| 17. |
94.The horizontal range is four times the maximum height attained by a projectile. The angle of projection is(b) 60°(c) 45°(d) 30 [MP PET 194(a) 90°-Aand (45the horizontal ranges described by the |
|
Answer» 60° is the angle of projection.so , option b is the right ome 45 degree is the correct answer |
|
| 18. |
Drawa labelled diagram of Chlamydom |
| Answer» | |
| 19. |
Sin2x-sin4x + sin6x |
|
Answer» sin2x - sin4x + sin6x = 2sin4xcos2x - 2sin2xcos2x = 2cos2x(sin4x - sin2x) = 4sin3x * cosx * cos2x |
|
| 20. |
3.Give the IUPAC name of the following compoundCH,COOH |
| Answer» | |
| 21. |
Write the IUPAC name of the following compound:CH-C-CH3 |
| Answer» | |
| 22. |
WW W WINCIAL, LULUwure the tree state.What chemical process is used for obtaining a metal from its oxide? |
|
Answer» Answer : Reduction .In this process, metal oxides arereducedby using suitable reducing agentssuchas carbon or by highlyreactivemetals to displace the metals from their oxides. |
|
| 23. |
. Write empirical formula of the following compounds.A) BenzeneB) Sodium bicarbonate |
|
Answer» 1 2 |
|
| 24. |
.:. Empirical formula of compound CH14. Calculate the mass of 1 atom of C |
| Answer» | |
| 25. |
2. Given that the abundances of isotopes 54Fe, 56Fe and 57Fe are 5%, 90% and 5% respectively, the atomic mass of FeisA) 55.85%VB) 55.95%C) 55.75%D) 56.05% |
|
Answer» atomic mass of Fe = (0.05*54+0.9*56+0.05*57) = 55.95 |
|
| 26. |
e) Connective tissue with a luluuid TThu18. An element 'x'has atomic number 13 and atomic mass 27:a) Draw the atomic structure of atom'x'b) Write number of Protons and neutrons in the nucleusof atom 'xc) State the name given to the combining capicity of anatom.d) Magnesium has 12 protons and 12 neutrons. Find thevalency of the magnesium. |
|
Answer» b) 13,14c) valencyd)2 (c )valency(b)13,14d 2 |
|
| 27. |
6. Determine the empirical formula of an oxide of iron which has 69.9% iron and 30.1% dioxygenby mass. [Atomic mass: Fe = 55.85, O = 16.00 |
| Answer» | |
| 28. |
State which of the following has more number of atoms?(a) 100 g of Sodium (b) 100 g of Iron(Given Atomic mass of Na023 u, Fe 5 5Q) |
|
Answer» Gram atomic mass of sodium = 23g 1 mole or 23g of sodium contains6.023 X 10^23atoms Then 100g of of sodium contains --------atoms = 100 X 6.023 X 10^23/23 = 2.6182 X 10^24atoms Gram atomic mass of iron = 56g 1 mole or 56 g of iron contains6.023 X 10^23atoms Then 100g of iron contains ----------atoms = 100 X6.023 X 10^23/ 56 = 1.0753 X 10^24 Therefore, 100g of sodium contains more number of atoms than 100g of iron. |
|
| 29. |
6 C State which of the following has more number of atoms?(a) 100 g of Sodium(b) 100 g of IronGiven Atomic mass of Na023 u, Fe 55) |
| Answer» | |
| 30. |
8] Explain why boiling point of inert gases increases with increases in atomic mass. |
|
Answer» The melting and boiling points of noble gases are very low in comparison to those of other substances of comparable atomic and molecular masses. This indicates that only weak van der Waals forces or weak London dispersion forces are present between the atoms of the noble gases in the liquid or the solid state. The van der Waals force increases with the increase in the size of the atom, and therefore, in general, the boiling and melting points increase fromHeHetoRnRn. Helium boils at−269∘C−269∘C. Argon has larger mass than helium and have larger dispersion forces. Because of larger size the outer electrons are less tightly held in the larger atoms so that instantaneous dipoles are more easily induced resulting in greater interaction between argon atoms. Therefore, its boiling point (−186∘C−186∘C) is more than that ofHeHe. Similarly, because of increased dispersion forces, the boiling and melting points of monoatomic noble gases increase from helium to radon. |
|
| 31. |
om.mallestProjectFind out the applications of all theinert gases, prepare a chart and display itin the class. |
|
Answer» what's your question I'm not understand 1)it is used in bulbs2)it is used in sign bulbs3)Filling ballons4)Food packing5)Arc Welding6)High speed photography7)Treatment of arthrities |
|
| 32. |
Why does Inert gases placed in Zero group |
|
Answer» Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gasesare chemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency. bhtt hadd bhtt haddd nhii ho pyega because they have no valence electrons Inert gas elements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence, inert gasesarechemically inert andplaced in zero group(Group-viii) in the periodic table. ... So , theyare placed in zero grou valency of inert gas elements is 0. so they are placed in zero group. because they have zero electrons in their valency shell and doesn't react with other elememnts because they have zero electronc in their valency shell and doesn't react with other elememnts because they have no electrons in valence shell Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gases arechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency. because inert gases can not react with anything and their outermost or valence shell is completed or full Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gases arechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency. निष्क्रिय गैस तत्वों में उनके बाहरी सबसे अधिक शेल पूर्ण या पूर्ण होते हैं। इसलिए उनके पास इलेक्ट्रॉनों को देने या प्राप्त करने के लिए किसी भी रासायनिक प्रतिक्रिया में प्रवेश करने की कोई प्रवृत्ति नहीं है। इसलिए, अक्रिय गैसों को रासायनिक रूप से निष्क्रिय किया जाता है और आवर्त सारणी में शून्य समूह (समूह- viii) में रखा जाता है। शून्य गैस के साथ निष्क्रिय गैसें। because valency is 0 in outermost shell Inertgas elements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inertgasesarechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inertgases withzerovalency. because his orbital is full because inert gases have zero electron in their valence shell as their outermost shell is completely filled have 8 e- so they are placed in zero group they have complete octet .....do not require any gain or lose of electron because they found late inert gases placed in zero group because they have it electrons in the outermost balance and zero group is also known as 18 group so 8 electrons in valence shell represents the 18 group and they are most stable as they do not react with any element element in zero group are known as noble gases because of their symmetric outermost electronic configuration of (nS2nP6) except He(1S2) they are most stable do not undergo any chemical reaction (except Xe) are kept in group 18 which is also zero group because the outermost shell of inert gas is completely filled Because their outermost orbit is complete.in mendeleevs original periodic table there was no place reserved for noble gas.they was discovered in end of 19th century.so mendeleev created zero group without disturbing original periodic table. |
|
| 33. |
Why does Inert gases placed in Zero group? |
|
Answer» Inert gases have a complete outermost orbit. So, it's valency is zero. Therefore, It is placed in zero group. |
|
| 34. |
What are medicines? Which is used for prevention of heart attack? |
|
Answer» Medicine is a drug or other preparation for the treatment or prevention of disease.Statins aremedicinesthat reduce the risk ofheart attackand stroke by helping to lower orpreventhigh cholesterol. |
|
| 35. |
How many lattice point are there in one unit cell of each of the following latticea. FCCb. End CCс. ВСС |
|
Answer» a) Face Centered Cubic: (8⋅1/8)+(6⋅1/2)=4 lattice points per unit volume c) Body Centered Cubic: (8⋅1/8)+1=2 lattice points per unit volume |
|
| 36. |
. Copper crystallises in ab bcc lattice with edgelength 'a equal to 387 pm. The distance betweentwo oppositely charged ions in the lattice is(A) 335 pm(B) 250 pm |
| Answer» | |
| 37. |
Q.5-Define (a) Lattice Enthalpy (b) Bend Order. |
|
Answer» (I) Lattice Enthalpy:-The lattice energy of a crystalline solid is a measure of the energy released when ions are combined to make a compound. It is a measure of the cohesive forces that bind ions. Lattice energy is relevant to many practical properties including solubility, hardness, and volatility. (ii)Bond number is the number of electron pairs between a pair of atoms. For example, in diatomic nitrogen N≡N the bond number is 3, in acetylene H−C≡C−H the bond number between the two carbon atoms is also 3, and the C−H bond order is 1. Bond number gives an indication of the stability of a bond. |
|
| 38. |
निम्नलिखित ईथरों को HI के साथ गरम करने से प्राप्त मुख्य उत्पाद दीजिए।CH(i) CH-CH, CH-CH-0-CH-CH,CH;(ii) CH-CH-CH,-0-c-CHECH,CH, |
| Answer» | |
| 39. |
O CH₂ - CH2 - CH2 - CH3 |
|
Answer» because singale bond so ane and iupasc name is butane single bond is there so it's iupac name is BUTANE butane because bond is single so ane and for carbon atom so butbut+ane = butane eth,meth,prop,but-so carbon 4then it prove single bondC4H10=Butane because of single bond it is butane because it has 4 carbon and 10 hydrogen butane it name of molecules there are four atom of carbon and single bond between each atom so,the name of this compound is butane Butane because Singal bond This Hydrocarbon compound's name is Butane hello ,butane answer hai . butane because bond is single so ane and for carbon atom so but IUPAC=butanebecause single bond is there Butane =C4H10 is carbon compond It's BUTANE (C4H10) I hope it Helps you it's iupac name is "butane"because here the carbon no is 4 so it's called bute and here all the bonds are single so here we called "ane" , that's "butane" butane as it have single bond and four carbon atoms Butane because it is a single bond IUPAC name is butane IUPAC NAME IS BUTANE According to me the answer is Butane iupac name is butane hoga because single bond so any and iupac name is butane this is butane because here single bond is formed between each molecule It's Butane because there is four carban and the single bond between them it is having single bond and it is butane It can be simplified as... C4H10... which is a single chained hydrocarbon having 4 carbon and 10 hydrogen... Also, it is Alkane because its group formula is CnH2n+2...Four carbon = ButGeneral formula of Alkane = Ane Hence name = " BUTANE" the answer is "butane " the answer is butane butane is iupac name this qaution the iupac name of this compund is butane because singale bond so ane and iupasc name is butane the answer of your question will be :- butane the ans C4H10 correct carbon Ka lama chain 4 hai air 4 carbon Ka lamba chain 4 Ka h aur 4 carbon ko butane bolenge this chain name will be butane This is the structure of (propane) The IUPAC name of this carbon compound is Butane. because their is single bond and these is butane butane with general formula CnH2n+2 butane is the name of this bond it's a Buten. so easy It is butanebeacuse it has four carbon atom which are join by single bond IUPAC name is butanae command name is n butane organic chemistry because single bond so and iupasc name is butane singal bond is there so it's iupac name is butane the answer is Butane butane is answer of question Butane is the answer butane because single bond butane because this is single bond so name is butane CH3-CH2-CH2-CH3CH3-CH(2+2+3)CH3-CH7-CH4 answer of this question is butane since there is only single bond therefore its name i butane It is single bond so the IUPAC name is Butane the IUPAC name of following Organic alkane is beuten. butane is the right answer the IUPAC name of the given hydrocarbon chain is n-butane it's IUPAC name is n- butane because singale bond so ane and iupasc name is butane Since Carbon has 4 covalent single bond so, this compound is butane Butane is the correct answer Butane. . butane because it is because this compound is made of single bond so at the end of the name of the compound it will be ( ane ) as there 4 carbon so ( but ) at the first 0 is the answer for you quistion C4H10 ishka answer hoga right Butane is the right answer The molecular formula of CH3-CH2-CH2-CH3 is Butane Butane is IUPAC name to the given compound butane because single bond its iupac name is but and because of single bond added with ane .so name is butane answer is butane because it has single bond IUPAC Name:butane name IUPAC name=Butane(C4 H10) butane is a single bond the given structure is butane Isla iupac name butane because singale bond so and iupac name is butan these is single there is aiupac name is butane single bond is their so that is why it's iupac name is 'BUTANE' this answer is right pls referee is answer ब्यूटेन होगा क्युकी कार्बन के चार परमाणु है this is a saturated bonding, the formula of it is CnH2n+2so c=4 = butethus the name of itbutane H H H H l l l lH - C - C - C - C - H 1 l 2 l 3 l 4 l H H H H Butane ( C H) ( 4 10) Iupac is n-butane or butane pucca this is right answer it contains 4 carbon atoms and 10 hydrogen atom so it is butane C4H10 = Butane . The right answer to this question is BUTANE Butane because c4H10 ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन This chain is known as BUTANE and fourth member or alkane group this carbon compound form singal bondso it's iupac name is Butane(C4H10) Butane is iupac name C (Carbon) is four so it's shows ( But )According to Meth, Eth, Prop and But.And single bond shows ane.So But + ane = ButaneC4H10 = Butane The name of this compound is Butane. single bond is there.so its IUPAC name is But+ane=Butane Butane ... contains 4 Carbons and Single bond butane .reason > The bond between all the carbons is single so it's suffix is ane and 4 carbons means bute combine butane . This is IUPAC name is a Butane during single bond, it's butane because of the single bond its name is BUTANE |
|
| 40. |
what's are alkane |
|
Answer» alkane are hydrocarbons following formula CnH2n+2 c↓nH↓2n+2is formula of alkane. any of a series of gases that contain hydrogen and carbon In organic chemistry, an alkane, or paraffin, is an acyclic saturated hydrocarbon. In other words, an alkane consists of hydrogen and carbon atoms arranged in a tree structure in which all the carbon–carbon bonds are single. Alkanes have the general chemical formula CₙH₂ₙ₊₂. Alkenes, also known as olefins, are organic compounds that consist of carbon and hydrogen atoms with one or more carbon-carbon double bonds in their chemical structure.Alkenesare unsaturated hydrocarbons. ... We can see two carbon atoms that are bonded together with a double bond, and they can be illustrated in two ways. Alkenes, also known as olefins, are organic compounds that consist of carbon and hydrogen atoms with one or more carbon-carbon double bonds in their chemical structure.Alkenesare unsaturated hydrocarbons. ... We can see two carbon atoms that are bonded together with a double bond, and they can be illustrated in two ways. Alkanes are saturated hydrocarbons. By saturated hydrocarbons, it means alkanes have single hydrogen and carbon atoms in their chemical formula. Formula of alkane is CnH2n+2. Methane, propane, ethane, and butane are four alkanes.Let us learn in detail about Alkane and physical properties of the alkane. Inorganic chemistry, analkane, orparaffin(a historical name that also hasother meanings), is anacyclicsaturatedhydrocarbon. In other words, an alkane consists ofhydrogenandcarbonatoms arranged in atreestructure in which all thecarbon–carbon bondsaresingle.[1]Alkanes have the general chemical formula CnH2n+2. The alkanes range in complexity from the simplest case ofmethane(CH4), wheren=1 (sometimes called the parent molecule), to arbitrarily large and complex molecules, likepentacontane(C50H102) or 6-ethyl-2-methyl-5-(1-methylethyl) octane, anisomeroftetradecane(C14H30). Alkanesare chemical compounds that consist of carbon (C) and hydrogen (H) atoms, so they are also called hydrocarbons. ... Taking a look at ethane and pentane, thesealkanesare referred to as saturated because they only contain single bonds, and because of that, each carbon atom is saturated with hydrogen atoms. any of a series of gases that contain hydrogen and carbon |
|
| 41. |
alcoholdoalkane. |
|
Answer» Dehydration to alkenes. Converting an alcohol to an alkene requires removal of the hydroxyl group and a hydrogen atom on the neighbouring carbon atom. Because the elements of water are removed, this reaction is called a dehydration. The dehydration reaction of alcohols to generate alkene proceeds by heating the alcohols in the presence of a strong acid, such as sulfuric or phosphoric acid, at high temperatures. i want example reaction |
|
| 42. |
eAAlKane Akleno ane Akyte andConuonsien a,Alkane |
|
Answer» In organic chemistry, a hydrocarbon is an organic compound consisting entirely of hydrogen and carbon. Hydrocarbons are examples of group 14 hydrides. Hydrocarbons from which one hydrogen atom has been removed are functional groups called hydrocarbyls. |
|
| 43. |
which of the following are alkane CH4 , C2H6,C2H4, C3 H6 and C3H8 |
|
Answer» Alkane have formula = CnH2n+2 answer - CH4 , C2H6 , C3H8 |
|
| 44. |
Alkane |
|
Answer» Alkanesare chemical compounds that consist of carbon (C) and hydrogen (H) atoms, so they are also called hydrocarbons. The chemical structure of alkanes only consists of single bonds. This illustration shows examples of the chemical structures of two alkanes: ethane and pentane. |
|
| 45. |
Alkane |
|
Answer» In organic chemistry, an alkane, or paraffin, is an acyclic saturated hydrocarbon. In other words, an alkane consists of hydrogen and carbon atoms arranged in a tree structure in which all the carbon–carbon bonds are single. Alkanes have the general chemical formula CₙH₂ₙ₊₂. |
|
| 46. |
\begin{array}{c}{\mathrm{CH}_{3}} \\ {\mathrm{CH}_{3}-\mathrm{C}-\mathrm{CH}_{2}-\mathrm{CH}_{2}-\mathrm{CH}-\mathrm{CH}_{3} \text { . }} \\ {\mathrm{CH}_{3}}\end{array} |
| Answer» | |
| 47. |
\begin{array} { l } { \mathrm { CH } _ { 3 } = \mathrm { CH } _ { 3 } } \\ { \mathrm { CH } _ { 2 } - \mathrm { CH } - \mathrm { CH } _ { 2 } } \\ { \mathrm { CH } _ { 2 } \mathrm { CH } _ { 2 } \mathrm { CH } _ { 3 } } \end{array} |
|
Answer» what m I supposed to do? name the organic compound it's octane as there are 8 Carbons which means 'Oct' and all have single bonds which means 'ane' no re. by iupac rules, u gotta take the longest chain. I guess it's 3 methyl heptane but I'm not sure. yes it's 3 methyl heptane |
|
| 48. |
\begin{array}{c}{\mathrm{CH}_{3}} \\ {\mathrm{CH}_{3}-\mathrm{CH}-\mathrm{CH}_{2}-\mathrm{CH}-\mathrm{CH}}\end{array} |
| Answer» | |
| 49. |
42. IUPAC name ofCH3(or) CH, C- CH, (or) C(CH,),CH3 |
|
Answer» 2-2di methyle propane 2,2-dimethyl propaneoption 1 |
|
| 50. |
6.The number of 1° carbon atoms in following compound are:CH,CHCH,-C- GH2-C- CHCH, CH |
|
Answer» The number of 1° carbon is 6. 1° - carbon connected to only 1 carbon in its adjacent |
|