This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
42. Calculate the wavelength and enrgy of radiation emitted for the electronic transition from infinite to stationary state ofhydrogen atom. (Given, R 1.09678 x10 m1h-66256x10-34Js and c2.9979 x 10°ms1)9.11 x 10-8m and 2.17 x 10-18JB) 8.11 x 10-7m and 3.14 x 10-16JVe) 5.14 x 10-18m and 4.14 x 10-18J11.17 x 10-8 m and 2.17 x 10-18J |
| Answer» | |
| 2. |
A radioactive element has half life period of 140days. How much of it will remain after 1120 days(a) 1/32 41/256 401/512 (d) 1/128036. |
| Answer» | |
| 3. |
More than one option(up to 89)86) Rate Jaw cannot be determined from balancedchemical equation ifa) Reverse reaction is involvedb) It is an elementary reactionc) Itis a sequence of elementary reactionsd) Any of the reactants is in excess |
|
Answer» Solution:(a, c, d) Rate law can be determined from balanced chemical equation if it is an elementary reaction. |
|
| 4. |
EVOLTION oF LIFE FoRMS |
|
Answer» Overview of Evolution Evolution is the process of change that has given us the Reality we have today.It has painted Life in the size, shape, colors, population frequency and activities that we find in every part of the World.It is not something of the past, but it is more of the present that leads to the future.It is the inherited traits of a population of organisms through successive generations. This change results from interactions between processes that introduce variation into a population, and other processes that remove it. MUTATION is a major cause of genetic changes. These hereditary changes are passed on through reproduction and may give rise to alternative traits in organisms. Mutation may also be caused by variations in genetic recombination, which shuffles the genes into new combinations that can result in organisms exhibiting different traits. NATURAL SELECTION – Traits that aid survival and reproduction become more common, while traits that hinder survival and reproduction become rarer. Natural selection occurs because only a small proportion of individuals in each generation will survive and reproduce, since resources are limited and organisms produce many more offspring than their environment can support. ADAPTATION is a process that adjusts traits so they become better suited to an organism’s environment. Over many generations, heritable variation in traits is filtered by natural selection and the beneficial changes are successively retained through differential survival and reproduction which is Adaptation. GENETIC DRIFT is another cause of evolution which leads to random changes in how common traits are in a population. Genetic drift is most important when traits do not strongly influence survival—particularly so in small populations, in which chance plays a disproportionate role in the frequency of traits passed on to the next generation. SPECIATION is a key process in evolution in which a single ancestral species splits and diversifies into multiple new species. Ultimately, all living (and extinct) species are descended from a common ancestor via a long series of speciation events. |
|
| 5. |
the depression in freezing point of water when 10 g of CH3CH CH(C)COOH is added to 250 g of(C.B.S.E. 2008 Supp.)water. Ka-1-4 × 10-3. Kf-186 K kg mol-1. |
| Answer» | |
| 6. |
Whatvolumeofopgengas(O)measuredatorot 0°Cand 1 atm, is needed to burn completely 1 L ofpropane gas (C3 Hg) measured under the sameconditions?(1) 10 L(3) 6 L(2) 7 L(4) 5 L |
| Answer» | |
| 7. |
20. The ionization potential of hydrogen is 13.6 eV/atom. The energy required to produce H+ ionsfrom 500 mg of hydrogen atoms is about(a) 1312 kJ(b) 656 kJ(c) 656 )(d) 1312 J.. |
|
Answer» 656 johhhjiohugymgu the answer could be option c |
|
| 8. |
Which solid has highest melting(b)Molecularpoint?(a) lonic solidsolid(c) Covalent solidsolid(d)Metallic |
|
Answer» This generally leads to low melting points for covalent solids, and high melting points for ionic solids. For example, the molecule carbon tetrachloride is a non-polar covalent molecule, CCl4. It's melting point is -23°C. By contrast, the ionic solid NaCl has a melting point of 800°C. (a) is correct option the correct option will be a...because due to strongest bond formed between the molecules is ionic bond thus it should have highest melting point..... |
|
| 9. |
1.AIN is an example of(a) Metallic Solid(b) Covalent Solid(c) lonic Solid(d) of these |
|
Answer» Option- BIt is a crystalline covalent or network solid |
|
| 10. |
using the modern periodic table explain metallic and non metallic characters? |
| Answer» | |
| 11. |
dilute sulpuric acid reacts with sodium carbonate |
|
Answer» h2so4 + na2co3 na2so4 h2co3 When dilute sulphuric acid reacts with sodium carbonate salt, it produces sodium sulphate and water in the aqueous medium. It also releases carbon dioxide gas in this reaction. Reaction:H2SO4 (aq) + Na2CO3 (aq) → Na2SO4 (aq) + H2O (l) + CO2(g) |
|
| 12. |
what is the common name of sodium carbonate |
|
Answer» washing soda is the correct answer Washing soda is the correct answer of the given question is common name of sodium carbonate is washing soda washing soda is the common name of sodium carbonate washing soda is the common name of sodium carbonate washing soda is the right answer Sodium carbonate,Na2CO3, (also known aswashing soda,soda ashandsoda crystals) is theinorganic compoundwith the formula Na2CO3and its various hydrates. All forms are white, water-soluble salts. All forms have a strongly alkaline taste and give moderately alkaline solutions in water. Historically it was extracted from the ashes of plants growing in sodium-rich soils. Because the ashes of these sodium-rich plants were noticeably different from ashes of wood (once used to producepotash), sodium carbonate became known as "soda ash".[12]It is produced in large quantities fromsodium chlorideandlimestoneby theSolvay process. Sodium carbonateNamesIUPAC name Sodium carbonate Other names Soda ash, washing soda, soda crystals Identifiers CAS Number 497-19-8(anhydrous) 5968-11-6(monohydrate) 6132-02-1(decahydrate) 3D model (JSmol) Interactive image ChEBI CHEBI:29377 ChEMBL ChEMBL186314 ChemSpider 9916 ECHA InfoCard100.007.127EC Number207-838-8E numberE500(i)(acidity regulators, ...) PubChemCID 10340 RTECS numberVZ4050000UNII 45P3261C7T CompTox Dashboard(EPA) DTXSID1029621 InChI InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 Key:CDBYLPFSWZWCQE-UHFFFAOYSA-L InChI=1/NaHCO3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 Key:CDBYLPFSWZWCQE-NUQVWONBAP SMILES [Na+].[Na+].[O-]C([O-])=O Properties Chemical formula Na2CO3Molar mass105.9888g/mol (anhydrous)286.1416g/mol (decahydrate)AppearanceWhite solid,hygroscopicOdorOdorlessDensity 2.54g/cm3(25°C, anhydrous) 1.92g/cm3(856°C) 2.25g/cm3(monohydrate)[1] 1.51g/cm3(heptahydrate) 1.46g/cm3(decahydrate)[2] Melting point851°C (1,564°F; 1,124K) (Anhydrous)100°C (212°F; 373K)decomposes (monohydrate)33.5°C (92.3°F; 306.6K)decomposes (heptahydrate)34°C (93°F; 307K)(decahydrate)[2][6] Solubility in water Anhydrous, g/100 mL: 7 (0°C) 16.4 (15°C) 34.07 (27.8°C) 48.69 (34.8°C) 48.1 (41.9°C) 45.62 (60°C) 43.6 (100°C)[3] SolubilitySoluble in aq.alkalis,[3]glycerolSlightly soluble in aq.alcoholInsoluble inCS2,acetone, alkylacetates, alcohol,benzonitrile, liquidammonia[4]Solubilityinglycerine98.3g/100 g (155°C)[4]Solubilityinethanediol3.46g/100 g (20°C)[5]Solubilityindimethylformamide0.5g/kg[5]Basicity(pKb)3.67 Magnetic susceptibility(χ) −4.1·10−5cm3/mol[2] Refractive index(nD) 1.485 (anhydrous)1.420 (monohydrate)[6]1.405 (decahydrate)Viscosity3.4 cP (887°C)[5]Structure Crystal structure Monoclinic(γ-form, β-form, δ-form, anhydrous)[7]Orthorhombic(monohydrate, heptahydrate)[1][8] Space group C2/m, No. 12 (γ-form, anhydrous, 170K)C2/m, No. 12 (β-form, anhydrous, 628K)P21/n, No. 14 (δ-form, anhydrous, 110K)[7]Pca21, No. 29 (monohydrate)[1]Pbca, No. 61 (heptahydrate)[8] Point group 2/m (γ-form, β-form, δ-form, anhydrous)[7]mm2 (monohydrate)[1]2/m 2/m 2/m (heptahydrate)[8] Lattice constant a=8.920(7)Å,b=5.245(5)Å,c=6.050(5)Å (γ-form, anhydrous, 295K)[7] α=90°, β=101.35(8)°, γ=90° Coordination geometry Octahedral (Na+, anhydrous)Thermochemistry Heat capacity(C) 112.3J/mol·K[2] Std molarentropy(So298) 135J/mol·K[2] Std enthalpy offormation(ΔfH⦵298) −1130.7kJ/mol[2][5] Gibbs free energy(ΔfG˚) −1044.4kJ/mol[2]HazardsMainhazardsIrritantSafety data sheetMSDSGHS pictograms[9]GHS signal wordWarning GHS hazard statements H319[9] GHS precautionary statements P305+351+338[9]NFPA 704 [11]  0 1 0 Lethal dose or concentration (LD, LC): LD50(median dose) 4090 mg/kg (rat, oral)[10]Related compounds Otheranions Sodium bicarbonate Othercations Lithium carbonatePotassium carbonateRubidium carbonateCaesium carbonate Related compounds Sodium sesquicarbonateSodium percarbonate Except where otherwise noted, data are given for materials in theirstandard state(at 25°C [77°F], 100kPa). |
|
| 13. |
eit alttd lonic Compound2. Write down the molecular formula of the following1) Sodium carbonate(ii) Zinc sulphideAluminium oxidev) Ferric sulphate(v) Barium chloride(vi) Magnesium carbonate |
| Answer» | |
| 14. |
57. Powdered iron is magnetic, but powdered sulfur isnor. What occurs when they form a mixture inabeaker at room temperature?A) The iron retains its magnetic propertiesB) The iron loses its metallic properties.C) The sulfur gains magnetic properties.D) The sulfur gains metallic properties. |
|
Answer» They form a mixture and a magnet can separate the iron from the sulfur. Heat the mixture up, however, and a chemical reaction occurs: Fe(s)+S(s)→FeS(s) The iron is oxidized, and the sulfur is reduced, andFeSresults.FeSis distinct chemically element, and results in a gray black solid that is not longer magnetic. hey. so would the anwser be ( b) in that case or no? Yes, the answer would be b Thank you for your help |
|
| 15. |
Calculate the number of molecules present in 53g of Sodium Carbonate. Som |
|
Answer» Avagadro's constant states that 1 mole of any substance has 6.022× 10²³ molecules/atoms. Find the number of moles of 53 g of Na2CO3:molar mass Na2CO3 = 23 × 2 + 12 + 16× 3 = (46+12+48) = 106 moles = mass/molar mass = 53/106 = 0.5 moles 1 mole = 6.022×10²³ atoms Then 0.5 moles = 6.022× 10²³× 0.5 atoms = 3.011× 10²³ atoms of Na2CO3 |
|
| 16. |
Element M forms, a chloride with the formula MCl whichis a solid with high melting point. What type of bond isin MCl2. Write the formula of the compound when Mcombines with sulphur, oxygen and nitrogen. |
|
Answer» The valency of chlorine is 1. Therefore, if the element M is forming a chloride of the formula MCl2, it means that the valency of M is 2. Also, since the compound MCl2has high melting point, it means that it is an ionic compound. Hence M is a metal and belongs to group 2 of the periodic table. |
|
| 17. |
Calculate the number of moles and molecules presentin 0.032 mg of methane (C 12, H-1) |
|
Answer» The molar mass of methane (CH4) is 12+4*1 = 16gm so, in one moles the mass is 16gm = 16000mg now we are given 0.032 mg so, no. of moles will be 0.032/16000 = 2× 10^-6 moles. |
|
| 18. |
[FI Give a reason for each of the following:G) Ionic compounds have a high melting point. |
|
Answer» In an ionic compound there is large electrostatic force of attraction between opposite charged ions. To overcome these forces a considerable amount of energy is needed therefore ionic compounds have high melting points |
|
| 19. |
Tungsten (a transition element) being a metal exhibits the following properties-(1) It is sonorous(I) It possesses high tensile strength(II) -It possesses high melting point(IV) It has high density |
|
Answer» 3)It posses high melting pointTungstenpossesses the highest melting temperature amongmetals. These properties maketungstenvaluable for many applications, including electrical, manufacturing, construction and chemical. |
|
| 20. |
what is meant by compatibility factor of gas. what is its value for an ideal gas? |
|
Answer» The compressibility factor (Z), also known as the compression factor or the gas deviation factor, is a correction factor which describes the deviation of a real gas from ideal gas behavior.For ideal gas it is 1 |
|
| 21. |
Q.5 Define Ideal gas equation. |
|
Answer» Ideal gas equation is PV=nRTwhere p=pressure, v= volume, n=no. Of moles, R= gas constant, T=temperature Ideal gas equation is also known as general gas law. The law of Ideal gas states that the volume of a specified amount of gas is inversely proportional to pressure and directly proportional to volume and temperature. |
|
| 22. |
The specific heat of a gas is found to be0.075 calories at constant volume and its formulawt is 40. The atomicity of the gas would be(1) One(2) Two(3) Three(4) Four |
|
Answer» Specificheat of gas at constant volume=0.075calg^-1C° i.e,0.075cal is absorbed by 1g of it for 1° rise in temperature at constant volume. So,total heat absorbed by 1g mole of the gas is 40(0.075)=3cal. Since,Cp-Cv=R or Cp=5 Cp/Cv=5/3 & hence the gas is monatomic. |
|
| 23. |
A gas such as carbon monoxide would bemost likely to obey the ideal gas law at[CBSE AIPMT 2015)(a) high temperatures and low pressures(b) low temperatures and high pressures(c) high temperatures and high pressures(d) low temperatures and low pressures |
|
Answer» thanks |
|
| 24. |
3. Calculate number of moles present in following:(a)10.0g of calcium carbonate |
|
Answer» Formula:No of moles=weight of calcium carbonate/molecular weight =10/(40+12+ (16×3))since Ca=50; C=12; O=16=10/100=0.1 moles no of moles= mass in gram/ gram molecular massmass in gram= 10ggram molecular mass of caco3 = 40+12+3*16= 100so no of moles= 10/100= 0.1 moles. 1mole of caco3 = GMM of caco3 1mole of caco3 =100g 100g of caco3 =1mole of caco3 10g of caco3 = 1×10÷100 =0.1mole |
|
| 25. |
Class XChemistrySECTION IA.Q1.Choose the most appropriate answer[10x1-10](i) Which of the following is a common characteristics of a covalent compound?a) High melting pointc) Conducts electricity d) Always soluble in waterb consists of moleculesThe gas law, which relates the volume of a gas to moles of the gas is:a)Avogadro's Law b) Gay-Lussac's Lawb) Boyle's Lawd) Charles Law |
|
Answer» 1. option B is the answer. 2. option A is the answer. |
|
| 26. |
26. The temperature at which a real gas obeys idealgas law for an appreciable range of pressure isknown as(1) Critical temperature(2) Normal boiling temperature(3) Boyle's temperature(4) Standard boiling temperature |
|
Answer» For an ideal gas, Z = 1 at any temperature or pressure. Boyle point depends on the nature of the real gas. Above the Boyle point Z is greater than 1. At low pressures and high temperatures muchabove the critical point of the substance, the real gases can be taken to behave like ideal gases. Gases like O₂, N₂,H₂, He, mono-atomic gases and inert gases behave NEARLY ideal at standard temperature (0⁰C) and pressure (1 standardatmosphere). Ideal gas law does not take into account the molecular size, andinter-molecular attraction or repulsion forces. It assumes that those factors are zero. In mono-atomic gases this assumption is valid over a wide range of pressures and temperatures. But in otherreal gases, inter-molecular forces are weak at high temperatures and low pressures. The reason is high kinetic energy overcomes small inter-molecular forces as the molecules are separated by large distances. The moleculesoccupyvery little space compared to the totalvolume of the gas. define temperature . |
|
| 27. |
1.0 g of pure calcium carbonate was found to react with50 ml of dilute HCl for completion of the reaction.The strength of the HCl solution is(1) 4M (2) 2M (3) 0.4M (4) 0.2M |
|
Answer» M.eq. of HCl = M.eq. of CaCO3 N×50=150×1000 ; N=1×100050×50=0.4N M.eg. meaning sorry m.eq means |
|
| 28. |
J. Write the statement for :(a) Boyle's law (b) Charles' lawK. Differentiate between Real gas and Idealgas.4. Answer the following questionsA. State and write mathematical expressionfor Dalton's law of partial pressure andexplain it with suitable example.B. Derive an Ideal gas equation. Mentionterms involved in it. Also write how itutilised to obtain combined gas law.the |
|
Answer» select the question which you want as answer k.Ideal gas: Ideal gas is defined as a gas that obeys gas laws at all condition of pressure and temperature. Ideal gases have velocity and mass. They do not have volume. When compared to the total volume of the gas the volume occupied by the gas is negligible. It does not condense and does not have triple point. Real gas: Real gas is defined as a gas that does not obey gas laws at all standard pressure and temperature conditions. When the gas becomes massive and voluminous it deviates from its ideal behaviour. Real gases have velocity, volume and mass. When they are cooled to their boiling point, they liquefy. When compared to the total volume of the gas the volume occupied by the gas is not negligible. To make you understand howideal gas and real gasare different from each other, here are the some of the majordifferences between ideal gas and real gas: |
|
| 29. |
30.The ion that is isoelectronic with CO is(1) CN (2) Og(3) N;NH+(4) NI |
|
Answer» 1) CN- is the correct answer cn is right answer dud firms 1 CN is right answer (1)cn right answer________ (1) is the answer CN- cn- is the correct answer |
|
| 30. |
A system absorbs 6 kJ of heat and does 1-5 kJ of work on itssurroundings. The change in internal energy is(a) -7.5 kJ(b) -4.5 kJ() +4-5 kJ(d) +7-5 kJ |
|
Answer» Q=U + W6=U +1.5U=6-1.5U=4.5 |
|
| 31. |
\left. \begin{array} { l l } { \text { vards completion } } \\ { K = 10 ^ { 3 } } & { ( 2 ) K = 10 ^ { - 2 } } \\ { K = 10 } & { ( 4 ) K = 1 } \end{array} \right. |
| Answer» | |
| 32. |
Velocity - time graph for the motion of an object in a straightthe time axis.pathisastraightlineparalleltIdentify the nature of motion of the body.Find the acceleration of the body.(a)(b) |
|
Answer» The motion is uniform in nature acceleration is zero since the velocity is not changing for the distance time graph it is straight line passing through the origin. |
|
| 33. |
19 (a) Derive ideal gas equation using gas laws.(b) What is the significance of compressibility factor? |
|
Answer» a) b)Compressibility factor is significant because it determines how far a gas is from it's ideal state, based on various factors.The compressibility factor is determined by the pressure, volume, temperature and number of moles in the gas. A gas in its ideal state has a compressibility factor of exactly 1 unit. Real gases often deviate from an ideal compressibility factor due to variations in temperature and pressure. As pressure increases, the compressibility factor of a gas also increases. As temperature increases the compressibility factor of a gas decreases. Factors that have the highest net effect on the compressibility factor of a gas are high pressure states and low temperature |
|
| 34. |
4. A gas present in a cylinder fitedith a frictionless piston expands against a constant pressure of1 atm from a volume of 2 litre to a volume of 6 litre. In doing so, it absorbs 800 J heat fromsurroundings. Determine increase in internal energy of process. |
|
Answer» wrong answer |
|
| 35. |
NH COONH ()2NH()+CO(R)If equilibrium pressure is 3 atm for the aboreaction, K will be |
| Answer» | |
| 36. |
(a) NaF22. The order of increasing lattice energy of the following salt is(a) NaCl < CaO < NaBr <.Bao(c) NaCl < NaBr< BaO<Cao(b) NaBr < NaCl < Ba。< Cao(d) NaBr < NaCl CaO < Ba0uill rive strongest ionic bond ?in(d) Mg2 and |
|
Answer» Option B is correct lattice energy depends on Mass of constituents particles |
|
| 37. |
One litre of a gas at 300 atm and 473 K is compressed to acompressibility factors found to be 1.072 and 1.375 respectively at the initial and final statthe final volume ?(A) 0.27 Lpressure of 600 atm and 273K. Thees. What is(B) 0.47L(C) 0.17 L(D) 0.37 L |
|
Answer» option d |
|
| 38. |
(a)Define non-metals. Give five examples of non-metals2) Name a non-metal which conducts electricityc) Name a non-metal having lustre (shining surface)2) Name a non-metal which is extremely hard. |
| Answer» | |
| 39. |
Which combination will give strongest ionic bond?(a) Na and Cl(c) Nat and O2(b) Mg2 and Cl-(d) Mg+ and O2- |
|
Answer» 4 A rightanswerquestions Sharing 2 elctrons with one atom will be strongest Among all option d |
|
| 40. |
OKhat do you mean by metallic character of an element? How does it vary aswe go down a group? Give reason for this variation. |
|
Answer» Metallic character of an element means the capacity of elements to lose electron of the outer most shell to attain stability. It vary as we go down in a group as the metallic character or electropositive character increase.Reason: As we move down a group in the periodic table, atomic size gradually increases. As a result, the force of attraction between the nucleus and the valence electrons decreases. Therefore, the tendency of the element to lose electrons to form positive ions increase and hence the metallic or the electropositive character increase as we move down the group. Increase in atomic size predominates the increase in nuclear charge. Like if you find it useful |
|
| 41. |
08 What is the total number of sigma and pi bonds in the following molecules(a) C,H, (b) C,H |
| Answer» | |
| 42. |
20gmaredissolvedinenoughwatertoWhat is the concentration of sugar (C2H20,) in mol L-l if itsmake a final volume up to 2L? |
| Answer» | |
| 43. |
Henry's law constant for CO2 dissolved inwater is 1.67x 108 Pa at 298 K. Calculatethe quantity of CO2 in 1 L of soda waterwhen packed under 2.5 atm CO2 pressureat 298 K. |
| Answer» | |
| 44. |
01.1 mole of CH, contains1) 6.02 x 10 atoms of H2) 4 g atom of Hydrogen3) 1.81 x 102 molecules of CH,4) 3.0 g of carbon |
|
Answer» One mole of methane (CH4) contains a total of 3 × 1024 atoms. One mole of methane (CH4) contains a total of 3 × 1024 atoms. 1 mole of methane (CH4) contains:- 1 mole of carbon- 2 mole of Hydrogen (H2)- 12 g of carbon (because 1 mole of C = rmm = 12g)- 4 g of hydrogen (because 2 moles of H2 = 2 x rmm = 4 g)- 16 g of methane (because 1 mole of CH4 = RMM of CH4 in g = 16g) |
|
| 45. |
01. Molten sodium chloride conducts electricity due to thepresence of(A) Free electrons(B) Free ions(C) Free molecules(D) Atoms of sodium and chlorine |
|
Answer» Why is sodium a good conductor of electricity but sodium chloride is not? Answer Follow Request More Ad by State Bank of India Find the information you need from the State Bank of India. Get the answers to your queries right here from SBI’s official account. Follow Us 2 ANSWERS  Jeffrey Whittaker, former High school and community college teacher (2010-2016) Answered May 20 Sodium is a metal. Metals are atoms in a sea of electrons. These electrons can move and conduct electricity. The atoms in the metal are actually cations or positivity charged. The sea of electrons is a large molecular orbital where the negative charges balance the positive charge of the atoms but allow electrons to flow between atoms or conduct electricity. Sodium chloride is a salt. In the solid state the valance electron of sodium has moved to the chloride atom where It remains in the atomic orbitals of chlorine. Thus the electrons can’t flow. The crystal is made up of rigid electrostatic bonds. However if the solid is melted, the cations and anions can move and carry a charge. So a molten salt will conduct electricity. |
|
| 46. |
what is ionic bond |
|
Answer» Ans :- Ionic bonding is the complete transfer of valence electron(s) between atoms. It is a type of chemical bond that generates two oppositely charged ions. In ionic bonds, the metal loses electrons to become a positively charged cation, whereas the nonmetal accepts those electrons to become a negatively charged anion. PLEASE LIKE THE ANSWER |
|
| 47. |
What is an ionic bond? |
|
Answer» A chemicalbondformed between twoionswith opposite charges.Ionic bondsform when one atom gives up one or more electrons to another atom. Thesebondscan form between a pair of atoms or between molecules and are the type ofbondfound in salts. |
|
| 48. |
8. How does metallic character change when we movei. Down in a groupii. Across a period? |
|
Answer» down a group metallic character increases and across a period metallic character decreases |
|
| 49. |
How does metallic character changes in moving from top tobottom in a group in the modern periodictable? 2 |
|
Answer» Metallic characterdecreases as you moveacrossaperiod inthe periodic table from left to right. This occurs as atoms more readily accept electrons to fill a valence shell than lose them to remove the unfilled shell.Metallic characterincreases as you move down an element groupinthe periodic table. |
|
| 50. |
9.8 Which of the following molecules havepractically the same mass?a) H,O and D,Oc) D,0 and HTOb) IH,O and HTOd) DTO and HDO |
|
Answer» option (c) is correct. Hint:H , D nd T are isotopes of hydrogen with mass- 1u ,2u ,3u respectively. |
|