Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

ClASSMALeDatecalculat e the valume of oxggen required farcomplete combustion f a2 male of methane3

Answer»

is represented by CH4 and a=have moleccular mass of 22.4when methane is burned following reaction takes placeCH4 + 2O2:::::> CO2 + 2H20 'In this reaction one mole of methane needs two moles of oxygen to be completely burnedfor 0.25 moles we can calculate as;=0.25*22.4*2=11.2 Litershope this answer helped you

2.

3. Calculate the volume of oxygen required forcomplete combustion of 0.25 mole of methane atSTP (Ans. 11.2 dm3)

Answer»
3.

inXI0number of molestheocalerelate11 gm of coz7) 11.2 e of coz3:01131023 malecules of soi) 25gm of Na32 gm of So2

Answer»

Given mass w= 11g

Molar mass of CO2= 12+2×16=44Now no of mole =w/m= 11/44

=1/4

= 0.25 mole Ans

w =11 g so molar of co2 12+2×6=44then 1 g Mai 11/44=0.25

4.

1. Name three states of matter which state oftmatter is rig.c.

Answer»

Three states of matter are 1) solid 2) liquid 3) gaseous Q)The rigid state of matter is = solid

1.Solid2.Liquid3.Gas.The three states of matter

solid , liquid ,gas solid is the rigid one

Three states of matter are - Solid, Liquid and Gas The rigid state of matter is Solid

three state of matter are solid liquid and gas

solid ,liquid,gasious solid state is ragid

1.solid2.liquid3. gassolid is the rigid state

1.solid2.liquid3. gassolid is the rigid state

1. solid2. liquid3. gasesthis is right answer

The three states of matter are:1. Solid2. Liquid3. GasSolid is the rigid state of matter because it has high intermolecular force of attraction.

1. Matter has occupy space have mass are called matter2. matter has tinny particals

5.

What were the criteria used by MendelĂŠev in creating his Periodic Table?

Answer»
6.

10) What are the factors which affect vapourpressure?

Answer»

1. Purity of liquid.

2. Temprature

3. Nature of liquid

4. Effect of adding solute

5. Concentration

7.

write the factors affect evaporation

Answer»

The rate of evaporation is affected by the following factors: Temperature: The rate of evaporation increases with an increase in temperature. Surface area: The rate of evaporation increases with an increase in surface area. Humidity: The amount of water vapour present in the air is called humidity. The rate of evaporation decreases with an increase in humidity. Wind speed: evaporation increases with an increase in wind speed.

8.

Stability of atom cannot be explained by Rutherford model of an atom? State reason for that.

Answer»

It is because he thought that electrons while revolving in a circular path release energy and the revolving electrons will lose energy and finally fall into the nucleus. Due to this, he was unable to prove atom stable

9.

The soil in a field is highly acidic. List any two materials which can be added to this sail to reduceacidity. Give the reason for your choice.

Answer»
10.

.wiueithobiegashaslèssthan8electronsinthevalenceshe4. State one use of radioactive isotopes in medicine.

Answer»

Nuclearmedicine usesradiation to provide diagnostic information about the functioning of a person's specific organs, or to treat them. Diagnostic procedures usingradioisotopesare now routine.

11.

7.What is the pressure on a swimmer 10 m below the surface of a lake?

Answer»
12.

9. State one observation which shows that atom is notindivisible.

Answer»
13.

A new electron enters the orbital when:(a) (n + I) is minimum(b) (n +I) is maximum(c) (n+ m) is minimum(d) (n+ m) is maximum

Answer»

(n+l) rule is given by Aufbau. According to Aufbau’s principle, in the ground state of the atoms, the orbitals are filled in the order of their increasing energies. In other words, electrons first occupy the lowest energy orbital available to them and enter into higher energy orbital only when the lower energy orbitals are filled.

The order in which the energies of orbitals increase and hence the order in which the orbitals are filled is as follows:

1s, 2s, 2p, 3s, 3p, 4s, 3d, 4p, 5s, 4d, 5p, 6s, 4f, 5d, 6p, 7s, 5f, 6d, 7p….Energy of the orbital is directly proportional to (n+l) value. Orbital having low value of (n+l) will have less value of energy. So the electrons are filled in the increasing order of (n+l) or we can say that new electron enters in the orbital having (n+l) minimum.

14.

3.What is slaking of lime?

Answer»

Calcium oxide reacts vigorously with water to produceslaked lime. This reaction is called 'slaking of lime'. This reaction is a highly exothermic reaction. The hissing sound during this process is due to the heat produced.

hit like if you find it useful

15.

\frac { 3 x + 7 } { x ^ { 2 } - 3 x + 2 } = \frac { A } { x - 2 } - \frac { 410 } { x - 1 } ,

Answer»
16.

Calcualane the velocity of ancund the nuckeus.elsatron plascod in fl orbi ofH lom, Also calulate the no. of revolutine

Answer»
17.

t. Disproportionation reactions

Answer»

Ans :- Disproportionationis a chemicalreaction, typically a redoxreaction, where a molecule is transformed into two or more dissimilar products. In a redoxreaction, the species is simultaneously oxidized and reduced to form at least two different products.Disproportionation reactions follow the form: 2A → A' + A"

18.

3. Write the disproportionation reaction of H3PO3

Answer»

On heating, orthophosphorus acid (H3PO3) disproportionates to give orthophosphoric acid (H3PO4) and phosphine (PH3). The oxidationstates of P in various species involved in thereaction are mentioned below.

4H3PO3 = 3H3PO4 + PH3

19.

e the disproportionation reaction of H3PO

Answer»
20.

Which of the following is not a disproportionation reaction?(a) H202>H20+O2Pb( NOs)Pbo+NO2 +02(c) Mir + H20Mn2+ M2 +

Answer»

In most redoxreactionssomething is oxidized and something else is being reduced. But in some redoxreactions, one substance can be both oxidized and reduced in the samereaction. And those are calleddisproportionation reaction.

Option (b) is the right answer .

Reason:

21.

«— ONCZ + O—Os+HNE.

Answer»

Reaction 4NH3 + 5O2 -------- 4NO + 6H2O are the example of displacement reaction and redox reaction.

Oxidation-reduction (redox) reaction is type of chemical reaction involves with easily transferring of two species.

Oxidation-reduction reaction is chemical reaction in which the oxidation number of molecule and atom.

Displacement reactions are chemical reaction with reactive element displaces.

22.

will you demonstrate that water vapour is present in air ?How

Answer»
23.

55 How will you demonstrate that water vapour is present in air ?

Answer»
24.

5. (a) State one similarity and one difference between evaporation and boiling.(b) List four factors which affect the rate of evaporation.(c) Describe an activity to show that water vapour is present in air.

Answer»

both are based on heat evaporation is a cooling process and boiling is a heating process

Both are based on heatevaporation is a cooling process and boiling is a heating process

25.

How can you convert?(a)CH, CO CH,CH, CH, CH,сосні

Answer»

CH3COCH3can beconverted to CH3CH2CH3by the action ofZn- Hg/HCl.

26.

CH _ { 3 } - CO - CH _ { 2 ^ { - } CH _ { 3 } }

Answer»

CH3-CO-CH2-CH3

Is butan-2-one

27.

2021 The value of AG for formation of Cr827 kJmol-1. Is the reduction of Cr2 O3 posslble with Al?2 o, is 540 kJmol-land that of Al, O, is

Answer»
28.

15. Give reason for the following:a) We get the smell of lighted incense stick sitting at a distance.b) We are able to cut the stream of water with our fingers.c) When we make lemonade, each sip has the sarne taste.

Answer»

a) It is because of the gas Particles are scattered very quickly and very fast so that the smell is experiencing at a very long distanceGas has more volume as that of solid and liquid

29.

20. Write the chemical name of the following compounds :(i) Ca3(PO4)2 (ii) K2CO3(iii) KMnO4(iv) Mn3(BO3)2(U) Mg(HCO3)2 (vi) Naz[Fe(CN)6](vii) Ba(ClO3)2 (viii) Ag2SO3(ix) (CH3COO)2 Pb (*) Na2SiO3of the following compounds :

Answer»

The given complex isK[Cr(H2O)2(C2O4)2]K[Cr(H2O)2(C2O4)2]. The possible isomers of the given complex are cis and trans form as shown below.

Thus, it exhibits geometrical isomerism.

The mirror image of cis form of this complex is non-superimposable as shown below.

Thus, the cis form exhibits optical isomerism.

iiii

The given complex is[Co(en)3]Cl3[Co(en)3]Cl3. The mirror image of the given complex is non-super imposable as shown below.

Thus, the isomerism it exhibit is optical isomerism.

iiiiii

The given complex is[Co(NH3)5(NO2)](NO3)3[Co(NH3)5(NO2)](NO3)3. The mirror image of the given complex is non-super imposable as shown below.

It can also show linkage isomerism as shown below.

It can also show ionization isomerism as shown below.

iviv

The given complex is[Pt(NH3)(H2O)Cl2][Pt(NH3)(H2O)Cl2]. The possible isomers of the given complex are cis and trans form as shown below.

Thus, it exhibits geometrical isomerism.

30.

Name the following compounds:CH3-CH2-OH

Answer»

CH3CH2OH=ethanol or ethyl alcohol

31.

Writethe IUPAC name of the following compounds.CH3CH(OH)CH2COOH

Answer»

3-Hydroxy Butanoic acid

32.

Write the names (common & IUPACas applicable) of the followingcompounds

Answer»

IUPAC : Tri-iodomethane

Common name : Iodoform

correct answer

33.

Who is the chief min's terIndia

Answer»

There are total 29 states and 7 Union Territories in India, and for each state, there is a Chief Minister.

We do not have a chief minister for the whole nation.

34.

what is the aqua regina ?

Answer»

Aqua regiais a mixture of hydrochloric acid (HCl) and nitric acid (HNO3) at a ratio of either 3:1 or 4:1. It is a reddish-orange or yellowish-orange fuming liquid. The term is a Latin phrase, meaning "king's water". The name reflects the ability ofaqua regiato dissolve the noble metals gold, platinum, and palladium

Formula:HNO₃+3HCl

Boiling point:108°C

Melting point:-42°C

Density:1.21g/cm³

NFPA 704 (fire diamond):0 3 0OX

Solubility in water:Miscible

Aqua regia, mixture of concentrated nitric and hydrochloric acids, usually one part of the former to three parts of the latter by volume. This mixture was given its name (literally, “royal water”) by the alchemists because of its ability to dissolve gold and other so-called noble metals.

it has power to dissolve metals.

35.

a. Describe how you would prepare 100 g of asolution that is 0.5% phenolphthalein by mass.

Answer»

Since the solute (phenolphthalein) is a solid, the solution is percent by mass. Mass percent means the number of grams of solute per 100 g of solution.

mass percent = (mass of solute/mass of solution) × 100% mass of solute = mass percent × mass of solution/100% = 0.5% x 100 g/100% = 0.5 g

Since the total mass of the solution equals 100 g, the remaining 99.5 g of the solution is water. To prepare the solution, dissolve 0.5 g phenolphthalein in 99.5 g distilled or deionized water.

36.

6.025 x 1020 molecules of acetic acid are present in500 ml of its solution. The concentration of solution is(1) 0.002 M(3) 0.012 M(2) 10.2 NM(4) 0.001 M

Answer»

No of moles=(6.02×10^20÷(6.02×10^23))=10^-3now 500 ml contains 10^-3 mol.....so 1000ml contains=(10^-3÷500)×1000 mol=0.002molso the molarity or the concentration of the solution is 0.002 M.......☺️

37.

b. Describe how you would prepare 100 mL of asolution that is 22% acetic acid by volume.

Answer»

Volume percent means the number of milliliters of solute per 100 mL of solution. Dilute 22 mL acetic acid with distilled or deionized water to make 100 mL of solution

38.

Scratch my head, see me turnfrom black to red. What am I?A puppyA match stickLottery ticketA volcano

Answer»

option 2 match stick

39.

Under what1.2 What makes a glass ditferent from a solid such as quartz? Uconditions could quartz be converted into glass?

Answer»
40.

·H, calculate the strength of 10 volume hydrogen peroxide solution.

Answer»
41.

when ozone react with hydrogen peroxide then hydrogen peroxide in reaction act as ???

Answer»

no is it oxidizing reducing or both

it acts as a proton donor.

So I guess that's reducing agent yeah? loss of electrons?

when 10g of ag reacts with 5g of s then what amount of ag2s is produced

add that as another question girl

means i am not getting didi

post it as another question

ok didi

42.

6. HOTS why is hydrogen peroxide kept in coloured bottles?9

Answer»

Hydrogen peroxideis a highly reactive metal that can react with light or heat to producewater. To prevent it's reaction with light and heat to makewaterit isstoredin coloured bottles so that light does'nt pass through it.

43.

formula for hydrogen peroxide

Answer»

Formula for hydrogen peroxide is -----H₂O₂

44.

A 0.750 L aqueous solution contains 90.0 g of ethanol, C2H50H. Calculatethe molar concentration of the solution in molL-1.

Answer»

1.The question asks for concentration,which means finding molarity, or:moles solutelitre solution2.To convert mass of ethanol to moles, we need to find the molar mass of C2H5OH using the periodic table. Molar mass is 46.1 g·mol-13.Molarity also requires volume; the question tells us we have 0.750 L. Put this information together to solve the problem, arranging the information to end up with the desired unit:

molL=90.0 g×1 mol46.1 g×10.750 L=2.60molLOur final answer: [C2H5OH ] = 2.60M

45.

A 0.750 L aqueous solution contains 90.0 g of ethanol, C2H5OH. Calculate the molar concentration of thesolution in mol L

Answer»

1.The question asks for concentration,which means finding molarity, or:moles solutelitre solution2.To convert mass of ethanol to moles, we need to find the molar mass of C2H5OH using the periodic table. Molar mass is 46.1 g·mol-13.Molarity also requires volume; the question tells us we have 0.750 L. Put this information together to solve the problem, arranging the information to end up with the desired unit:

molL=90.0 g×1 mol46.1 g×10.750 L=2.60 molLOur final answer: [C2H5OH ] = 2.60M

46.

Calculate the osmotic pressure of a solution obtained by mixing 100 cm of 3.4% aqueous solution ofurea (NH,CONH,) and 100 cm' of 1.6% aqueous solution of sugar C12H22011 at 20°C.

Answer»

Urea and cane sugar are very dissolvable in water. But we assume these molecules cannot pass through a semipermeable membrane. Only water can pass through.

π = Osmotic pressure = C_solute * R T

R = 8.314 J/°K C_solutes = Molar concentration of solutes

T = absolute temperature = 293°K given

We assume that the volume of Urea and Cane sugar in the solutions are negligible as the concentrations are low.

Molar concentration: in 200 ml we have

Solutes = 3.4 / 60 moles of Urea + 1.6 /342 moles of cane sugar = 0.061 moles = 0.061 * 1000ml /200 ml = 0.306 M

Since Cane sugar and Urea are not Ionic, we do not multiply the concentration by any factor.

Osmotic pressure =π = 0.306 * 8.314 * 293 = 745 Pa

47.

pH of a solution produced when an aqueous solution ofpH 6 is mixed with an equal volumeof an aqueous solution of pH 3 is about:2) 4.31) 3.33) 44) 4.5

Answer»

pH = 6

-log [H+] = 6

[H+]1=10-6

pH = 3

-log [H+] =3

[H+]2=10-3

[H+]mix=[H+]1V1+[H+]2V2/V1+V2

V1=V2=V

[H+]mix= (10-6+10-3)V/2V

= (10-6+10-3)/2

10-6being small neglected

= 0.5 x10-3

[H+]mix= 5 x 10-4

pHmix= – log[H+]mix

= 4 – log5

= 4 – 0.7 pHmix= 3.3

48.

What will be the resultant pH when 200 ml oan aqueous solution of HCl having pH=2 imixed with 300 ml of an aqueous solution oNaOH having pH-12:?

Answer»
49.

ALL2. Water is added to the solution such that the molefraction of water in the solution becomes 0.9. Theboiling point of the solution is(1) 354.7 K(3) 376.2 K(2) 375.5 K(4) 380.4 K

Answer»

The boiling point of the solution is 375.5K

50.

(94) The number of moles of Kl required toproduce 0.4 mole K, Hg 1, is11 2) 3) 16 4) 16

Answer»

The required equation is HgCl2+4KI>>2KCl+K2HgI4. According tostoichiometric calculations:- 4 moles of KI gives 1 mole of K₂HgI₄. THEREFORE 0.4moles of K₂HgI₄ requires----- ? 0.4 moles x 4 moles/1 mole=1.6 moles therefore1.6 moles of KI is required to produce 0.4 moles of K₂HgI₄.