Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
How are the areas of study - evolution and classification interlinked |
| Answer» | |
| 2. |
Define vegitive propagation |
| Answer» So easy ?? | |
| 3. |
How do you think the tendency to lose electrons will change in a group? |
| Answer» So easy ?? | |
| 4. |
Name two transition elements |
| Answer» Fe , ca | |
| 5. |
Some traits cannot pass on to next generation. Explain |
| Answer» | |
| 6. |
Nuclear power plant |
| Answer» | |
| 7. |
Which part of plant is female and male?? |
|
Answer» And carpel? Pistil is female part Nd stamen is male part |
|
| 8. |
Why Stars twinkling |
| Answer» | |
| 9. |
Characteristics of periods in periodic table |
| Answer» | |
| 10. |
Magnetic. Effects |
| Answer» | |
| 11. |
What would you observe when zinc is added to solution of iron ii sulphate |
| Answer» Zinc displace iron from its sulphate and zinc sulphate is formed.Zn + FeSO4 = ZnSO4 + Fe | |
| 12. |
Name two *** hormones |
| Answer» Testosterone(Male) Oestrogen(Female) | |
| 13. |
What is quantom theory |
|
Answer» It is a fundamental theory in physics which describes nature at a smallest scales of energy levels of atoms nd subatomic particles..?? The modern theory of light which combines both wave and particle nature of light |
|
| 14. |
What type of cell division found takes ace in asexual reproductiin |
| Answer» | |
| 15. |
A proper defination of saponification reaction |
|
Answer» Esters in the presence of acid or base react to give back alcohol and carboxylic acid is called saponification.This reaction is used in soap formation. I know it but i need a breif explanation So easy ?? Answer the question then give bye So easy ?? and bye |
|
| 16. |
Why do bronze statue kept in museum turns green |
|
Answer» Bronze and brass turn green due chemical reactions between the copper in those alloys and the atmosphere. Due to formation of copper sulphonate. |
|
| 17. |
Why CNG is not used as domestic fuels in homes? |
| Answer» | |
| 18. |
How to prepare science easily |
| Answer» | |
| 19. |
Cu + hno3(conc.)= ??? |
|
Answer» Cuno3+h Conc.hno3 cant react with copper No reaction because copper is less reactive than hydrogen |
|
| 20. |
Cu + hno3 = ????? |
|
Answer» CuNo3+ H2 Cu+hno3=(CuNo3)2+2No+2H2o Haa bhai mere ko pata hai |
|
| 21. |
Cu + hno3 = ???? |
| Answer» | |
| 22. |
What is antichlor? |
| Answer» | |
| 23. |
Why red light is least scattered |
| Answer» Due to short wavelengths | |
| 24. |
C + hno3 = ???, |
| Answer» Cu(NO3)2+NO+H2O it is right abhi try kiya h | |
| 25. |
2cu + 4hno3(conc.)=cu(no3)2+2no2+2h2o |
| Answer» | |
| 26. |
Naoh + n2o5 = ???? |
| Answer» | |
| 27. |
I\'m new here frnds |
| Answer» | |
| 28. |
Naoh + n2o5 |
| Answer» | |
| 29. |
This app is very helpful naa? |
| Answer» | |
| 30. |
Hlo hIMU ji. |
| Answer» | |
| 31. |
When an electri current flows through a conductor it becomes hot. why? |
| Answer» Due to heating effect of current | |
| 32. |
R u fine |
|
Answer» Noo yes and you Who |
|
| 33. |
Hello Ishita Singh how r u |
| Answer» Mcbcdc | |
| 34. |
What\'s the meaning of F U C K plz tell me |
| Answer» Slemcbcdc | |
| 35. |
Naoh +n2o5 |
|
Answer» 2NaOH +n2o5=2NaNO3+H2O(Double Displacement Reaction) NaN2o+H2O So easy ?? |
|
| 36. |
Samrudhi.. ? |
| Answer» | |
| 37. |
Which reaction happen when Ethonal changes to Ethene |
| Answer» | |
| 38. |
What is unit of inheilritence |
|
Answer» Gene So easy ?? |
|
| 39. |
What hapen when metal are burnt in air |
| Answer» They form their oxide | |
| 40. |
Sir/mam, science ka notes CBSE exam ka liye khafi ha kya please reply...... |
| Answer» | |
| 41. |
Alia aap kha se ho? |
| Answer» Heven se chelaga ??? | |
| 42. |
Mera friend ho jo mujhe please bataye |
| Answer» | |
| 43. |
Na2so4+2hcl£=2nacl+h2so4 is it right equation or wrong ....??? If wrong than tell how |
|
Answer» Sahi hai Right No yaar |
|
| 44. |
i need ptacticals .. of science .. class 10 . cbse .. 2017 /2018. |
| Answer» | |
| 45. |
formula of ethanoate |
| Answer» So easy | |
| 46. |
RIMSHA ek baar aa jao |
| Answer» | |
| 47. |
What are the full of w t o |
|
Answer» World trade organization World orzaartion World trade organization |
|
| 48. |
What is bad |
| Answer» | |
| 49. |
RIMSHA plzzzz aa jao |
| Answer» | |
| 50. |
Vasopressin is secreted from where |
| Answer» | |