Explore topic-wise InterviewSolutions in .

Schottky defect, basically a vacancy defect, arises in ionic crystals when equal number of anions and cations are missing from their normal lattice sites, resulting in the formation of a pair of holes.

Schottky defect is generally found in strongly ionic compounds having high coordination number and made up of anions and cations of nearly same size.

On the other hand Frenkel defect arises when a cation leaves it's normal lattice position and occupies an interstitial position.

Frenkel defect is generally found in compounds having low coordination numberand made up of canions and cations of widely different sizes i.e., anion much larger than cation.

Although these conditions seem to be just opposite to each other, yet AgBr shows both the defects. It is because AgBr crystal has a coordination number of 6 which is neither high nor low. The radius ratio of AgBr is also intermediate, thus AgBr satisfies the conditions to exhibit both type of defects.

P.S.: frenkel defect is more commen in AgBr because silver ions due to their small size easily occupy interstitial sites while comparitively larger bromide ions doesn't leave their position that easiy.

A Schottky defect is a type of point defect in a crystal lattice named after Walter H. Schottky. ... In ionic crystals, the defect forms when oppositely charged ions leave their lattice sites, creating vacancies. These vacancies are formed in stoichiometric units, to maintain an overall neutral charge in the ionic solid.

A Frenkel defect or dislocation defect is a type of defect in crystalline solids where in an atom is displaced from its lattice position to an interstitial site, creating a vacancy at the original site and an interstitial defect at the new location without any changes in chemical properties.

The two main ways of changing physical states of matter include heatingandcooling.Evaporation involves theheatingof a substance till it changes into a gaseous state. Some substances under a change from solid to gas directly without first changing into liquid, a process called sublimation.

because only change of matter is take place on it so it is a physical change

it is a physical change

because only change of matter is take place on it so it is a physical change

percentage composition is 62.9%

Washing soda crystals hydrated = >Na2CO3.10H2OMolar mass = 286molar mass of water = 180

% of water = > 180/286*100= > 62.93

4.0

22 votes

Stereocenters are labeledRorS. The "right hand" and "left hand" nomenclature is used to name the enantiomers of a chiral compound. The stereocenters are labeled asRorS. Consider the first picture: a curved arrow is drawn from the highest priority (1) substituent to the lowest priority (4) substituent

The% w/wofHinC2H6 [ethane]is:

% H= (MH,tot/MC2H6) ×100%

where:

MHis themolar mass of hydrogen,1.0079 g/mol, andMH,totis thetotalmass contributed by hydrogen in the compound. There are6equivalents of hydrogen in ethane, so we need to account for that.

MC2H6is themolecular mass of ethane, which is the sum of the atomic masses of carbon and hydrogen.

MC2H6=2×12.011+6×1.0079=30.069 g/mol

Hence, the% w/wofHis:

% H= 6×1.007930.069×100%

=20.11%

1.Nomenclature is a system of names or terms, or the rules for forming these terms in a particular field of arts or sciences. Probably the best known of these nomenclatural systems are the five codes of biological nomenclature that govern the Latinized scientific names of organisms.

2.Pure ethanol is a flammable, colorless liquid with a boiling point of 78.5° C. Its low melting point of -114.5° C allows it to be used in antifreeze products. It has a pleasant odor reminiscent of whiskey. Its density is 789 g/l about 20% less than that of water.

Cyclic hydrocarbons have the prefix "cyclo-" and have an "-alkane" ending unless there is an alcohol substituent present. When an alcohol substituent is present, the molecule has an "-ol" ending.hence option c

Areversible reactioncan proceed in both theforwardandbackwarddirections.

Equilibriumis when therateof theforward reaction equalstherateof thereverse reaction.

All reactant and product concentrations are constant atequilibrium.

60° is the angle of projection.so , option b is the right ome

45 degree is the correct answer

sin2x - sin4x + sin6x = 2sin4xcos2x - 2sin2xcos2x = 2cos2x(sin4x - sin2x) = 4sin3x * cosx * cos2x

Answer : Reduction .In this process, metal oxides arereducedby using suitable reducing agentssuchas carbon or by highlyreactivemetals to displace the metals from their oxides.

1

2

atomic mass of Fe = (0.05*54+0.9*56+0.05*57) = 55.95

b) 13,14c) valencyd)2

(c )valency(b)13,14d 2

Gram atomic mass of sodium = 23g

1 mole or 23g of sodium contains6.023 X 10^23atoms

Then 100g of of sodium contains --------atoms

= 100 X 6.023 X 10^23/23 = 2.6182 X 10^24atoms

Gram atomic mass of iron = 56g

1 mole or 56 g of iron contains6.023 X 10^23atoms

Then 100g of iron contains ----------atoms

= 100 X6.023 X 10^23/ 56 = 1.0753 X 10^24

Therefore, 100g of sodium contains more number of atoms than 100g of iron.

The melting and boiling points of noble gases are very low in comparison to those of other substances of comparable atomic and molecular masses. This indicates that only weak van der Waals forces or weak London dispersion forces are present between the atoms of the noble gases in the liquid or the solid state.

The van der Waals force increases with the increase in the size of the atom, and therefore, in general, the boiling and melting points increase fromHeHetoRnRn.

Helium boils at−269∘C−269∘C. Argon has larger mass than helium and have larger dispersion forces. Because of larger size the outer electrons are less tightly held in the larger atoms so that instantaneous dipoles are more easily induced resulting in greater interaction between argon atoms. Therefore, its boiling point (−186∘C−186∘C) is more than that ofHeHe.

Similarly, because of increased dispersion forces, the boiling and melting points of monoatomic noble gases increase from helium to radon.

what's your question I'm not understand

1)it is used in bulbs2)it is used in sign bulbs3)Filling ballons4)Food packing5)Arc Welding6)High speed photography7)Treatment of arthrities

Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gasesare chemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency.

bhtt hadd bhtt haddd nhii ho pyega

because they have no valence electrons

Inert gas elements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence, inert gasesarechemically inert andplaced in zero group(Group-viii) in the periodic table. ... So , theyare placed in zero grou

valency of inert gas elements is 0. so they are placed in zero group.

because they have zero electrons in their valency shell and doesn't react with other elememnts

because they have zero electronc in their valency shell and doesn't react with other elememnts

because they have no electrons in valence shell

Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gases arechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency.

because inert gases can not react with anything and their outermost or valence shell is completed or full

Inert gaselements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inert gases arechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inert gaseswithzerovalency.

निष्क्रिय गैस तत्वों में उनके बाहरी सबसे अधिक शेल पूर्ण या पूर्ण होते हैं। इसलिए उनके पास इलेक्ट्रॉनों को देने या प्राप्त करने के लिए किसी भी रासायनिक प्रतिक्रिया में प्रवेश करने की कोई प्रवृत्ति नहीं है। इसलिए, अक्रिय गैसों को रासायनिक रूप से निष्क्रिय किया जाता है और आवर्त सारणी में शून्य समूह (समूह- viii) में रखा जाता है। शून्य गैस के साथ निष्क्रिय गैसें।

because valency is 0 in outermost shell

Inertgas elements have their outer most shell completed or full. So they have no tendency to enter into any chemical reaction by giving or receiving electrons. Hence,inertgasesarechemicallyinertandplaced in zero group(Group-viii) in the periodic table.Inertgases withzerovalency.

because his orbital is full

because inert gases have zero electron in their valence shell as their outermost shell is completely filled have 8 e- so they are placed in zero group

they have complete octet .....do not require any gain or lose of electron

because they found late

inert gases placed in zero group because they have it electrons in the outermost balance and zero group is also known as 18 group so 8 electrons in valence shell represents the 18 group and they are most stable as they do not react with any element element in zero group are known as noble gases

because of their symmetric outermost electronic configuration of (nS2nP6) except He(1S2) they are most stable do not undergo any chemical reaction (except Xe) are kept in group 18 which is also zero group

because the outermost shell of inert gas is completely filled

Because their outermost orbit is complete.in mendeleevs original periodic table there was no place reserved for noble gas.they was discovered in end of 19th century.so mendeleev created zero group without disturbing original periodic table.

Inert gases have a complete outermost orbit. So, it's valency is zero. Therefore, It is placed in zero group.

Medicine is a drug or other preparation for the treatment or prevention of disease.Statins aremedicinesthat reduce the risk ofheart attackand stroke by helping to lower orpreventhigh cholesterol.

a) Face Centered Cubic: (8⋅1/8)+(6⋅1/2)=4 lattice points per unit volume

c) Body Centered Cubic: (8⋅1/8)+1=2 lattice points per unit volume

(I) Lattice Enthalpy:-The lattice energy of a crystalline solid is a measure of the energy released when ions are combined to make a compound. It is a measure of the cohesive forces that bind ions. Lattice energy is relevant to many practical properties including solubility, hardness, and volatility.

(ii)Bond number is the number of electron pairs between a pair of atoms. For example, in diatomic nitrogen N≡N the bond number is 3, in acetylene H−C≡C−H the bond number between the two carbon atoms is also 3, and the C−H bond order is 1. Bond number gives an indication of the stability of a bond.

because singale bond so ane and iupasc name is butane

single bond is there so it's iupac name is BUTANE

butane because bond is single so ane and for carbon atom so butbut+ane = butane

eth,meth,prop,but-so carbon 4then it prove single bondC4H10=Butane

because of single bond it is butane because it has 4 carbon and 10 hydrogen

butane it name of molecules

there are four atom of carbon and single bond between each atom so,the name of this compound is butane

Butane because Singal bond

This Hydrocarbon compound's name is Butane

hello ,butane answer hai .

butane because bond is single so ane and for carbon atom so but

IUPAC=butanebecause single bond is there

Butane =C4H10 is carbon compond

It's BUTANE (C4H10)

I hope it Helps you

it's iupac name is "butane"because here the carbon no is 4 so it's called bute and here all the bonds are single so here we called "ane" , that's "butane"

butane as it have single bond and four carbon atoms

Butane because it is a single bond

IUPAC name is butane

IUPAC NAME IS BUTANE

According to me the answer is Butane

iupac name is butane hoga

because single bond so any and iupac name is butane

this is butane because here single bond is formed between each molecule

It's Butane because there is four carban and the single bond between them

it is having single bond and it is butane

It can be simplified as... C4H10... which is a single chained hydrocarbon having 4 carbon and 10 hydrogen... Also, it is Alkane because its group formula is CnH2n+2...Four carbon = ButGeneral formula of Alkane = Ane Hence name = " BUTANE"

the answer is "butane "

the answer is butane

butane is iupac name this qaution

the iupac name of this compund is butane

because singale bond so ane and iupasc name is butane

the answer of your question will be :- butane

the ans C4H10 correct

carbon Ka lama chain 4 hai air 4

carbon Ka lamba chain 4 Ka h aur 4 carbon ko butane bolenge

this chain name will be butane

This is the structure of (propane)

The IUPAC name of this carbon compound is Butane.

because their is single bond and these is butane

butane with general formula CnH2n+2

butane is the name of this bond

it's a Buten. so easy

It is butanebeacuse it has four carbon atom which are join by single bond

IUPAC name is butanae

command name is n butane

organic chemistry

because single bond so and iupasc name is butane

singal bond is there so it's iupac name is butane

the answer is Butane

butane is answer of question

Butane is the answer

butane because single bond

butane because this is single bond so name is butane

CH3-CH2-CH2-CH3CH3-CH(2+2+3)CH3-CH7-CH4

answer of this question is butane

since there is only single bond therefore its name i butane

It is single bond so the IUPAC name is Butane

the IUPAC name of following Organic alkane is beuten.

butane is the right answer

the IUPAC name of the given hydrocarbon chain is n-butane

it's IUPAC name is n- butane

because singale bond so ane and iupasc name is butane

Since Carbon has 4 covalent single bond so, this compound is butane

Butane is the correct answer

Butane. .

butane because it is because this compound is made of single bond so at the end of the name of the compound it will be ( ane ) as there 4 carbon so ( but ) at the first

0 is the answer for you quistion

C4H10 ishka answer hoga right

Butane is the right answer

The molecular formula of CH3-CH2-CH2-CH3 is Butane

Butane is IUPAC name to the given compound

butane because single bond

its iupac name is but and because of single bond added with ane .so name is butane

answer is butane because it has single bond

IUPAC Name:butane name

IUPAC name=Butane(C4 H10)

butane is a single bond

the given structure is butane

Isla iupac name butane

because singale bond so and iupac name is butan

these is single there is aiupac name is butane

single bond is their so that is why it's iupac name is 'BUTANE' this answer is right pls referee is answer

ब्यूटेन होगा क्युकी कार्बन के चार परमाणु है

this is a saturated bonding, the formula of it is CnH2n+2so c=4 = butethus the name of itbutane

H H H H l l l lH - C - C - C - C - H 1 l 2 l 3 l 4 l H H H H

Butane ( C H) ( 4 10)

Iupac is n-butane or butane pucca this is right answer

it contains 4 carbon atoms and 10 hydrogen atom so it is butane

C4H10 = Butane .

The right answer to this question is BUTANE

Butane because c4H10

ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन ब्यूटेन

This chain is known as BUTANE and fourth member or alkane group

this carbon compound form singal bondso it's iupac name is Butane(C4H10)

Butane is iupac name

C (Carbon) is four so it's shows ( But )According to Meth, Eth, Prop and But.And single bond shows ane.So But + ane = ButaneC4H10 = Butane

The name of this compound is Butane.

single bond is there.so its IUPAC name is But+ane=Butane

Butane ... contains 4 Carbons and Single bond

butane .reason > The bond between all the carbons is single so it's suffix is ane and 4 carbons means bute combine butane .

This is IUPAC name is a Butane

during single bond, it's butane

because of the single bond its name is BUTANE

alkane are hydrocarbons following formula CnH2n+2

c↓nH↓2n+2is formula of alkane.

any of a series of gases that contain hydrogen and carbon

In organic chemistry, an alkane, or paraffin, is an acyclic saturated hydrocarbon. In other words, an alkane consists of hydrogen and carbon atoms arranged in a tree structure in which all the carbon–carbon bonds are single. Alkanes have the general chemical formula CₙH₂ₙ₊₂.

Alkenes, also known as olefins, are organic compounds that consist of carbon and hydrogen atoms with one or more carbon-carbon double bonds in their chemical structure.Alkenesare unsaturated hydrocarbons. ... We can see two carbon atoms that are bonded together with a double bond, and they can be illustrated in two ways.

Alkenes, also known as olefins, are organic compounds that consist of carbon and hydrogen atoms with one or more carbon-carbon double bonds in their chemical structure.Alkenesare unsaturated hydrocarbons. ... We can see two carbon atoms that are bonded together with a double bond, and they can be illustrated in two ways.

Alkanes are saturated hydrocarbons. By saturated hydrocarbons, it means alkanes have single hydrogen and carbon atoms in their chemical formula. Formula of alkane is CnH2n+2. Methane, propane, ethane, and butane are four alkanes.Let us learn in detail about Alkane and physical properties of the alkane.

Inorganic chemistry, analkane, orparaffin(a historical name that also hasother meanings), is anacyclicsaturatedhydrocarbon. In other words, an alkane consists ofhydrogenandcarbonatoms arranged in atreestructure in which all thecarbon–carbon bondsaresingle.[1]Alkanes have the general chemical formula CnH2n+2. The alkanes range in complexity from the simplest case ofmethane(CH4), wheren=1 (sometimes called the parent molecule), to arbitrarily large and complex molecules, likepentacontane(C50H102) or 6-ethyl-2-methyl-5-(1-methylethyl) octane, anisomeroftetradecane(C14H30).

Alkanesare chemical compounds that consist of carbon (C) and hydrogen (H) atoms, so they are also called hydrocarbons. ... Taking a look at ethane and pentane, thesealkanesare referred to as saturated because they only contain single bonds, and because of that, each carbon atom is saturated with hydrogen atoms.

any of a series of gases that contain hydrogen and carbon

Dehydration to alkenes. Converting an alcohol to an alkene requires removal of the hydroxyl group and a hydrogen atom on the neighbouring carbon atom. Because the elements of water are removed, this reaction is called a dehydration.

The dehydration reaction of alcohols to generate alkene proceeds by heating the alcohols in the presence of a strong acid, such as sulfuric or phosphoric acid, at high temperatures.

i want example reaction

In organic chemistry, a hydrocarbon is an organic compound consisting entirely of hydrogen and carbon. Hydrocarbons are examples of group 14 hydrides. Hydrocarbons from which one hydrogen atom has been removed are functional groups called hydrocarbyls.

Alkane have formula = CnH2n+2

answer - CH4 , C2H6 , C3H8

Alkanesare chemical compounds that consist of carbon (C) and hydrogen (H) atoms, so they are also called hydrocarbons. The chemical structure of alkanes only consists of single bonds. This illustration shows examples of the chemical structures of two alkanes: ethane and pentane.

In organic chemistry, an alkane, or paraffin, is an acyclic saturated hydrocarbon.

In other words, an alkane consists of hydrogen and carbon atoms arranged in a tree structure in which all the carbon–carbon bonds are single.

Alkanes have the general chemical formula CₙH₂ₙ₊₂.

what m I supposed to do?

name the organic compound

it's octane as there are 8 Carbons which means 'Oct' and all have single bonds which means 'ane'

no re. by iupac rules, u gotta take the longest chain. I guess it's 3 methyl heptane but I'm not sure.

yes it's 3 methyl heptane

2-2di methyle propane

2,2-dimethyl propaneoption 1

The number of 1° carbon is 6.

1° - carbon connected to only 1 carbon in its adjacent