Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 15901. |
To discover the relationship between sides and areas of similar traingles Full activity |
| Answer» In similar ?the corresponding sides of ratio equal and similar | |
| 15902. |
Q .3 14.3 |
| Answer» | |
| 15903. |
14.3 |
| Answer» | |
| 15904. |
In mathematics any QUESTION just mail me at [email\xa0protected] .... |
| Answer» | |
| 15905. |
Which book I should practice for standard maths ....rather than NCERT?? |
|
Answer» Rd Sharma , rs Aggarwal , modern abc RD sharma maths book is best I prefer Rd Sharma And think u should to choose |
|
| 15906. |
How should i prepare for mathematics standard exam ? |
|
Answer» Please send standard sample paper and board paper is all the qiestion is ncrt text books Standard maths ki tayari ke liye ncert optinal exercise banaye Practice ncert based questions |
|
| 15907. |
Will standard paper of mathematics be very tough? |
| Answer» It will be of the same existing level that is followed by last years | |
| 15908. |
Which types of questions come in basic maths |
|
Answer» Thanks so much you also prefer basic math From ncert only |
|
| 15909. |
If sum of the roots of the quadratic equation ax2- 5x2 +11=0 then the value of a is? |
| Answer» A=0 | |
| 15910. |
Exercise. 4.4 question 2 and 3 |
|
Answer» Kis,book ka Mail me at [email\xa0protected] |
|
| 15911. |
Ex 7.1 question no 6 and7 |
| Answer» Book | |
| 15912. |
Harsh math standard paper will be same as previous exam level |
| Answer» It means that the previous paper is like that standard level paper and easy level\'s paper is also going at low level from old pattern | |
| 15913. |
Anyone can ask any question i am able yo reply answer |
|
Answer» What is jhamming????? On which base pattern the maths standard paper will make |
|
| 15914. |
Evaluate sin 36 /cos 54 -sin 54/ cos 36 |
|
Answer» Sin(90-54)/cos(90-36)-sin(90-36)/cos(90-54)Cos36/cos54-cos54/cos36=0 But how to solve it O |
|
| 15915. |
On which web site I.will Regiter for ntse exam |
| Answer» The web site is not now opened | |
| 15916. |
Sample paper 2019-2020 |
| Answer» Search on Google | |
| 15917. |
98/4*5+12/2+58 |
|
Answer» Roun off 187 186.5 |
|
| 15918. |
Tangent which can be drawn from external point is called |
| Answer» tangent from external point are always equal | |
| 15919. |
number is the irrational number root 3 is irrational number |
|
Answer» Yes Yes root 3 is irrational number |
|
| 15920. |
3X _ y =2 and x+ 2y = 10 slove graphically. |
|
Answer» Graph is not possible here bro Y=4 ;. x=2 |
|
| 15921. |
Sir basic sample paper came or not |
|
Answer» When and where The basic sample paper has come |
|
| 15922. |
Sin50/sin40=? |
|
Answer» Tan50 Sin 50/sin40=sin (90_40)/sin40=cos 40/sin 40=cot40 Cot 40 |
|
| 15923. |
Find the square root of the following polynomials by division method(i) x4-12x3+4x4+42x+9 |
| Answer» | |
| 15924. |
What is meaning of polynomials |
|
Answer» Many terms A expression of two or more Algebraic terms |
|
| 15925. |
Concept map for class 10 introductio to trigo |
| Answer» | |
| 15926. |
Is anyone from Bangalore |
| Answer» Gourav ek kaam kro ...ap shreya or harshita se baat kr lo....jab booooor hi jao tb ....mere pass aa jana | |
| 15927. |
Abc is an equilateral triangle of side 2a .find of its altitude |
|
Answer» The formula of altitute is root 3 a Root 3 times a. |
|
| 15928. |
5.3 q n0.3 5 |
| Answer» | |
| 15929. |
Compute the mode of age |
| Answer» | |
| 15930. |
Mam / sir what is the blue print of the mathematics chapters |
| Answer» Blue print question | |
| 15931. |
1+sinA=? |
| Answer» | |
| 15932. |
√5+800÷69×√2=10 |
| Answer» | |
| 15933. |
The pattern of paper were chnged |
|
Answer» I have the pattern Yes Yes now MCQs will be there |
|
| 15934. |
When we get sample paper for objective questions |
| Answer» | |
| 15935. |
The quadratic polynomial whose sum of zeroes is 3 and product of zeroes is -2 is |
|
Answer» P(x)= x^-3x-2 y^2-3y-2 P(x)=x^2-3x-2 Hfyig |
|
| 15936. |
Tell me what i choose standard or basic my maths is strong but science is weak |
|
Answer» You have to take standard because your maths is strong If you want to choose arts and biology you can choose basic maths but if you want to take commerce and maths you should take standard maths Which subject you want to take in 11 class |
|
| 15937. |
If one of the zeroes of the quadratic polynomial (k-1)x2+kx+1) is -3 then find the value of k? |
|
Answer» answer k =2 Put the value of x as -3 ur answer will come |
|
| 15938. |
Prove that the parallelogram circumscribing a cricle is a rhombus |
| Answer» \xa0Given: ABCD be a parallelogram circumscribing a circle with centre O.To prove: ABCD is a rhombus.We know that the tangents drawn to a circle from an exterior point are equal in length.Therefore, AP = AS, BP = BQ, CR = CQ and DR = DS.Adding the above equations,AP + BP + CR + DR = AS + BQ + CQ + DS(AP + BP) + (CR + DR) = (AS + DS) + (BQ + CQ)AB + CD = AD + BC2AB = 2BC(Since, ABCD is a parallelogram so AB = DC and AD = BC)AB = BCTherefore, AB = BC = DC = AD.Hence, ABCD is a rhombus. | |
| 15939. |
Cot^2A(secA-1)÷1+sinA=sec^2A(1-sinA÷1+secA) |
| Answer» | |
| 15940. |
Prove that product of any consecutive positive integer is divisible by 6 |
| Answer» Sol;Let us three consecutive integers be, n, n + 1 and n + 2.Whenever a number is divided by 3 the remainder obtained is either 0 or 1 or 2.let n = 3p or 3p + 1 or 3p + 2, where p is some integer.If n = 3p, then n is divisible by 3.If n = 3p + 1, then n + 2 = 3p + 1 + 2 = 3p + 3 = 3(p + 1) is divisible by 3.If n = 3p + 2, then n + 1 = 3p + 2 + 1 = 3p + 3 = 3(p + 1) is divisible by 3.So that n, n + 1 and n + 2 is always divisible by 3.⇒ n (n + 1) (n + 2) is divisible by 3.\xa0Similarly, whenever a number is divided 2 we will get the remainder is 0 or 1.∴ n = 2q or 2q + 1, where q is some integer.If n = 2q, then n and n + 2 = 2q + 2 = 2(q + 1) are divisible by 2.If n = 2q + 1, then n + 1 = 2q + 1 + 1 = 2q + 2 = 2 (q + 1) is divisible by 2.So that n, n + 1 and n + 2 is always divisible by 2.⇒ n (n + 1) (n + 2) is divisible by 2.\xa0But n (n + 1) (n + 2) is divisible by 2 and 3.\xa0∴ n (n + 1) (n + 2) is divisible by 6. | |
| 15941. |
Define mid point theorom |
| Answer» Mid-Point Theorem :-The line segment joining the mid-points of two sides of a triangle is parallel to the third side and equal to half the third side.Given: In triangle ABC, P and Q are mid-points of AB and AC respectively.To Prove: i) PQ || BC ii) PQ = 1/ 2 BCConstruction: Draw CR || BA to meet PQ produced at R.Proof:∠QAP = ∠QCR. (Pair of alternate angles) ---------- (1)AQ = QC. (∵ Q is the mid-point of side AC) ---------- (2)∠AQP = ∠CQR (Vertically opposite angles) ---------- (3)Thus, ΔAPQ ≅ ΔCRQ (ASA Congruence rule)PQ = QR. (by CPCT). or PQ = 1/ 2 PR ---------- (4)⇒ AP = CR (by CPCT) ........(5)But, AP = BP. (∵ P is the mid-point of the side AB)⇒ BP = CRAlso. BP || CR. (by construction)In quadrilateral BCRP, BP = CR and BP || CRTherefore, quadrilateral BCRP is a parallelogram.BC || PR or, BC || PQAlso, PR = BC (∵ BCRP is a parallelogram)⇒ 1 /2 PR = 1/ 2 BC⇒ PQ = 1/ 2 BC. [from (4)] | |
| 15942. |
please teel me which maths i have to choose standard or basic |
|
Answer» If u want to choose biology or humanity then you should choose basic maths and if you want to choose maths or commerce in 11th the you should choose standard maths. You should chose standard . Its will helpful for you in 11th class to chose science or commerce |
|
| 15943. |
Sec + tan = x find sec |
| Answer» Sec+ tan = x(1/cos+ sin/ tan) = x(1+sin / cos) = xCos / cos = x1 = x | |
| 15944. |
Prove that the point (0,0) ,(5,5) and (-5,5) are the verticed of a right angled isosceles triangle |
| Answer» | |
| 15945. |
If the perimeter and the area of a circle are numerically equal then find the radius of the circle? |
|
Answer» Q:\xa0If the perimeter and the area of a circle are numerically equal then find the radius of the circle?Answer:r=2Step-by-step explanation:Perimeter of circle = 2πrArea of circle = πr²According to the Question,Perimeter of circle = Area of circle2πr = πr²or, 2πr / πr = ror, 2 = ror, r = 2Hence the radius is 2. Radius is 2 |
|
| 15946. |
Show that uder root 2 is erretional |
| Answer» First of all we have that under root 2 is rational Under root2=a/b in which a and b are. co-prime Now, b under root 2= a, So, by squaring both the sides we have, 2b square=a square Therefore, by using theorem 1.3 we have that if 2 divides \'a \'square so then, 2 divides \'a\'.So, we have, a=2c (for some integer c) So, by substituting a, we get 2b square =4c square. Now, shift 2 on other side so we get, b square= 2c square. So, again by theorem 1.3 we have that, 2 divides b square so it also so 2 also divides b. So, this occurs because of our wrong assumption so, we conclude that under 2 is not rational but it is irrational | |
| 15947. |
What are the criteria of right angle triangle to proof both the triangle similar |
| Answer» | |
| 15948. |
The 11th term of an AP is 38 and the 16th term is 73.Find the common difference |
|
Answer» Only answer d=9 |
|
| 15949. |
Us eucleid division lemma to show that the cube of any positive integer is of the form 9m,9m+1,9m+8 |
| Answer» | |
| 15950. |
If for an AP ,S8=16 and S16=8 , find first negative terms |
| Answer» -1 | |