Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 18551. |
Ncert ex 6.5 question number 15 |
| Answer» | |
| 18552. |
What is the formula of volume ad cube |
|
Answer» Side^3 1/3pie r cube a^3 |
|
| 18553. |
Explain why the number 7×11×13+13 is composite |
| Answer» 7 × 11 × 13 + 13Take 13 common there we get\xa0= 13(7 x 11 +1 )= 13(77 + 1 )= 13(78)It is the product of two numbers and both numbers are more than 1. So, it is a composite number. | |
| 18554. |
In an election contesten between a and b obtained votes equal to twice the no. |
| Answer» ?? | |
| 18555. |
How to slove this eqn 2x2 |
|
Answer» How?? So the value must be x=√2 Oh ke.. i understood.. its answer must me(√2)^2 4 4 4 |
|
| 18556. |
Sin² .cos² = 2sec² |
| Answer» | |
| 18557. |
I am too much happy |
|
Answer» scored 80 Please give me ur best as Kal mera pre board h mathematics ka Congrats?????????????????☺☺☺aage bhi lana.... I scored 79 In my maths Pre board Why?? Why |
|
| 18558. |
Points A(0,3) B(-2,y) , C(-1,4) find the values of y by using area of triangle formula |
|
Answer» Questions is wrong area must be given They r collinear?? Wrong question... Area must be given |
|
| 18559. |
secx+tanx=a then sinx =? |
|
Answer» No wrong Sinx=( a cos x - 1) Ha bs abhi...start hi hone wala...hai.. Sinx=a cos x Cricket... I don\'t have any pen and copy right now. ....i will solve it later...abhi. ..ground me hu |
|
| 18560. |
Who can prove area of sphere? |
|
Answer» Okk? Hmm,,marti jyo wase bhi tumhe maths nhi ata? Jab se tumne kaha hai?? Anushika?? Koi nhi hai Tum kb se ratta mrne lgi Anushka Pta hi but kon intelligent hai math me yha?? Ratta marna important hai??????? Khud hi*?? Abe tu bs khub hi prove kar le because it is not going to be asked in examination |
|
| 18561. |
How is everyone preparing for boards .?? |
|
Answer» IIT No |
|
| 18562. |
How can u define slant height |
|
Answer» Ok It is used in formula of surface area of cone ////// |
|
| 18563. |
Prove that √2 is irrational. |
|
Answer» It is on pg no. 12 of ncert I had proved it Very easy, already given in Ncert |
|
| 18564. |
2=0 |
|
Answer» ?? Stupid |
|
| 18565. |
Need gf |
|
Answer» Koshish jaari rkho Kya pta mill jaae Koshish jaari rkho Kya pta mill jae Bhaiya ji khi or dhundiye Yaha nhi milegi bhai |
|
| 18566. |
Tan 65°+cos35° |
| Answer» | |
| 18567. |
Hello priya |
| Answer» Best of luck | |
| 18568. |
If 3cosx 4siny =5find the value of4cosx 3 siny =????????? |
| Answer» | |
| 18569. |
Helloo |
|
Answer» Hiiiii... Hi Hiii |
|
| 18570. |
I want Some questions which gives p in coordinate geometry like (-2,p) |
| Answer» | |
| 18571. |
Find the sum of Frist 24 terms of the list the numbers whose nth 3+2n |
|
Answer» 672 Sry 216 is wrong it\'s 672 216 672 What\'s the d 732 672 |
|
| 18572. |
Is there any one from Allahabad, UP |
| Answer» Nhi | |
| 18573. |
Today i got 72/80 in maths |
|
Answer» Congratulation both of u Me too in 2nd pre board... |
|
| 18574. |
headache.. |
|
Answer» yaar ???? ???? ????? ??? |
|
| 18575. |
The roots of equation whose roors are additive inverse |
| Answer» | |
| 18576. |
Given a12=37, d=3, find a and a12 |
|
Answer» A=4 s12=246 Dj ...So easy nahi bolega? a=4 and a12=37 A12 is already given Bhai Avi mood nahi Hai |
|
| 18577. |
Aryan patel are you here |
|
Answer» Ok Name hai :- Ayush ...code yaad nahi !! Friend request de deta hoon abhi hi Player code de diya na Aise bol diya ki aa jana ...but kuchh dega tb toh aaunga Mera player code lele#98yrproqv Ha bolo Kaise aaunga ...kuchh pata higa tab toh Aapna player code bata de Bro aabhi maine game delete kar diya exams hai isialiye After board exams you wil be in my clan please Abhi hi aa jau ?? But mere bhaiya ka hai clan ....maar khakar aana hoga ?? Wo to pata hai bro Par mujhe aryan se kuch kaam hai Main tha COC wala |
|
| 18578. |
Question no. 3 from chapter no . 4 class 10 exercise no . 4.3 |
| Answer» Check NCERT Solutions here :\xa0https://mycbseguide.com/ncert-solutions.html | |
| 18579. |
How many here who play clash of clans game |
|
Answer» After board exams you will be in my clan Please Nope .Coleader !! Utna time nahi deta toh leaden banna pasand nahi You are leader Mine clan level 5 and i donate 7000+ every season ...But busy due to exams Level 4 clan Which level clan ?? Ayush what is your clan level Anyone wants to come in my clan Join my clan 2 are of th9 one of th10 and one of th5 Me from 4 id\'s It was very addictive so delette it Me th 9 |
|
| 18580. |
What is Hydrogenation of oil? |
|
Answer» In this method the unsaturated oil is reacted with hydrogen gas in present of nickel which leads to its hydrogenation and it is converted into saturated dalda ghee It is a addition reaction in which there is adding of hydrogen to the vegetable oil in the presence of nickel catalyst to give vanspati ghee |
|
| 18581. |
ax+by=a+b÷23x+5y=4 |
| Answer» The given system of equations is{tex}ax + by = \\frac{{a + b}}{2}{/tex}\xa0...(1)3x + 5y = 4 ...(2)From (1), we get2(ax + by) = a + b{tex}\\Rightarrow{/tex}\xa02ax + 2by - (a + b) = 0 ...(3)From (2), we get; 3x + 5y -4 = 0 ...(4)We know that if,\xa0a1x +\xa0b1y + c1\xa0= 0...........(i)a2x + b2y + c2\xa0= 0............(ii)then by cross multiplication method,{tex}\\frac x{b_1c_2-c_1b_2}=-\\frac y{a_1c_2-c_1a_2}=\\frac1{a_1b_2-a_2b_1}{/tex}Here,comparing equation (3) & (4) with the above formula, we get:-a1 = 2a, b1 = 2b, c1 = -(a + b)a2 = 3, b2 = 5, c2 = -4Now applying cross-multiplication method, we have ;{tex} \\frac{x}{{2b \\times ( - 4) - [ - (a + b) \\times 5}]}{/tex}\xa0{tex} = \\frac{{ - y}}{{2a \\times ( - 4) - \\left[ { - (a + b)} \\right] \\times 3}}{/tex}\xa0{tex}= \\frac{1}{{2a \\times 5 - 2b \\times 3}}{/tex}{tex} \\Rightarrow \\frac{x}{{ - 8b + 5(a + b)}} = \\frac{{ - y}}{{ - 8a + 3(a + b)}}{/tex}\xa0{tex} = \\frac{1}{{10a - 6b}}{/tex}{tex}\\Rightarrow \\frac{x}{{ - 8b + 5a + 5b}} = \\frac{{ - y}}{{ - 8a + 3a + 3b}}{/tex}\xa0{tex} = \\frac{1}{{10a - 6b}}{/tex}{tex}{/tex}Now, from 1st & 3rd part;{tex}\\frac{x}{{5a - 3b}} = \\frac{1}{{10a - 6b}}{/tex}{tex} \\Rightarrow x = \\frac{{5a - 3b}}{{10a - 6b}} = \\frac{{5a - 3b}}{{2(5a - 3b)}} = \\frac{1}{2}{/tex}Again, from 2nd & 3rd part;{tex}\\frac{{ - y}}{{ - 5a + 3b}} = \\frac{1}{{10a - 6b}}{/tex}{tex} \\Rightarrow - y = \\frac{{ - 5a + 3b}}{{2(5a - 3b)}}{/tex}{tex} \\Rightarrow y = \\frac{{ - ( - 5a + 3b)}}{{2(5a - 3b)}}{/tex}{tex} = \\frac{{5a - 3b}}{{2(5a - 3b)}}{/tex}{tex} \\Rightarrow y = \\frac{1}{2}{/tex}Hence, {tex}x = \\frac{1}{2},\\;y = \\frac{1}{2}{/tex}\xa0is the solution to the given system of equations. | |
| 18582. |
What do you mean by trignomateric ratios |
| Answer» All the values of 30° ,45° etx r ratios | |
| 18583. |
2+6 |
|
Answer» are bhai itta difficult question mat puch lol 8 8 |
|
| 18584. |
Verify that 3,-2,1 are the zeros of the cubic polynomial |
|
Answer» Just put all the 3 values in the give polynomial and if remainder comes 0 then yes they r zeroes Suraj you want formula |
|
| 18585. |
are black pens allowed in board exams |
|
Answer» Jarori nhi rehta highlight karna Bhai black pen se highlight kr skte h Shubham is correct Black pen ka kya karega paper mai question thodi likhna hai Don\'t ask such question Yes they are Yes |
|
| 18586. |
Root of872 |
|
Answer» Hiii Sneha me u know me... 29.529 29.52 |
|
| 18587. |
Give all formulas in class 10 maths . |
| Answer» Check revision notes for formulae :\xa0https://mycbseguide.com/cbse-revision-notes.html | |
| 18588. |
If the distance between the points (4, k) and (1, 0) is 5, then what can be the possible values of k |
|
Answer» So possible value of K is +4 or - 4 Possible value of K is +4 or - 4 K=4 |
|
| 18589. |
A wire 112cm long is bent to form a right triangle if hypotenuse is 50cm find area of triangle |
| Answer» | |
| 18590. |
Threr |
| Answer» Ruhi | |
| 18591. |
How many sides of the triangle? |
|
Answer» Hlo Ruhi |
|
| 18592. |
If a sin^2A + b cos^2A=c then show that cot^2A=c-a/b-c |
| Answer» | |
| 18593. |
True |
| Answer» | |
| 18594. |
Prove that root 5. 3782 + root 89. 57210 is irrational |
| Answer» | |
| 18595. |
A^2+B^2 equals how much |
|
Answer» (a +b)^2 - 2ab (a+b) 2 -or + 2ab |
|
| 18596. |
Derive all formulas of Sn |
|
Answer» Sn= n/2【2a +[n-1]d】 Yaani ki hum Sn= n/2【a+a+(n-1)d】kah sakte hai Yaani ki Sn =n/2 {a+l}. {{{a+(n-1)d=l=An Sn=n/2(a+an)orSn=n/2(a+l) Write from 1st term....and write ap from last term.....and add them... You will get it? Sn=n/2(2a+(n-1)d)Sn=n/2(a+l) |
|
| 18597. |
X^2+5x-(a^2+a-6) =o |
| Answer» Given,\xa0{tex}x^2+5x-(a^2+a-6)=0{/tex}splitting {tex}a^2+a-6{/tex}{tex}\\Rightarrow{/tex}\xa0x2\xa0+ 5x - (a2\xa0+ 3a - 2a - 6) = 0{tex}\\Rightarrow{/tex}\xa0x2\xa0+ 5x - [ a(a + 3) - 2 (a + 3) ] = 0{tex}\\Rightarrow{/tex}\xa0x2\xa0+ 5x - (a + 3)(a - 2) = 0Now splitting the middle term{tex}\\Rightarrow{/tex}\xa0x2\xa0+ (a + 3)x -(a - 2)x - (a + 3) (a - 2) = 0{tex}\\Rightarrow{/tex}\xa0x [x + ( a + 3)] - ( a - 2)[ x + (a + 3)] = 0{tex}\\Rightarrow{/tex}\xa0[x + ( a + 3) ] [ x - (a - 2)] = 0\xa0{tex}\\Rightarrow{/tex}\xa0x + ( a + 3) = 0 or x - ( a - 2) = 0{tex}{/tex}\xa0Therefore,\xa0{tex}x=-(a+3) \\ {or} \\ (a-2){/tex} | |
| 18598. |
If p\'th term is q and q\'th term is p. Prove that it\'s m\'th term is p+ q-n..? plzzz..... |
| Answer» Let a be the first term and d be the common difference of the given A.P. Then,pth term = q {tex}\\Rightarrow{/tex}a + (p-1) d = q ...(i)qth term = p {tex}\\Rightarrow{/tex}a + (q-1) d = p ...(ii) Subtracting equation (ii) from equation (i), we get(p - q) d = (q - p) {tex}\\Rightarrow{/tex}\xa0d = -1Putting d = - 1 in equation (i), we geta + ( p-1) × (-1) = q⇒ a = (p + q - 1)\xa0nth term = a + (n -1 )d= (p + q - 1)+ (n -1) × (-1)= p + q - 1 -n + 1= (p + q - n) | |
| 18599. |
Divyansha aap mere whatsapp pe ho |
|
Answer» Great I am also do you want to join a group Ok Kl kru to chalega ...Kya Nahi message kro Tumhe nhi pta Kya ? Message kro abhi ek bar Ha |
|
| 18600. |
2016 board question paper |
| Answer» Download it from this app | |