Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 25801. |
What are functional groups?(anyone please send the answer) |
| Answer» An atom or a group of atoms that determine the properties of any organic compounds is functional group. | |
| 25802. |
Find the eleventh term from the last term of AP 27,23,19...........,-65 |
| Answer» -25 | |
| 25803. |
Find the common difference of an A.P in which a25 - a12=-52 |
| Answer» d = 4 | |
| 25804. |
Is 999999999.0000 a term of A.P. 1, 2, 3, 4... |
|
Answer» ??? Is it wrighr Yes |
|
| 25805. |
find the LCM 336 and 54 by prime factories method |
| Answer» | |
| 25806. |
Solve x =2x+4\\x=9 |
| Answer» | |
| 25807. |
Find the value of sin 60°geomectrically |
| Answer» | |
| 25808. |
x^^-3x^+2 |
| Answer» | |
| 25809. |
What is remainder theorem?????What is the value of `n\' |
| Answer» | |
| 25810. |
How to know that the graph is intersecting x-axis |
| Answer» When line passes through x axis | |
| 25811. |
fundamental theoram of arithmetic plz tell tommorow is my maths exam |
|
Answer» So sad Unique prime factorization theorem |
|
| 25812. |
How to maths paper will come in 2018What percentage of easy difficult medium type of question |
|
Answer» 10 question of 3 mark 6 question 1 mark 8 question 4 marks 6-7 questions is from 1 marks 5-6 question is from 2 marks 9-10 question is from 3 marks and the left question is from 4 marks |
|
| 25813. |
Prove that √2 is irrational number. |
|
Answer» It\'s ncert question Or rd sharma...It\'s there in those books R u having rs agarwal ? |
|
| 25814. |
Find the sum of the first 40postive integers |
| Answer» a=1 d=1 n=40Sn= 20(1+40) =820 | |
| 25815. |
Vbb |
| Answer» | |
| 25816. |
Circle areas |
| Answer» | |
| 25817. |
Show that one and only one out of n, n+1, n+2 divisible by 3 |
|
Answer» Take n=aq+b, where a=3 and b=0,1,2,And then place this value of n in all of them- n, n+1, n+2 See example in r.s |
|
| 25818. |
Priyanshi then how first term is 1 .. 0*1=0 |
|
Answer» Thik h tm pura sahi btao ?? pura sahi nahi hai.. khaak shocked?? Thnx Rahul Rahul shocked ho gya ki kase koi us ke question ko solve Kar sakta h ??? yes..half right.. but good attempt.. ?? Rahul I am right n We not multiply zero from one we multiply one from one then we got one beginning there are two one Mtlb |
|
| 25819. |
Name the valve from which blood goes into left ventricle? |
| Answer» Pulmonary vein | |
| 25820. |
Value of sin120degree |
|
Answer» Priyanshi in jk where Sin 60= sin 120 Value of sin 60 = value of sin 120 √3/2 |
|
| 25821. |
What is value of sin90 |
|
Answer» Ok priyanshi Mere qst k anwr nhi diya Wo answer v reply kr rhi hu n isliye thoda late reply kr rhi hu Mtlb Mai kr to rhi hu 1 Why priyanshi you not talking to me Vry easy ?.. 1 hoga answer ?? 1 |
|
| 25822. |
Ya have an a same confusion that Whether we have to use gel or ordinary pens in board exam? ???? |
|
Answer» Ball pen Ball pen i think !! Gel |
|
| 25823. |
If sinA+sin^3A =cos^2A then prove that cos^6A-4cos^4A +8cos^2A=4 |
| Answer» | |
| 25824. |
Find the value of x for which (8x+4),(6x-2)&(2x+7) are in A.P. |
|
Answer» Thanx all of u Consider the 3 terms as \' a , b & c \'.2× b = a + c.Substitute in it.Then u will get x. 7.5 |
|
| 25825. |
Trigonometry identity |
| Answer» Open yr NCERT maths book | |
| 25826. |
If m=a+1 /a-1 and n =a-1 /a+1, then m²+n²-3 mn is equal to : |
|
Answer» Mujhe toh question he lag rha hai ?? ?? qstn h |
|
| 25827. |
TSA of a cube is 216cm² . What will be it\'s volume |
| Answer» 216cmcube | |
| 25828. |
bpt stands for |
| Answer» Basic proportionality theorem | |
| 25829. |
What is tangent-secant theorem? |
| Answer» | |
| 25830. |
I want all the formulas |
| Answer» See in this app | |
| 25831. |
Two cube each of volume 125cm are joined end to end. Find the surface area of resulting cuboid |
|
Answer» Volume of each cube = 125 cm³ a³ = 125 a. = 5 cmLength of cuboid = (5 +5) = 10 cmBreadth of cuboid = 5 cmHeight of cuboid = 5 cm Surface area of cuboid = 2 (lb + bh + hl) = 2 (10×5 + 5×5 + 5×10) = 2 (50 + 25 + 50) = 2 (125) = 250 cm² 250 cm square |
|
| 25832. |
If x^2+2x+k is the factor of polynomial x^3+3x+5x-6 then find k |
| Answer» | |
| 25833. |
If m=a+1 /a-1 and n=a -1 /a +1, then m square +n square - 3mn is =? |
| Answer» | |
| 25834. |
If 2 sin(3x – 15)° = 3 , then find the value of sin2(2x + 10)° + tan2(x + 5)°. |
| Answer» | |
| 25835. |
Prove that sin^4 alpha + sin^2 beta + cos^4 + cos^2 beta=1 |
| Answer» | |
| 25836. |
756 factor |
| Answer» | |
| 25837. |
Is 144 term of the A.P 3,7,11...? Justify your answer. |
|
Answer» no 575 No...............its not the term. Check by putting formulae a+(n-1)d=144. If n is whole no then it is the term..... No |
|
| 25838. |
3,5,18,72,? What is the next term |
|
Answer» Yes this is not in ap This is not in A.P. Nhi mil rha... sochne waala question hai yeh.. |
|
| 25839. |
When I sit to solve math I do all questions wrong and I do not solve next question ?? What can I do |
|
Answer» Harivansh rai bachan ki ek pnkti..... lehro se drkr nauka paar nhi hoti or koshish ktne waalo ki kbhi haar nhi hoti.... big fan?? Questions ko pahle samajh lo you can do best of luck????????? Practice makes a men perfect Also to you Try try and try.....???? Vo bhi accha idea hai...???? Tum aisa Karon blanket kholo or soo jaon ????????????? Smjh le kese krte hai... then practice hi practice.. Just do practice....one time solve ques. By seeing solution then.solve urself.... |
|
| 25840. |
Cos60+sin30 |
|
Answer» Cos60+sin(90-60)Cos60+cos602cos602x1/21 ans 2cos 60 1 2sin30 |
|
| 25841. |
The pointA(3,Y)is equidistant from the point P(6,5)and Q(0,-3).Find the value of Y |
| Answer» Y=1 | |
| 25842. |
Prove that( 1 + cosec theta )(1 - sin theta) = cos theta cos theta |
| Answer» Change all into sin and cos | |
| 25843. |
How many total. Cards are there?what are king queen and jack |
|
Answer» 52 cards and kings,queen,jack r called face card Total cards = 52 and king queen and Jack are face cards. They are 12 in number.. |
|
| 25844. |
What is the properties of an isosceles triangle |
| Answer» An isosceles triangle is a triangle that has (at least) two equal side lengths. If all three side lengths are equal, the triangle is also equilateral. | |
| 25845. |
Find the value of k if quadic equation 3x2square -kroot3x+4=0 |
|
Answer» Its 4 K=4 |
|
| 25846. |
The ratio of the sum of n terms of two A.P.s is (7n+1):(4n+27).Find the ratio of their mth term. |
|
Answer» We know n th term of AP can be written as an= sn - s(n-1)i.e. nth term of AP = sum of first n terms - sum of first (n-1) termsNow, Try once more ...here it can\'t be solved !! Try again urself |
|
| 25847. |
Pichle exam m maths m kitne no aaye out of 80??? |
|
Answer» Ayush plx mera gender mat change kar I m a boy named vansh bhardwaj Ek din m kitni ghnte padhta h tu ayush?? Mat kro ....mera kya logi ?? Nice marks shashaank Ayush sachi mujhe biswaas nhi ho rha 68 ??? vishwas hi nhi h ? Sujal well done.. Ayush sachi??? 79.5 ...so indirectly 80 Usne 48 aye Mera Abhi 50 ka Huwa tha Btao ti |
|
| 25848. |
Tan(a)÷ sec(a)= sin(a) or not |
|
Answer» Yes answer sin(a) Yeah!! Yes Yup |
|
| 25849. |
How can we do triangle questions easily |
| Answer» | |
| 25850. |
Solve for x and y ax+by = a+b _____ 23x+5y=4 |
| Answer» Solve the eqn and u will the values in terms of a&b | |