Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 31201. |
10+2 |
|
Answer» 5×100_2×244 200 - (100+88) 12 12.. |
|
| 31202. |
123 and 12 |
| Answer» | |
| 31203. |
If m times the m\'th term of an A.P. is equal to n times the n\'th term and m=- |
| Answer» | |
| 31204. |
Prove that the rectangle circumscribing a circle is a square. |
| Answer» | |
| 31205. |
If sina+sin^2a=1 so prove that cos^2a+cos^4=1 |
| Answer» SinA + sin (sq) A =1SinA =1- sin(sq)A _(1) By identitySin(sq)A+cos(sq) A =11-sin(sq) A =cos(sq)AOn putting this value in _(1)Sin A=cos(sq)AOn squaringSin(sq) A= cos (raised to4) A _(2)We have to find Cos(sq) A + sin (sq) A from _(2) =1 by identity | |
| 31206. |
How i can get full marks in math exam also in board exam |
|
Answer» First solve all the ncert qurstion and when u think that particular chapter\' s all the textual question are done the go only go for gides and value based question after that u can set timer and solve question so it will be easy to complete the paper and perfectly Only ek hi step hhh practice pratice pratice.... Mera bi yhi haal tha but maths ko apni life ka part banao iski practice krna skip n kro.. Hmesha 2hours do uss... Your maths will be perfect... |
|
| 31207. |
Find the sum of 1-6+2-7+3-8+.......100term |
|
Answer» -500 -250 -250 |
|
| 31208. |
Tan A + cotA = 7 then find the value of tan^2 A + cot^A |
|
Answer» So, the value of tan^2 + cot^2 = 47. Tan A + cot A = 7 => (tan A + cotA)^2 = 49 (squaring on both sides) => tan^2A + cot^2A + 2(tanA × cotA) = 49........(1) . Now, as we know that, tanA× cotA= 1 . So, put the value of tanA × cotA in (1), we get, tan^2A + cot^2A + 2 = 49 => tan^2A + cot^2A = 47. 47 |
|
| 31209. |
i want answers of sample paper 2020 |
| Answer» Which subject | |
| 31210. |
The LCM of smallest two digit number composite number and smallest composite number is |
|
Answer» First, we have to know what is a composite number. A composite number is a number that has a minimum of two factors. Or we can say a whole number that can make by multiplying other whole numbers.So, the smallest composite number is 4, and the smallest 2 digits composite number is 10.4 is a composite number cause it has 2 factors. One is (1 *4) and, another one is (2*2)10 is also a composite number because it also has 2 factors. One is (1 *10) and, another one is (5*2)LCM of these two composite numbers ( 4 and 10 ) is 20. 20 |
|
| 31211. |
The LCM of smallest number two digit composite number and smallest composite number is |
| Answer» | |
| 31212. |
The decimal representation of 11 |
| Answer» | |
| 31213. |
Let eight consecutive no. Be×,×+2,×+4,×+6,×+8,×+10,×+12,×+14 |
| Answer» | |
| 31214. |
Solve for x (2 x/x-5)^2+(2x/x-5) - 24=0 |
| Answer» | |
| 31215. |
Sides of two similar triangles are in the ratio 4:9. Areas of these triangles are in the ratio |
|
Answer» 16:81 16/81. |
|
| 31216. |
Trigonometric ratios derivation |
|
Answer» Sin Sin=os/hCos=as/hTan=os/as Cosec=1/sinSec=1/cosCot=1/tan Sin |
|
| 31217. |
Sin30 + tan45-cosec60/sec30+cos60+cot45 |
| Answer» (43 - 24√3)/11 | |
| 31218. |
X-1÷x-2+x-3÷x-4=10/3. Find the value of x |
|
Answer» x = 5 or 5/2. ??? |
|
| 31219. |
How can we know that construction is needed for a particular question ...for class 10th |
|
Answer» Why????? By seeing what do you want to prove and what you have in the question you ca understand how to do construction |
|
| 31220. |
Lesson 8 me doubt h |
| Answer» Tell me what\'s ur doubt | |
| 31221. |
What is formula of cuboid of volume surface area |
|
Answer» T.s.a. of cuboid=2(lb+bh+hl),....,C.S.A of cuboid=2(lb+bh),....,Vol. Of cuboid=L×B×H... Volume of cuboid: l×b×h anf T.S.A of cuboid 2(lb+bh+hl) |
|
| 31222. |
Important question for CBSE Board 2020 |
|
Answer» Prepare from this and you will get full marks in board exam You will get it in oswaal question bank for 2020 exam and also in sample papers........ and of course in this app.... |
|
| 31223. |
Solve:X+4=0 |
|
Answer» X=-4 x= -4 -4 X = - 4 X = 4 |
|
| 31224. |
Write a rational number between √3 and √5 |
|
Answer» 1.735 Rational number between √3 and √5 is 1.75 |
|
| 31225. |
How to find zeros of polynomial?How to find zeros of quadratic polynomial |
| Answer» By factorisation method or quadratic formula | |
| 31226. |
Find the number Of all 3 Digit natural numbers which are divisible by 9 |
|
Answer» a=108 , d=9 , an=999, then find n with formula an=a+(n-1)d , the final answer is n= 100 Bro first find the smallest and largest 3digit terms divisible by 9 then use formula of AP for finding THE nth term \'An=A1+(n-1)d where A1 is the smallest 3digit term divisible by 9 An is the largest 3 digit term and d is the common difference \'9\' |
|
| 31227. |
Area of circle= |
|
Answer» π r² πr² |
|
| 31228. |
G m frnds...have a good day |
|
Answer» Gud afternoon Plzzzzz bohot important h Shreya plzz mujhe aapse baat krni h Same to u. Bestie ji kl mai ye app uninstall kr dunga..jisse ki mind diverd n ho Lagta h ab agle saal milenge????????? Mera 28 ko h last Ya Ha ankesh ji or ap bhi..sabko all the best Mera 23 ko last h Mera 23 se...??? Apna best dena ok Hm bhi ab school ni jayenge..ghar pr hi ab revision krenge Mere 16 se Ok ab acche se baat 23 ko hogi because mere 14 se pre board h.. Na ji..aaj or kl rest krna h..? I m also like u....aap school ni gaye Family* Hum acche h ji..famil bhi..or aap kaise h Hello..kaisi h aap..and ur family Gm.. |
|
| 31229. |
Will optional exercises come in board exam ? |
|
Answer» Hmmm.. maths ki optional exercise m se bhi aaa skta hhh....?? And other 10 marks will be on one word or fill in the blanks Yep of 10 marks Ya |
|
| 31230. |
The nth term of an A.P. , the sum of whose nth term is Sn is....?explain |
|
Answer» We know, difference between two consecutive terms of an arithmetic progression (AP) must be same.e.g., if a is the first term and d is the common difference of an AP.then, series is : a , a + d , a + 2d , a + 3d , a + 4d...... are in APnow, nth term = = a + (n - 1)dsum of n terms = = a + (a + d) + (a + 2d) + ..... + [a + (n - 1)d]= (a + a + a ....n times ) + [d + 2d + 3d + .... + (n - 1)d ]= na + d[1 + 2 + 3 + ..... + (n -1)]= na + d[(n - 1)(n)/2 ]= n/2 [ 2a + (n - 1)d]hence, = n/2 [2a + (n - 1)d ] Sn=n/2+{2a+(n-1)d} |
|
| 31231. |
Guidelines forMathematics Laboratory in Schools |
| Answer» | |
| 31232. |
Chapter 10 |
| Answer» | |
| 31233. |
Solve 60/x - 60/x+5=1 by quadratic formula |
| Answer» Answer x= 15, -20 | |
| 31234. |
Solve 6-p²=p using factorization method |
| Answer» 6-p^2 =p6= p+p^2p^2+p-6=0P^2+3p-2p-6=0p(p+3)-2(p+3)=0(p+3)(p-2)=0p=(-3),2 | |
| 31235. |
3x+5/5 - x-2/3 - 5x-7/6 = 0 |
| Answer» | |
| 31236. |
I want to understand the exercise area related to circle |
|
Answer» It\'s really easyJust try it Go through Youtube or try at ones... |
|
| 31237. |
1 chapter mcq |
| Answer» | |
| 31238. |
The value of theta in cosec increases or decreases |
| Answer» As theta increases the value of cosec theta decreases. | |
| 31239. |
Prove that sinA(1+tanA)+cosA(1+cotA) =secA+cosecA |
| Answer» | |
| 31240. |
Exercise 13.1 Questions 3,4,5 |
| Answer» | |
| 31241. |
Can I get some important questions from ncert class 10 ?? |
|
Answer» I know whole ncert is important but its my 1st pre board exam of maths ....so m little bit scared of exam ....i hope so exam would be easyy....?? ? Of course...infact whole ncert is very important |
|
| 31242. |
4.3 quesion 2ka first part |
| Answer» Excuse me, solution is given in this app..... | |
| 31243. |
find probability of an impossible event |
|
Answer» 0 0 Zero O 0 |
|
| 31244. |
Construct a triangle whose perimeter is 13.5 cm and the ratio of sides is 2:3:4 |
|
Answer» triangle* x=1.5.........therefore, sides of triangles = 3cm , 4.5cm and 6cm Let them be as 2x 3x and 4x use pythagoras theorem to find out x and do the construction |
|
| 31245. |
If a=2 and d=8 and Sn=90 . Find n and an. |
|
Answer» Sn=n/2(2a+(n-1)d)90=n/2(4+8n-8)180=n(8n-4)8n²-4n-1802(4n²-n-45)n=-9/2,n=5 90 = n/2(4+(n-1)8)180= n(4+8n -8)180= -4n+8n^28n^2-4n -180 =0Solve it for n Sn = 90Sn = n/2 [ 2a + (n - 1)d]90 = n/2 [ 2 x 2 + (n - 1)8]180/n = 4 + 8n - 8180/n = 8n - 4180 = 8n^2 - 4n{tex}8n^2 - 4n - 180 = 0{/tex}{tex}2n^2 - n - 45 = 0{/tex}{tex}2n^2 - 10n + 9n - 45 = 0{/tex}2n( n - 5) + 9( n - 5) = 0(2n + 9)(n - 5) = 0n = -9/2 or n = 5But n cannot be negative.So, n = 5an = a + (n - 1)da5 = 2 + (5-1)8a5 = 2 + 4 x 8a5 = 2 + 32 = 34 N=5,an=34;if n=9/2,an=38 |
|
| 31246. |
What is value of root -2 |
|
Answer» Thanks for answering mates Not 1.414 ,imaginary number banega to hoga 1.414i.i matlab iota..use hota h na aapne pdha hoga 1.414 Hi mate......Value of root -2 is : *1.414* 1.414 |
|
| 31247. |
If there is a school conducting a game there are thirty students divide the students in four games |
|
Answer» The school is just conducting one game right?.....the how to divide the students in fourgames? 7.5 |
|
| 31248. |
Exercise 13.2 7 |
| Answer» 2and 4 | |
| 31249. |
(cosQ-sinQ)/(cosQ+sinQ)=(1-√3)/(1+√3) |
| Answer» Pura question kya hai? Kuch prove krna hai ya Kuch find krna hai? | |
| 31250. |
Show that (CosQ-sinQ)/ (cosQ+sinQ)=(1-√3)/(1+√3). |
| Answer» | |