InterviewSolution
Saved Bookmarks
InterviewSolution
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 1951. |
एक 7 मीटर व्यास वाली बेलनाकार टंकी का आयतन 770 घन मीटर हैज्ञात कीजिए। --*तो टंकी की ऊँचाईe gL |
|
Answer» radius = 7/2 m20.01m will be the height |
|
| 1952. |
ABC is an isosceles right-angled triangle, right-angled at C. Prove that AB2AC |
| Answer» | |
| 1953. |
Express in simplest forma. 24:40 b. 75:300 |
|
Answer» a) 24:40 = 3:5 b) 75:300 = 3:20 |
|
| 1954. |
the triangle is right angled4 GABC is night angled at A. HAL BC.prove that 4BAL- ACE |
|
Answer» Like if you find it useful |
|
| 1955. |
EXERCISE 9.1ind the integrals (primitives) of the followingー7) drdx3x2 2x 5dx5.2 dr2dx8. sin4x.cos3x dx9.cos2x.cos4x dx |
| Answer» | |
| 1956. |
18. 1J (2x+)sin (2x3 +3)drsin (2x +3x)dr |
| Answer» | |
| 1957. |
एक बहुपद के अन्तः कोण, A.P. में हैं। न्यूनतम कोण 120° है।और सार्व–अन्तर 59 है। बहुभुज की भुजाओं की संख्या ज्ञातकीजिए।(a) 7(b) 8(c) 9(d) 11 |
|
Answer» 60+55+50+45+40+35+30+25+20 = 360भुजाओं की संख्या = 9 bhjao ki number 9 hai c) is the correct answer a correct answer is (C) 9 |
|
| 1958. |
The dimensions of a rectangular room (cuboid) are l, b and h. What is the arour walls?2.oo ig 19 so m What is its |
|
Answer» Area of four walls = Lateral Surface Area of the room = 2(l+b) x h Or, you can say perimeter x Height please like the solution 👍 ✔️ |
|
| 1959. |
If a square garden is 220meters then how much of itscircumference |
|
Answer» 220= 4x sideside = 55m |
|
| 1960. |
A man deposited rupees 10,000 in the bank he will threw rupees 6,500 from the next day. What is the balance money in the bank. |
|
Answer» 10,000-6,500=3500 remaining balance |
|
| 1961. |
s. Suhani depositeda sum of 9000 in a bank. After 2 years, she withdrew 4000of 5 years, she received 8300. Find the rate of interest on thesum she received. |
|
Answer» Suhani deposited a sum of 9000 in a bank.so, principal , P = 9000 Rs.Simple interest after 2 years where interest rate r % per annum is given by S.I = 9000 × r × 2/100 = 180r so, total amount after 2 years , A = 9000 + 180r now, Suhani withdraw 4000 from her account.rest amount = 9000 + 180r - 4000 = 5000 + 180r for second case, rest total amount , A = 5000 + 180r but we know, simple interest is applied only on initial principal amount not whole amount. otherwise it will be compound interest. so, principal , P = 5000 time taken, t = 5 years simple interest after (5-2)= 3 years , SI = 5000 × r × 3/100 = 150r she received in last 8300 so, 180r + 150r + 5000 = 8300330r = 8300 - 5000 = 3300r = 3300/330 = 10% hence, interest rate is 10% |
|
| 1962. |
A man deposited some money in the bank on 7-2-2009 for 100 days. Find the day on which he can withdraw his money. |
|
Answer» 100 days from 7-2 -2009will be 17th may 2009 so he can now take his moneyas remaining days in February will be 21 in March -31 in april- 30 days and on 17th may it will be 100th dayconsidering 7 Feb as 1st day |
|
| 1963. |
9. A man deposited? 4200 in bank at 8% (pa) and1400 in a post office at 6% (p.a.). Find the rateof interest for the whole sum. |
| Answer» | |
| 1964. |
13. Two-fifths of A's monB's is equal to C's; in all they have Rs 770: what have they each?ey is equal to B's, and seven-ninths of |
| Answer» | |
| 1965. |
a bank at the rateaks.-edrเป็ A man deposited-Rs 110000 insimple internest annuallyi Finolthe amount in is th yarsince hep dleposited the amount and also calculatethe total amount L ater 2o yadrs |
| Answer» | |
| 1966. |
express each of the following ratios in the simplest form 24:36 |
|
Answer» 24 : 36 Cancel using 6 4 : 6 Cancel using 2 2 : 3 thanks |
|
| 1967. |
express each of the following ratios in the simplest form 2.5m to 150cm |
|
Answer» 2.5 m = 250cm So, 250:150 5:3 |
|
| 1968. |
A man left 25% of his money to his mother, 55% to his daughter and the remainingHow much money did he leave? Find the shares of his mother and daughter9000 to his brother. |
| Answer» | |
| 1969. |
17, A man left 25% of his money to his mother, 55% to his daughter and the remainingbrother. How much money did he leave? Find the shares of his mother and daughter9000 to his |
|
Answer» where is the answere please sent answere He left €45000.mother's share =11250, Daughter's share=€24,750 |
|
| 1970. |
3. The surface area of a cube is 1350 emi. Find the volume of the cube.ht circular cylinder is 250 cm Ii the heer 5m |
|
Answer» Total surface area of cube = 6 a² But, Tsa of cube = 1350 cm² ∴ 6a² = 1350 ⇒ a² = 1350/6 ⇒ a² = 225 cm ⇒ a = √ 225 ⇒ a = 15 cm The side of the cube = 15 cm. Now, Volume of cube = a³ ⇒ ( 15 )³ ⇒ 15 × 15 × 15 ⇒ 3375 cm³ Volume of cube : 3375 cm³ |
|
| 1971. |
10. What is the comhalf-yearly ?12000 at 10% pa for 2 years, if the interest is calculatedpound interest onar ooper annum, compounded |
| Answer» | |
| 1972. |
weight ofchocolate bars in the gift pack!7. Radha has 6 kg 300 g ghee. She gives her three daughters equally, How much everydaughter will get? |
|
Answer» 2kg 1gm.....hope this helps |
|
| 1973. |
10. A vessel had 4¾ l of milk. Suman drank 3/5 l How much milk is left in the vessel(b |
| Answer» | |
| 1974. |
5. Determine if the following ratios form a proportion:(i) 25 cm 1 m and 40 160(il) 39 litres : 65 litres and 6 bottles: 10 bottles(iii) 200 mL : 2.5 L and 4: 50(iv) 2 kg: 80 kg and 25 g: 625 kg |
|
Answer» I couldn't understand 4th question. please get understand in right way.thank you |
|
| 1975. |
. A fourth of the guestsAt a party, colas, squash and fruit iuice were offered to guests. Adrank colas, a third drank squash, two fifthsdrink any thing. How many guests were in all? |
| Answer» | |
| 1976. |
2Raj drank some pepsi from a 500 ml bottle. He found thatHow much did he drink?was remainin |
|
Answer» (3/5)*500ml = 300ml. he drink 300ml from the Pepsi |
|
| 1977. |
4) Aman earns 3980 every month. How much does he earn in 3 years? |
|
Answer» 35280 is correct answer 980×36 =35280is the right answer |
|
| 1978. |
2.Rai drank some pepsi from a 500 ml bottle. He found thatHow much did he drink?was remaininght clice nizza Find t |
| Answer» | |
| 1979. |
105(V)/3.502.Find the> 0 30th term of the A.P. 10, 7, 4 ...✓11 th term of the A.P. : -3.3.2....whic3.Find the respective terms for the following APs.0 4 = 2; a = 26 finda m= 13; 4-3 find abirt(m) 4, = 5; 0,9 find a, a (iv) a=-4; 46 = 6 find a, aV) a, = 38; 4 --22 find a,, 43, 4, asWhich term of the AP:3, 8, 13, 18,...,is 78?Find the number of terms in each of the following APs :4.5.0 7,13, 19,..., 205 ( 18,15 , 13,..., -476. . Check whether, -150 is a term of the AP: 11, 8, 5,2...7. Find the 31s' term of an AP whose 11th term is 38 and the 16th term is 73.8. If the 3 and the 9th terms of an AP are 4 and - 8 respectively; which term of this APzero?9. The 17" term of an AP exceeds its 10h term by 7. Find the common difference10. Two APs have the same common difference. The difference between their 100this 100, what is the difference between their 1000th terms?II. How many three-digit numbers are divisible by 7?12. How many multiples of 4 lie between 10 and 250?13. For what value of n, are the nth terms of two APs: 63, 65, 67. ... and 3, 10,equal?14. Determine the AP whose third term is 16 and the 7th term exceeds the 5 term15.SHOT ON REDMI NOTE 7Find the 20th term from the end of the AP:3, 8, 13,...,253. |
|
Answer» do the followinv step tn=a +( n -1)×dand sn = n/2(2a+(n-1)×d)put the values and geg the answer |
|
| 1980. |
Find 5th term of an AP whose nth term is 3n-5. |
| Answer» | |
| 1981. |
I. Choose the correct option for each question1. The first term of an AP whose 6th term is 5 and the 10th term is 9 is(a) 4.(b) 10(c) 0 |
| Answer» | |
| 1982. |
The 5th term of an arithmetic sequence is 38 and the 9h term is 66.What is its 25th term? |
|
Answer» 25th term is 178 thank you very much |
|
| 1983. |
: Determine the AP whose 3rd term is 5 and the 7th term is9 |
| Answer» | |
| 1984. |
A chord of a circle of radius 10 cm subtends a right angle at the centre.Find the arc corresponding to the :(i) minor segment(ii)major sector. (Use π=3.14) |
| Answer» | |
| 1985. |
9000 for 2 years 4 months at 10% per annum compounded annually. |
|
Answer» thanks |
|
| 1986. |
(B) 11 cm, 200 cm(D) 11 cm, 241 c 2CIT, 100 cmIn a circle of radius 21 cm, an arc subtends an angle of 60° at thethe area of the minor segment is and the area of the major segment is(A),41 cm2, 1355 cmcentre, th40.05 cm2, 1155 cm2A chord AB of a circle ofragjus 15(B) 40 стр. 1 255 cm2(D) 39,05 cm2, 1100 cm2CE |
| Answer» | |
| 1987. |
in a circle with radius r a minor arc subtends an angle of measures theta |
|
Answer» txs bhai |
|
| 1988. |
On selling a bat for ă200, aman gains40. His gain % is |
|
Answer» Selling price=200 RsGain=40RsSo,cost price=200-40=160 Rs Gain%=Gain*100/CP =40*100/160=25% |
|
| 1989. |
19. In a circle of radius 10.5 cm, the minor arc is one-fifth of the major arc.Find the area of the sector corresponding to the major arc. |
| Answer» | |
| 1990. |
A father's age is 3 times the sum of ages of his two sons. Five years later he will be twice the sum of ages of his two sons. Find the present age of the father. |
|
Answer» F=3(S1+S2)F+5=2(S1+5+S2+5)=2(S1+S2)+20so F=2(S1+S2)+203(S1+S2)=2(S1+S2)+20so S1+S2=20so F=3×20=60 Years |
|
| 1991. |
Aman earns 980 every month. How much does he earn in 3 years? |
|
Answer» The man earn Rs.35280 in 3 years 980*36=35280 in 3 year |
|
| 1992. |
Thinking about the Text1. Here aresome headings for paragraphs in the texths) for each title against the headin. WriteThe first one tuntheparagrapis) Einstein's equation9i) Einstein meets his future wife(ii) The making of a violinistliv) Mileva and Einstein's mother(y) A letter that launched the arms race(vi) A desk drawer full of ideas(vii) Marriage and divorce |
| Answer» | |
| 1993. |
A father's age is 3 times the sum of ages of his two sons. Five years later he will be twice the sum of ages of his two sons. Find the present age of the father |
|
Answer» let the age of father be x and the sum of age of sum of two son be yx=3yx+5=2(y+10)x+5=2y+20x=2y+153y=2y+15y=15yrx=3(15)=45yr |
|
| 1994. |
6. Three sons aged 10 years, 6 years and 3 yearsinherit their father's property in the ratio oftheir age. The youngest gets Rs. 75,000, whatwas the total property worth?(A) Rs. 2,25,000 (B) Rs. 4,75,000(C) Rs. 7,50,000 (D) Rs. 7,00,000(E) of these |
|
Answer» ans is e money is in ratio of ages so 10:6:3so 3 is equivalent to 75000so total property 19*75000/3=475000 |
|
| 1995. |
A man 37 years old ond his two sons are 8years and 3 yeass old respectively. Aftes howmany years will he be twice as oll as the sum of the ages of his sons |
| Answer» | |
| 1996. |
father is aged three times more than his son rohit. After 8 years, he would be two and a half times of Rohit's age. After further 8 years, how many times would he be of Rohit's age? |
|
Answer» Let Rohit's age be x.Father's age = 3x.According to the question, 3x+8 = 2.5(x+8)=> 0.5x = 12=> x = 24.Rohit's present age = 24 years old.Rohit's age after (8+8) years = 24 + 16 = 40 years old. PLEASE HIT THE LIKE BUTTON |
|
| 1997. |
20 दि जरद-नस्ायू O14. Find pip valess of K qon whaich *yeal snd dual nsets :Sl - R SR g R "f'*दिसर 61 न ब( 4 जन >तैसशरर hos |
|
Answer» For real and equal roots, determinat should be zero.D=0b^2 -4ac=0(2k)^2-4(k^2-k+2)=04k^2 -4k^2 +4k -8=0k=2 hit like if you find it useful |
|
| 1998. |
8/Find the amount and the compound interest onて10,000 for 11 years at 10% perannum, compounded half yearly. Would this interest be more than the interest hewould get if it was compounded azully? |
| Answer» | |
| 1999. |
yeal4. Find A, if P-764,000, R7.5 % pa. and T1 year, compounded every four months. |
|
Answer» A = 64000(1+7.5/300)(1+7.5/300)(1+7.5/300) = 64000(1+0.025)(1+0.025)(1+0.025) = 68921 If you find this answer helpful then like it. |
|
| 2000. |
would have gor JUEach yeal a tree grows 5cm less than it did the preadingyear. If it grew by Im in the first year, then in how manyu willhave ceased growing, 437+97-3. if |
|
Answer» Hey its part of an Arithmetic progressionan Arithmetic progression(AP) isa sequence of numbers in which each differs from the preceding one by a constant quantityinwhich a(first term) = 100 cmd(common difference) = -5cmAn(nth term) = 0cmn = ?thereforeAn = a + (n-1)d0 = 100 -5n + 5-105 = - 5n21 = nhence in the 21 st year the tree will stop growing |
|