InterviewSolution
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 7251. |
Units of temperature in SI system A) °C B) Kelvin C) Calorie D) A (or) B |
|
Answer» Correct option is B) Kelvin |
|
| 7252. |
ONGC की स्थापना किस वर्ष में की गयी थी ?(A) 1947 में(B) 1951 में(C) 1955 में(D) 1959 में |
|
Answer» सही विकल्प है (D) 1959 में |
|
| 7253. |
The definition of an urban area given in which year was liberal?(A) In 1991(B) In 1981(C) In 1971(D) In 1951 |
|
Answer» Correct option is (A) In 1991 |
|
| 7254. |
स्थानांतरण के आर्थिक कारणों की चर्चा कीजिए । |
|
Answer» स्थानांतरण के आर्थिक कारण निम्नानुसार हैं :
|
|
| 7255. |
__________ amount of heat is required to raise the temperature of 100 g of kerosene from 10 °C to 30 °C (Given: specific heat of kerosene is 0.51 kcal/kg °C)(A) 0.102 kcal (B) 1.02 kcal (C) 10.2 kcal (D) 102 kcal |
|
Answer» Correct option is: (B) 1.02 kcal |
|
| 7256. |
किस वर्ष में नगर की दी गयी परिभाषा उदार थी ?(A) 1991 में(B) 1981 में(C) 1971 में(D) 1951 में |
|
Answer» सही विकल्प है (D) 1951 में |
|
| 7257. |
भारत में रेलवे के विकास को संक्षिप्त में समझाइए । |
|
Answer» वाहनव्यवहार क्षेत्र में विश्व में रेलवे का विकास क्रांतिकारी गिना जाता है । भारत में रेलवे का विकास अंग्रेजों ने आर्थिक हित
|
|
| 7258. |
वर्ष 2050 तक विश्व की कितनी जनसंख्या शहरों में निवास कर रही होगी ?(A) 1/2(B) 1/4(C) 2/3(D) 3/9 |
|
Answer» सही विकल्प है (C) 2/3 |
|
| 7259. |
बिजली की व्याख्या करें. |
|
Answer» आर्थिक विकास के लिए सबसे महत्त्वपूर्ण चालक बल बिजली को मान सकते हैं । गाँव और शहर दोनों के विकास के लिए बिजली अनिवार्य है । ग्रामीण विस्तारों में कृषि, सिंचाई, गृह और छोटे पैमाने के उद्योगों का विकास बिजली का आभारी है । इसी प्रकार औद्योगिक विकास एवं सेवा के विकास के लिए भी बिजली आवश्यक है । भारत में बिजली का उत्पादन 1950-’51 में 2300 मेगावॉट थी जो जुलाई 2009 में बढ़कर 154,574 मेगावॉट (MW) हो गयी । इस प्रकार बिजली में अनेक गुना । वृद्धि हुयी है । इसकी असर उद्योग, सेवा और कृषि विभाग के विकास पर दे सकते हैं । बिजली के उत्पादन में भारत का स्थान 7वाँ हैं । परंतु उपयोग में 5वें क्रम पर है ।
वर्ष 2012-’13 में थर्मल पावर द्वारा 70% हाइड्रोपावर और विन्ड (पवनचक्की) पावर द्वारा 16% न्यूक्लियर पावर द्वारा 2% और 12% बिजली अन्य के द्वारा प्राप्त की जाती है । इन सबमें से प्रदूषण मुक्त बिजली उत्पादन के लिए सरकार हाइड्रोपावर और विन्डपावर पर अधिक प्रोत्साहन दे रही है । |
|
| 7260. |
एशिया खंड में रेलवे नेटवर्क के सम्बन्ध भारत का स्थान कौन-सा है ? |
|
Answer» एशिया खंड में रेलवे नेटवर्क के सम्बन्ध में भारत का स्थान प्रथम है । |
|
| 7261. |
रेलवे नेटवर्क के सम्बन्ध में विश्व में भारत का स्थान कौन-सा है ? |
|
Answer» रेलवे नेटवर्क के सम्बन्ध में विश्व में भारत का स्थान चौथा है । |
|
| 7262. |
बिजली क्षेत्र के सामने चुनौतियों की चर्चा कीजिए । |
|
Answer» बिजली ऊर्जा का महत्त्वपूर्ण स्रोत है । सरकार बिजली के उत्पादन के लिए प्रयत्नशील है । फिरभी बिजली क्षेत्र को अनेक चुनौतियों
|
|
| 7263. |
2011 की जनगणना के अनुसार कितने करोड़ लोग शहरों में निवास करते थे ? |
|
Answer» 2011 की जनगणना के अनुसार 37.7 करोड़ (31.16%) लोग शहरों में निवास करते थे । |
|
| 7264. |
भारत में सबसे बड़ा सार्वजनिक साहस कौन-सा है ?(A) बिजली(B) बीमा(C) पेट्रोलियम(D) रेलवे |
|
Answer» सही विकल्प है (D) रेलवे |
|
| 7265. |
पेट्रोलियम की व्याख्या करें. |
|
Answer» ऊर्जा का सबसे महत्त्वपूर्ण स्रोत पेट्रोलियम है । पेट्रोलियम का उपयोग वाहनों में ईंधन के रुप में महत्त्वपूर्ण है । अद्यतन टेक्नोलोजी उत्पादन के लिए अधिकतर पेट्रोलियम उत्पादन पर आधार रखती है । पेट्रोलियम का परिचय निम्नानुसार है :
|
|
| 7266. |
वर्ष 2012-’13 मे कृषि में बिजली का कितना उपयोग होता था ?(A) 22%(B) 18%(C) 45%(D) 2% |
|
Answer» सही विकल्प है (B) 18% |
|
| 7267. |
ग्राम्य समाज का आर्थिक रीति से कमजोर वर्ग शहरों में अनिवार्य रुप से जाना पड़ता है यह स्थानांतरण(A) आकर्षण(B) अपाकर्षण(C) आंतरिक(D) बाह्य |
|
Answer» सही विकल्प है (B) अपाकर्षण |
|
| 7268. |
वर्ष 2012-13 में थर्मल पावर द्वारा कितने प्रतिशत हाइड्रोपावर बिजली का उत्पादन होता था ? ।(A) 70%(B) 50%(C) 80%(D) 90% |
|
Answer» सही विकल्प है (A) 70% |
|
| 7269. |
ग्रामीण लोग शहरी जीवन से प्रभावित होकर शहरों में स्थानांतरण करे तो वह किस प्रकार का स्थानांतरण है ?(A) आकर्षण(B) अपाकर्षण(C) राष्ट्रीय(D) अन्तर्राष्ट्रीय |
|
Answer» सही विकल्प है (A) आकर्षण |
|
| 7270. |
ग्रामीण विस्तार से युवक-युवती शहरी विस्तार की ओर पलायन करते हैं । समझाइए । |
|
Answer» ग्रामीण विस्तार के युवक-युवती अधिकांशत: 18 से 25 वर्ष की आयु के होते हैं । वे अपनी स्कूल की शिक्षा प्राप्त करने के बाद उन्हें ग्रामीण विस्तार में अपनी योग्यता अनुसार रोजगार नहीं मिलता है । वे लोग शहर में जाकर शिक्षा के कारण अपनी योग्यतानुसार काम ढूँढ़ लेते हैं । कभी-कभी तो उच्च शिक्षण प्राप्त करने की व्यवस्था भी ग्रामीण विस्तार में न होने से शहरी विस्तार की ओर जाना पड़ता है । फिर 18 से 25 वर्ष के युवक अधिक साहसी एवं जोखम उठानेवाले होते हैं। उनमें कुछ कर गुजरने की क्षमता होती है । परिणामस्वरूप अपने भविष्य का लक्ष्य प्राप्त करने के लिए वे शहरी विस्तार की ओर स्थानांतर करते हैं। इस प्रकार भारत में ग्रामीण विस्तार से शहरी विस्तार की ओर पलायन करते हैं । |
|
| 7271. |
अपाकर्षण स्थानांतरण किसे कहते हैं ? |
|
Answer» जब ग्रामीण समाज में निवास करनेवाले लोग धंधे, व्यवसाय या नोकरी के पर्याप्त अवसर अपने गाँव में न हों या आर्थिक प्रवृत्ति के लिए दूसरा विकल्प न हो या अपर्याप्त हो, शिक्षा के पर्याप्त अवसर न हो तब उन्हें अनिवार्य रुप से शहरों में आना पड़ता है तो उसे अपाकर्षण स्थानांतरण कहते हैं । अपाकर्षण परिबलों में प्राकृतिक आपदाएँ, मानवसर्जित दंगे, युद्ध, रूढिचुस्त वातावरण, जड़ प्रवृत्ति आदि का भी समावेश होता है । क्योंकि इन कारणों से भी अनिवार्य रुप से शहरों में जाना जाता है । |
|
| 7272. |
भारत में तेल (पेट्रोलियम) का भंडार कहाँ मिला ?(A) गुजरात(B) असम(C) झारखंड(D) उड़ीसा |
|
Answer» सही विकल्प है (B) असम |
|
| 7273. |
2011 की जनगणना के अनुसार भारत में कितना लिंगानुपात है?(क) 927(ख) 931(ग) 940(घ) 935 |
|
Answer» सही विकल्प है (ग) 940 |
|
| 7274. |
वर्ष 2012 में बालमृत्यु का प्रमाण कितना था ?(A) 40(B) 44(C) 50(D) 64 |
|
Answer» सही विकल्प है (B) 44 |
|
| 7275. |
ग्राम्य विस्तार में से शहरी विस्तार में होनेवाली जनसंख्या के स्थानांतरण को क्या कहते हैं ?(A) उदारीकरण(B) निजीकरण(C) वैश्वीकरण(D) शहरीकरण |
|
Answer» सही विकल्प है (D) शहरीकरण |
|
| 7276. |
2012 में भारत में बालमृत्यु का प्रमाण कितना था ? |
|
Answer» 2012 में भारत में बालमृत्यु का प्रमाण 44 था । |
|
| 7277. |
2011 की जनणना के अनुसार भारत में साक्षरता दर है –(क) 74.04%(ख) 70.85%(ग) 75.85%(घ) 80.0% |
|
Answer» सही विकल्प है (क) 74.04% |
|
| 7278. |
वर्ष 2011 में शहरी जनसंख्या का प्रमाण कितना था ?(A) 17.97%(B) 19.97%(C) 31.16%(D) 27.86% |
|
Answer» सही विकल्प है (C) 31.16% |
|
| 7279. |
2011 में गुजरात में साक्षरता का प्रमाण कितने प्रतिशत था ?(A) 74.04%(B) 52.21%(C) 79.31%(D) 69.14% |
|
Answer» सही विकल्प है (C) 79.31% |
|
| 7280. |
What is atomicity ? |
|
Answer» The number of atoms constituting a molecule is known as its atomicity. |
|
| 7281. |
Determine the empirical formula of an oxide of iron which has 69.9% iron and 30.1% dioxygen by mass |
||||||||||||||||||
Answer»
Empirical formula = Fe2O3 |
|||||||||||||||||||
| 7282. |
Determine the empirical formula of an oxide of iron which has 69.9% iron and 30.1% dioxygen by mass. |
|
Answer» % of iron by mass = 69.9 % [Given] % of oxygen by mass = 30.1 % [Given] Atomic mass of iron = 55.85 amu Atomic mass of oxygen = 16.00 amu Relative moles of iron in iron oxide =%mass of iron/Atomic mass of iron = 69.9/55.85 = 1.25 Relative moles of oxygen in iron oxide = %mass of oxygen /Atomic mass of oxygen = 30.01/16=1.88 Simplest molar ratio = 1.25/1.25 : 1.88/1.25 ⇒ 1 : 1.5 = 2 : 3 ∴ The empirical formula of the iron oxide is Fe2O3. |
|
| 7283. |
Calculate the mass of sodium acetate (CH3COONa) required to make 500 mL of 0.375 molar aqueous solution. Molar mass of sodium acetate is 82.0245 g mol-1. |
|
Answer» Mass of sodium acetate required to make 1000 mL of 1 M aqueous solution = 82.0245 g Mass of sodium acetate required to make 500 mL of 1 M aqueous solution = {82.0245 x 500}/{1000} = {82.0245}/{2} g Mass of sodium acetate required to make 500 mL of 0.375 molar aqueous solution = {82.0245 x 0.375}/{2} = 15.38 g |
|
| 7284. |
Determine the molecular formula of an oxide in which mass percent of iron and oxygen are 69.9 and 30.1 respectively. |
||||||||||||||||||
Answer»
Empirical formula = Fe2O3 Molecular formula = Fe2O3 |
|||||||||||||||||||
| 7285. |
How much copper can be obtained from 100 g of copper sulphate (CuSO4)? |
|
Answer» Molar mass of CuSO4 = 63.6 + 32 + 64 = 159.6 g 159.6 g CuSO4 gives 63.6 g copper 100 g CuSO4 will give = {63.6 x 100}/{159.6} g copper = 39.85 g copper |
|
| 7286. |
The average molar mass of a mixture of methane (CH4) and ethane (C2H4) present in the ratio of x : y is found to be 20.0 g mol-1. If the ratio was reversed, what would be the molar mass of the mixture? |
|
Answer» Molar mass of CH4 = 12 + 1(4) = 16 g mol–1 Molar mass of C2H4 = 2(12) + 1(4) 28 g mol–1 When these molecules are present in the x: y, their average molar mass = \(\frac{\mathrm{x}\times16\times y\times28}{\mathrm{x}+y} \) = 20 g mol-1 i.e. 16x + 28y = 20(x + y) or 4x + 7y = 5(x + y) or x = 2y or \(\frac{\mathrm{x}}{y}\) = \(\frac{2}{1}\) = 2 : 1 If the ratio is reversed, now ratio x : y = 1 : 2 \(\therefore\) Average molar mass = \(\frac{1\times16+2\times20}{1+2}\) = 24 g mol–1 |
|
| 7287. |
Calculate the concentration of nitric acid in moles per litre in a sample which has a density, 1.41 g mL-1 and the mass percent of nitric acid in it being 69%. |
|
Answer» 69% HNO3 by mass means 69 g of HNO3 is present 100 g of solution. Volume of solution = Mass/Density = 100/1.41 = 70.9 mL-3 Molar mass of HNO3 = 1 + 14 + 48 = 63 u Moles of HNO3 = 69/63 = 1.09 Concentration = {1.09 x 1000}/{70.9} = 15.37 moles per litre |
|
| 7288. |
How is tert-butyl alcohol obtained from acetone? |
|
Answer» Tert-butyl alcohol obtained by treating acetone with Grignard’s reagent CH3COCH3 + CH3MgBr → [(CH3)3C-OMgBr] + H+/H2O → (CH3)3C-OH + Mg (OH) Br |
|
| 7289. |
How can propan-2-one be converted into tert- butyl alcohol? |
| Answer» Using Grignard reagent | |
| 7290. |
10 mL of H2 combine with 5 mL of O2 to form water. When 200 mL of H2 at STP is passed over heated CuO, the CuO loses 0.144 g of its weight. Does the above data correspond to the law of constant composition? |
|
Answer» In the second reaction, 0.144 g weight is lost from CuO which is due to reduction of CuO into Cu. We can say that 0.144 g oxygen is combined with 200 mL H2. \(\because\) 32 g oxygen occupies 22400 mL volume at STP \(\therefore\) 0.144 g oxygen will occupy = \(\frac{2240}{32}\) x 0.144 = 100.8 mL of O2 \(\therefore\) Ratio of H2 and O2 in water = 200 : 100.8 = 2 : 1 This ratio is equivalent to first reaction (i.e. 10 : 5 or 2 : 1). Hence, the above data corresponds to the law of constant composition. |
|
| 7291. |
Calculate the concentration of nitric acid in moles per litre in a sample which has a density, 1.41 g mL-1 and the mass percent of nitric acid in it being 69%. |
|
Answer» 69 mass percent of nitric acid means that 69 g of HNO3 are present in 100 g of solution. Volume of solution = Mass/Density = 100g/1.41mL−1 = 70.92 mL Moles of HNO3 = 69/63 = 1.095 Therefore Molarity = Moles of HNO3 /Volume of solution (in ml ) x 1000 = 1.095/70.92 x 1000 = 15.44 M |
|
| 7292. |
Which of these weighs most? (i) 32 g of oxygen, (ii) 2 g atom of hydrogen, (iii) 0.5 mole of Fe, (iv) 3.01 × 1023 atoms of carbon. |
|
Answer» (i) 32 g of oxygen weighs most. (ii) 2 g atom of H2 = 2g (iii) 0.5 mole of Fe = mole × atomic weight = 0.5 × 56 = 28 g (iv) 6.022 × 1023 = 1 atom of d 3.01 × 1023 atoms of C = 1/2 × 12 = 6 g. |
|
| 7293. |
How is tert-butyl alcohol obtained from acetone? |
|
Answer» This is obtained by treating acetone with Grignard’s reagent. CH3COCH3+ CH3MgBr → [(CH3)3C-OMgBr] H + /H2O → (CH3)3C-OH + Mg (OH) Br |
|
| 7294. |
What is the molarity of a solution of methanol in water in which the mole fraction of methanol is 0.25. |
|
Answer» 1 mole of solution contains 0.25 mol of methanol and 1 – 0.25 = 0.75 mol of water. Mass of water = 0.75 x 18 = 13.5 Molality of methanol solution = Moles of Methanol/ Mass of solvent x 1000 0.25/13.5 x 100 = 18.5 m |
|
| 7295. |
How many atoms are present in 4 ml of NH3 at STP? |
|
Answer» 22400 ml of NH3 contains = 4 × 6.022 × 1023 atoms [∵ NH3 contains 4 atoms]. 1ml of NH3 contains = (4 x 6.022 x 1023)/22400 = 1.07 × 1020 atoms. |
|
| 7296. |
Calculate the molarity of a solution of ethanol in water in which the mole fraction of ethanol is 0.040 (assume the density of water to be one). |
|
Answer» Mole fraction of C2H5OH = No. of moles of C2H5OH/No. of moles of solution n(C2H5OH) = n(C2H5OH)/n(C2H5OH)+n(H2O) = 0.040 (Given) ……..Eqn. 1 We have to find the number of moles of ethanol in 1L of the solution but the solution is dilute. Therefore, water is approximately 1L. No. of moles in 1L of water = 1000g/18g mol-1 = 55.55 mol Substituting n(H2O) = 55.55 in eqn 1 n(C2H5OH)/n (C2H5OH) + 55.55 = 0.040 ⇒ 0.96n(C2H5OH) = 55.55 × 0.040⇒ n(C2H5OH) = 2.31 molHence, molarity of the solution = 2.31M |
|
| 7297. |
Calculate the molarity of pure water (density of water = 1 g mL-1 ). |
|
Answer» Density of water = 1 g mL-1 Mass of 1000 mL of water = Volume x Density 1000 x 1 = 1000 g Moles of water = 1000/18 = 55.55 Now, 55.55 moles of H2O are present in 1000 ml or 1L of water. Therefore Molarity = 55.55 M. |
|
| 7298. |
500 mL of NH3 contains 6.00 x 1023 molecules at N.T.P. How many molecules are present in 100 mL of CO2 at N.T.P.? (a) 6 x 1023(b) 1.5 x 1021(c) 5.88 x 1.023(d) 1.5 x 1022 |
|
Answer» Correct option is (b) 1.5 x 1021 |
|
| 7299. |
What will be the molarity of a solution, which contains 5.85 g of NaCl(s) per 500 mL?(i) 4 mol L–1(ii) 20 mol L–1(iii) 0.2 mol L–1(iv) 2 mol L–1 |
|
Answer» (iii) 0.2 mol L–1 |
|
| 7300. |
Calculate molarity of water if its density is 1.00g mL–1 . |
|
Answer» Volume of solution = \(\frac{mass}{density}\) Molar mass of H2O = 1(2) + 16 = 18 Molarity = \(\frac{No.\,of\,moles\,of\,solute}{Volume\,of\,solution}\) = \(\frac{Density}{Molar\,mass\,of\,H_2O}\) = \(\frac{1000}{18}\) = 55.56 M |
|